/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 27 Low-molecular-weight dicarboxyli... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Low-molecular-weight dicarboxylic acids normally exhibit two different \(\mathrm{p} K_{\mathrm{a}}\) values. Ionization of the first carboxyl group is easier than the second. This effect diminishes with molecular size, and, for adipic acid and longer chain dicarboxylic acids, the two acid ionization constants differ by about one \(\mathrm{p} K\) unit. $$ \begin{array}{llcc} \hline \begin{array}{l} \text { Dicarboxylic } \end{array} & \text { Structural } & & \\ \hline \text { Oxalic } & \text { Formula } & \mathrm{p} K_{\mathrm{a} 1} & \mathrm{p} K_{\mathrm{a} 2} \\ \text { Malonic } & \mathrm{HOOCCOOH} & 1.23 & 4.19 \\ \text { Succinic } & \mathrm{HOOCCH}{ }_{2} \mathrm{COOH} & 2.83 & 5.69 \\ \text { Glutaric } & \mathrm{HOOC}\left(\mathrm{CH}_{2}\right)_{2} \mathrm{COOH} & 4.16 & 5.61 \\ \text { Adipic } & \mathrm{HOOC}\left(\mathrm{CH}_{2}\right)_{3} \mathrm{COOH} & 4.31 & 5.41 \\ \hline \end{array} $$ Why do the two \(\mathrm{p} K_{\mathrm{a}}\) values differ more for the shorter chain dicarboxylic acids than for the longer chain dicarboxylic acids?

Short Answer

Expert verified
Answer: The difference in pKa values is larger for shorter chain dicarboxylic acids because the two carboxyl groups are in closer proximity in smaller molecules. This close proximity allows the negative charge on the first ionized carboxylate group to stabilize the positive charge on the second carboxyl group, making it harder to ionize. As the molecular size increases, the electrostatic interaction between the carboxyl groups decreases, leading to a smaller difference in pKa values for longer chain dicarboxylic acids.

Step by step solution

01

Understanding dicarboxylic acids and ionization properties

Dicarboxylic acids are compounds containing two carboxyl groups (-COOH). When these carboxyl groups lose a proton (H+), they ionize, forming carboxylate anions (-COO-). The pKa value of an acid is a measure of its ionization, representing the pH at which half of the carboxyl groups have ionized. A lower pKa value indicates a stronger acid (greater ease of ionization).
02

Analyzing given data to identify the trend in pKa values

Using the given data, we see that the difference between pKa values (pKa1 and pKa2) is larger for shorter-chain dicarboxylic acids such as oxalic and malonic acids than for longer-chain dicarboxylic acids such as adipic acid. The data shows that the difference in pKa values decreases as the molecular size or chain length increases.
03

Explaining the effect of molecular size on pKa values

The larger difference in pKa values for shorter-chain dicarboxylic acids is due to the proximity of the two carboxyl groups. Since these groups are closer together in smaller molecules, the negative charge on the first ionized carboxylate group can stabilize the positive charge on the second carboxyl group, making it harder to ionize. The negative charges can be stabilized on the same molecule due to electrostatic attraction with the remaining proton in the second carboxyl group.
04

Describing the diminishing effect of molecular size on pKa values

The electrostatic interaction between the two carboxyl groups decreases as the chain length or molecular size increases. In larger molecules like adipic acid and longer-chain dicarboxylic acids, the carboxyl groups are farther apart, reducing the impact of the first ionization on the second ionization. Consequently, the difference in pKa values for the successive ionization decreases as the molecular size increases.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Understanding Acid Ionization Constants
When discussing dicarboxylic acids, grasping the concept of acid ionization constants is crucial. Acid ionization constants, which are quantitatively expressed as pKa values, tell us about the acidity of a molecule—the lower the pKa, the stronger the acid. Think of pKa as a numeric scale where each number indicates how comfortably an acid donates its proton (H+).

Understanding pKa is akin to understanding the willingness of a person to lend money; the lower the value, the more generous the lender. In the context of dicarboxylic acids, each carboxyl group has its own pKa value, revealing how it will behave in different pH environments. Generally, during ionization, one carboxyl group will donate its proton more readily than the other, leading to two distinct pKa values for a single dicarboxylic acid molecule.

