/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Free solutions & answers for Organic Chemistry Chapter 17 - (Page 1) [step by step] | 91Ó°ÊÓ

91Ó°ÊÓ

Problem 10

Draw a structural formula for each salt. (a) Sodium benzoate (b) Lithium acetate (c) Ammonium acetate (d) Disodium adipate (e) Sodium salicylate (f) Calcium butanoate

Problem 12

Potassium sorbate is added as a preservative to certain foods to prevent bacteria and molds from causing food spoilage and to extend the foods' shelf life. The IUPAC name of potassium sorbate is potassium \((2 E, 4 E)-2,4\)-hexadienoate. Draw a structural formula for potassium sorbate.

Problem 14

On a cyclohexane ring, an axial carboxyl group has a conformational energy of \(5.9 \mathrm{~kJ}\) (1.4 kcal)/mol relative to an equatorial carboxyl group. Consider the equilibrium for the alternative chair conformations of trans-1,4-cyclohexanedicarboxylic acid. Draw the less stable chair conformation on the left of the equilibrium arrows and the more stable chair on the right. Calculate \(\Delta G^{0}\) for the equilibrium as written, and calculate the ratio of the more stable chair to the less stable chair at \(25^{\circ} \mathrm{C}\).

Problem 16

Acetic acid has a boiling point of \(118^{\circ} \mathrm{C}\), whereas its methyl ester has a boiling point of \(57^{\circ} \mathrm{C}\). Account for the fact that the boiling point of acetic acid is higher than that of its methyl ester, even though acetic acid has a lower molecular weight.

Problem 17

Given here are \({ }^{1} \mathrm{H}-\mathrm{NMR}\) and \({ }^{19} \mathrm{C}-\mathrm{NMR}\) spectral data for nine compounds. Each compound shows strong absorption between 1720 and \(1700 \mathrm{~cm}^{-1}\), and strong, broad absorption over the region \(2500-3300 \mathrm{~cm}^{-1}\). Propose a structural formula for each compound. Refer to Appendices 4,5, and 6 for spectral correlation tables. $$ \begin{aligned} &\text { (a) } \mathrm{C}_{5} \mathrm{H}_{10} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 0.94(\mathrm{t}, 3 \mathrm{H}) & 180.71 \\ 1.39(\mathrm{~m}, 2 \mathrm{H}) & 33.89 \\ 1.62(\mathrm{~m}, 2 \mathrm{H}) & 26.76 \\ 2.35(\mathrm{t}, 2 \mathrm{H}) & 22.21 \\ 12.0(\mathrm{~s}, 1 \mathrm{H}) & 13.69 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (b) } \mathrm{C}_{6} \mathrm{H}_{12} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{19} \text { C-NMR } \\ \hline 1.08(\mathrm{~s}, 9 \mathrm{H}) & 179.29 \\ 2.23(\mathrm{~s}, 2 \mathrm{H}) & 47.82 \\ 12.1(\mathrm{~s}, 1 \mathrm{H}) & 30.62 \\ & 29.57 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (c) } \mathrm{C}_{5} \mathrm{H}_{8} \mathrm{O}_{4}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 0.93(\mathrm{t}, 3 \mathrm{H}) & 170.94 \\ 1.80(\mathrm{~m}, 2 \mathrm{H}) & 53.28 \\ 3.10(\mathrm{t}, 1 \mathrm{H}) & 21.90 \\ 12.7(\mathrm{~s}, 2 \mathrm{H}) & 11.81 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (d) } \mathrm{C}_{5} \mathrm{H}_{8} \mathrm{O}_{4}\\\ &\begin{array}{cr} \hline{ }^{1} \text { H-NMR } & { }^{19} \text { C-NMR } \\ \hline 1.29(\mathrm{~s}, 6 \mathrm{H}) & 174.01 \\ 12.8(\mathrm{~s}, 2 \mathrm{H}) & 48.77 \\ & 22.56 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (e) } \mathrm{C}_{4} \mathrm{H}_{6} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 1.91(\mathrm{~d}, 3 \mathrm{H}) & 172.26 \\ 5.86(\mathrm{~d}, 1 \mathrm{H}) & 147.53 \\ 7.10(\mathrm{~m}, 1 \mathrm{H}) & 122.24 \\ 12.4(\mathrm{~s}, 1 \mathrm{H}) & 18.11 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (f) } \mathrm{C}_{3} \mathrm{H}_{4} \mathrm{Cl}_{2} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{19} \text { C-NMR } \\ \hline 2.34(\mathrm{~s}, 3 \mathrm{H}) & 171.82 \\ 11.3(\mathrm{~s}, 1 \mathrm{H}) & 79.36 \\ & 34.02 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (g) } \mathrm{C}_{5} \mathrm{H}_{8} \mathrm{Cl}_{2} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 1.42(\mathrm{~s}, 6 \mathrm{H}) & 180.15 \\ 6.10(\mathrm{~s}, 1 \mathrm{H}) & 77.78 \\ 12.4(\mathrm{~s}, 1 \mathrm{H}) & 51.88 \\ & 20.71 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (h) } \mathrm{C}_{5} \mathrm{H}_{9} \mathrm{BrO}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 0.97(\mathrm{t}, 3 \mathrm{H}) & 176.36 \\ 1.50(\mathrm{~m}, 2 \mathrm{H}) & 45.08 \\ 2.05(\mathrm{~m}, 2 \mathrm{H}) & 36.49 \\ 4.25(\mathrm{t}, 1 \mathrm{H}) & 20.48 \\ 12.1(\mathrm{~s}, 1 \mathrm{H}) & 13.24 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (i) } \mathrm{C}_{4} \mathrm{H}_{8} \mathrm{O}_{3}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 2.62(\mathrm{t}, 2 \mathrm{H}) & 177.33 \\ 3.38(\mathrm{~s}, 3 \mathrm{H}) & 67.55 \\ 3.68(\mathrm{~s}, 2 \mathrm{H}) & 58.72 \\ 11.5(\mathrm{~s}, 1 \mathrm{H}) & 34.75 \\ \hline \end{array} \end{aligned} $$

Problem 20

Show how to prepare pentanoic acid from each compound. (a) 1-Pentanol (b) Pentanal (c) 1-Pentene (d) 1-Butanol (e) 1-Bromopropane (f) 1-Hexene

Problem 24

The reaction of an \(\alpha\)-diketone with concentrated sodium or potassium hydroxide to give the salt of an \(\alpha\)-hydroxyacid is given the general name benzil-benzilic acid rearrangement. It is illustrated by the conversion of benzil to sodium benzilate and then to benzilic acid. Propose a mechanism for this rearrangement. O=C(O)C(=O)C(=O)c1ccccc1 O=C(O)C(O)(c1ccccc1)C(O)(c1ccccc1)c1ccccc1 Benzil Sodium benzilate Benzilic acid

Problem 25

Select the stronger acid in each set. (a) Phenol \(\left(\mathrm{p} K_{\mathrm{a}} 9.95\right)\) and benzoic acid \(\left(\mathrm{p} K_{\mathrm{a}} 4.19\right)\) (b) Lactic acid \(\left(K_{a} 8.4 \times 10^{-4}\right)\) and ascorbic acid \(\left(K_{a} 7.9 \times 10^{-5}\right)\)

Problem 27

Low-molecular-weight dicarboxylic acids normally exhibit two different \(\mathrm{p} K_{\mathrm{a}}\) values. Ionization of the first carboxyl group is easier than the second. This effect diminishes with molecular size, and, for adipic acid and longer chain dicarboxylic acids, the two acid ionization constants differ by about one \(\mathrm{p} K\) unit. $$ \begin{array}{llcc} \hline \begin{array}{l} \text { Dicarboxylic } \end{array} & \text { Structural } & & \\ \hline \text { Oxalic } & \text { Formula } & \mathrm{p} K_{\mathrm{a} 1} & \mathrm{p} K_{\mathrm{a} 2} \\ \text { Malonic } & \mathrm{HOOCCOOH} & 1.23 & 4.19 \\ \text { Succinic } & \mathrm{HOOCCH}{ }_{2} \mathrm{COOH} & 2.83 & 5.69 \\ \text { Glutaric } & \mathrm{HOOC}\left(\mathrm{CH}_{2}\right)_{2} \mathrm{COOH} & 4.16 & 5.61 \\ \text { Adipic } & \mathrm{HOOC}\left(\mathrm{CH}_{2}\right)_{3} \mathrm{COOH} & 4.31 & 5.41 \\ \hline \end{array} $$ Why do the two \(\mathrm{p} K_{\mathrm{a}}\) values differ more for the shorter chain dicarboxylic acids than for the longer chain dicarboxylic acids?

Problem 29

The normal pH range for blood plasma is \(7.35-7.45\). Under these conditions, would you expect the carboxyl group of lactic acid \(\left(\mathrm{p} K_{\mathrm{a}} 3.08\right)\) to exist primarily as a carboxyl group or as a carboxylic anion? Explain.

Access millions of textbook solutions in one place

  • Access over 3 million high quality textbook solutions
  • Access our popular flashcard, quiz, mock-exam and notes features
  • Access our smart AI features to upgrade your learning
Access millions of textbook solutions in one place

Recommended explanations on Chemistry Textbooks