Why is this important? In biochemical processes or industrial applications, the specific pKa values can influence reaction outcomes, solubility, and compound reactivity. For students, understanding these numbers is key to predicting how these molecules will react under various circumstances.
Molecular Size Effect on Acidity
You might wonder how something as straightforward as molecular size could impact acidity. This effect is significant in the world of carboxylic acids. Larger molecular sizes tend to exhibit closer pKa values between their two carboxyl groups, unlike their smaller counterparts.

For imagery, picture a short rope with a weight attached at each end; those weights influence each other strongly because they're close. In chemistry, this is akin to oxalic acid, where both carboxyl groups closely 'feel' each other’s presence, resulting in a bigger difference between their pKa values. As the molecular 'rope' gets longer, like in adipic acid, the 'weights' barely have any influence over one another, hence the pKa values differ less.

Another angle to understand this is through charge distribution. In smaller molecules, negative charges can influence nearby parts more strongly, affecting the molecule's reactivity. When the chains grow longer, the charges disperse more easily, making the molecule's overall reactivity more uniform and less influenced by the ionization state of a single group.
Carboxyl Group Ionization
Diving deeper into the ionization of carboxyl groups will shed light on why dicarboxylic acids have varying pKa values. A carboxyl group is made up of a carbon atom double-bonded to an oxygen atom and single-bonded to a hydroxyl group (-COOH). When it ionizes, it loses a hydrogen ion (proton) and becomes negatively charged (-COO-).

This process matters significantly because the negative charge left behind influences the molecule's properties. In the case of dicarboxylic acids, the first carboxyl group to ionize stabilizes the molecule, but it simultaneously makes the second group less inclined to lose its proton, as the negative charges repel each other.

In simpler terms, it's like two neighboring magnets with the same poles facing each other—they push apart. This is more intense when the groups are closer, like in small molecules. As a result, the first carboxyl group tends to have a much lower pKa than the second, especially in smaller dicarboxylic acids. When a student understands this push-and-pull game between carboxyl groups, it becomes easier to visualize their ionization behavior and predict the pKa values.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Given here are \({ }^{1} \mathrm{H}-\mathrm{NMR}\) and \({ }^{19} \mathrm{C}-\mathrm{NMR}\) spectral data for nine compounds. Each compound shows strong absorption between 1720 and \(1700 \mathrm{~cm}^{-1}\), and strong, broad absorption over the region \(2500-3300 \mathrm{~cm}^{-1}\). Propose a structural formula for each compound. Refer to Appendices 4,5, and 6 for spectral correlation tables. $$ \begin{aligned} &\text { (a) } \mathrm{C}_{5} \mathrm{H}_{10} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 0.94(\mathrm{t}, 3 \mathrm{H}) & 180.71 \\ 1.39(\mathrm{~m}, 2 \mathrm{H}) & 33.89 \\ 1.62(\mathrm{~m}, 2 \mathrm{H}) & 26.76 \\ 2.35(\mathrm{t}, 2 \mathrm{H}) & 22.21 \\ 12.0(\mathrm{~s}, 1 \mathrm{H}) & 13.69 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (b) } \mathrm{C}_{6} \mathrm{H}_{12} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{19} \text { C-NMR } \\ \hline 1.08(\mathrm{~s}, 9 \mathrm{H}) & 179.29 \\ 2.23(\mathrm{~s}, 2 \mathrm{H}) & 47.82 \\ 12.1(\mathrm{~s}, 1 \mathrm{H}) & 30.62 \\ & 29.57 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (c) } \mathrm{C}_{5} \mathrm{H}_{8} \mathrm{O}_{4}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 0.93(\mathrm{t}, 3 \mathrm{H}) & 170.94 \\ 1.80(\mathrm{~m}, 2 \mathrm{H}) & 53.28 \\ 3.10(\mathrm{t}, 1 \mathrm{H}) & 21.90 \\ 12.7(\mathrm{~s}, 2 \mathrm{H}) & 11.81 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (d) } \mathrm{C}_{5} \mathrm{H}_{8} \mathrm{O}_{4}\\\ &\begin{array}{cr} \hline{ }^{1} \text { H-NMR } & { }^{19} \text { C-NMR } \\ \hline 1.29(\mathrm{~s}, 6 \mathrm{H}) & 174.01 \\ 12.8(\mathrm{~s}, 2 \mathrm{H}) & 48.77 \\ & 22.56 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (e) } \mathrm{C}_{4} \mathrm{H}_{6} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 1.91(\mathrm{~d}, 3 \mathrm{H}) & 172.26 \\ 5.86(\mathrm{~d}, 1 \mathrm{H}) & 147.53 \\ 7.10(\mathrm{~m}, 1 \mathrm{H}) & 122.24 \\ 12.4(\mathrm{~s}, 1 \mathrm{H}) & 18.11 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (f) } \mathrm{C}_{3} \mathrm{H}_{4} \mathrm{Cl}_{2} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{19} \text { C-NMR } \\ \hline 2.34(\mathrm{~s}, 3 \mathrm{H}) & 171.82 \\ 11.3(\mathrm{~s}, 1 \mathrm{H}) & 79.36 \\ & 34.02 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (g) } \mathrm{C}_{5} \mathrm{H}_{8} \mathrm{Cl}_{2} \mathrm{O}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 1.42(\mathrm{~s}, 6 \mathrm{H}) & 180.15 \\ 6.10(\mathrm{~s}, 1 \mathrm{H}) & 77.78 \\ 12.4(\mathrm{~s}, 1 \mathrm{H}) & 51.88 \\ & 20.71 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (h) } \mathrm{C}_{5} \mathrm{H}_{9} \mathrm{BrO}_{2}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 0.97(\mathrm{t}, 3 \mathrm{H}) & 176.36 \\ 1.50(\mathrm{~m}, 2 \mathrm{H}) & 45.08 \\ 2.05(\mathrm{~m}, 2 \mathrm{H}) & 36.49 \\ 4.25(\mathrm{t}, 1 \mathrm{H}) & 20.48 \\ 12.1(\mathrm{~s}, 1 \mathrm{H}) & 13.24 \\ \hline \end{array} \end{aligned} $$ $$ \begin{aligned} &\text { (i) } \mathrm{C}_{4} \mathrm{H}_{8} \mathrm{O}_{3}\\\ &\begin{array}{cc} \hline{ }^{1} \text { H-NMR } & { }^{13} \text { C-NMR } \\ \hline 2.62(\mathrm{t}, 2 \mathrm{H}) & 177.33 \\ 3.38(\mathrm{~s}, 3 \mathrm{H}) & 67.55 \\ 3.68(\mathrm{~s}, 2 \mathrm{H}) & 58.72 \\ 11.5(\mathrm{~s}, 1 \mathrm{H}) & 34.75 \\ \hline \end{array} \end{aligned} $$

Show how to prepare pentanoic acid from each compound. (a) 1-Pentanol (b) Pentanal (c) 1-Pentene (d) 1-Butanol (e) 1-Bromopropane (f) 1-Hexene

Potassium sorbate is added as a preservative to certain foods to prevent bacteria and molds from causing food spoilage and to extend the foods' shelf life. The IUPAC name of potassium sorbate is potassium \((2 E, 4 E)-2,4\)-hexadienoate. Draw a structural formula for potassium sorbate.

When 4-hydroxybutanoic acid is treated with an acid catalyst, it forms a lactone (a cyclic ester). Draw the structural formula of this lactone, and propose a mechanism for its formation.

The reaction of an \(\alpha\)-diketone with concentrated sodium or potassium hydroxide to give the salt of an \(\alpha\)-hydroxyacid is given the general name benzil-benzilic acid rearrangement. It is illustrated by the conversion of benzil to sodium benzilate and then to benzilic acid. Propose a mechanism for this rearrangement. O=C(O)C(=O)C(=O)c1ccccc1 O=C(O)C(O)(c1ccccc1)C(O)(c1ccccc1)c1ccccc1 Benzil Sodium benzilate Benzilic acid

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.