/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 104 Consider the following two acids... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Consider the following two acids: O=C(O)c1ccccc1O Salicylic acid $\mathrm{HO}_{2} \mathrm{CCH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{CO}_{2} \mathrm{H}$ Adipic acid $\mathrm{p} K_{\mathrm{a}_{\mathrm{l}}}=4.4 \mathrm{l} ; \mathrm{p} K_{\mathrm{L}_{3}}=5.28$ In two separate experiments the \(\mathrm{pH}\) was measured during the titration of \(5.00 \mathrm{mmol}\) of each acid with $0.200 \mathrm{M} \mathrm{NaOH}$. Each experiment showed only one stoichiometric point when the data were plotted. In one experiment the stoichiometric point was at $25.00 \mathrm{~mL}\( added \)\mathrm{NaOH}$, and in the other experiment the stoichiometric point was at \(50.00 \mathrm{~mL} \mathrm{NaOH}\). Explain these results. (See Exercise 103.)

Short Answer

Expert verified
The titration results can be explained by identifying that Salicylic acid is monoprotic and Adipic acid is diprotic. In the experiment with the stoichiometric point at 25.00 mL added NaOH, Salicylic acid is the titrated monoprotic acid, as it requires equal moles of NaOH as the moles of the acid. Meanwhile, the experiment with the stoichiometric point at 50.00 mL added NaOH corresponds to Adipic acid, a diprotic acid that requires twice as many moles of NaOH as the moles of the acid to reach the stoichiometric point.

Step by step solution

01

Identifying the monoprotic and diprotic acid

The first step in understanding these results is to recognize that Salicylic acid is monoprotic (having one ionizable hydrogen), and Adipic acid is diprotic (having two ionizable hydrogens). Adipic acid also has given pKa values, indicating its two dissociable protons.
02

Calculate the amount of NaOH needed to reach the stoichiometric point for each acid

To find the stoichiometric point of a reaction, we can use the formula: moles of acid = moles of base First, let's calculate the moles of each acid to be titrated: For both acids: moles = 5.00 mmol Now, we can calculate the moles of NaOH needed to reach the stoichiometric point for each acid: For Salicylic acid (monoprotic): moles of NaOH = (1 moles of NaOH / 1 moles of acid) × 5.00 mmol = 5.00 mmol For Adipic acid (diprotic): moles of NaOH = (2 moles of NaOH / 1 moles of acid) × 5.00 mmol = 10.00 mmol
03

Calculate the volume of NaOH required for the stoichiometric point of each reaction

Now we can use the moles and the concentration of NaOH to calculate the volume of NaOH required to reach the stoichiometric point for each reaction: Concentration * Volume = moles For Salicylic acid: 0.200 M * Volume = 5.00 mmol Volume = \( \frac{5.00}{0.200} \) mL = 25.00 mL For Adipic acid: 0.200 M * Volume = 10.00 mmol Volume = \( \frac{10.00}{0.200} \) mL = 50.00 mL
04

Explain the titration results based on stoichiometric points

Since our calculations show that Salicylic acid requires 25.00 mL of NaOH, and Adipic acid requires 50.00 mL of NaOH to reach the stoichiometric point, we can now understand the experimental results: The experiment with the stoichiometric point at 25.00 mL added NaOH refers to the titration of Salicylic acid, a monoprotic acid because it requires equal moles of NaOH as the moles of the acid. The experiment with the stoichiometric point at 50.00 mL added NaOH refers to the titration of Adipic acid, a diprotic acid because it requires twice as many moles of NaOH as the moles of the acid to reach the stoichiometric point.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

A friend asks the following: "Consider a buffered solution made up of the weak acid HA and its salt NaA. If a strong base like \(\mathrm{NaOH}\) is added, the HA reacts with the \(\mathrm{OH}^{-}\) to form \(\mathrm{A}^{-}\). Thus the amount of acid (HA) is decreased, and the amount of base \(\left(\mathrm{A}^{-}\right)\) is increased. Analogously, adding \(\mathrm{HCl}\) to the buffered solution forms more of the acid (HA) by reacting with the base \(\left(\mathrm{A}^{-}\right) .\) Thus how can we claim that a buffered solution resists changes in the \(\mathrm{pH}\) of the solution?' How would you explain buffering to this friend?

A certain buffer is made by dissolving \(\mathrm{NaHCO}_{3}\) and \(\mathrm{Na}_{2} \mathrm{CO}_{3}\) in some water. Write equations to show how this buffer neutralizes added \(\mathrm{H}^{+}\) and \(\overline{\mathrm{OH}}^{-}\).

Methyl red has the following structure: CN(C)c1ccc(N=Nc2ccccc2C(=O)O)cc1 It undergoes a color change from red to yellow as a solution gets more basic. Calculate an approximate \(\mathrm{pH}\) range for which methyl red is useful. What is the color change and the \(\mathrm{pH}\) at the color change when a weak acid is titrated with a strong base using methyl red as an indicator? What is the color change and the \(\mathrm{pH}\) at the color change when a weak base is titrated with a strong acid using methyl red as an indicator? For which of these two types of titrations is methyl red a possible indicator?

In the titration of \(50.0 \mathrm{~mL}\) of \(1.0 \mathrm{M}\) methylamine, \(\mathrm{CH}_{3} \mathrm{NH}_{2}\) \(\left(K_{\mathrm{b}}=4.4 \times 10^{-4}\right)\), with \(0.50 \mathrm{M} \mathrm{HCl}\), calculate the \(\mathrm{pH}\) under the following conditions. a. after \(50.0 \mathrm{~mL}\) of \(0.50 \mathrm{M} \mathrm{HCl}\) has been added b. at the stoichiometric point

Consider the titration of \(80.0 \mathrm{~mL}\) of \(0.100 \mathrm{M} \mathrm{Ba}(\mathrm{OH})_{2}\), by \(0.400\) \(M\) HCl. Calculate the pH of the resulting solution after the following volumes of \(\mathrm{HCl}\) have been added. a. \(0.0 \mathrm{~mL}\) d. \(40.0 \mathrm{~mL}\) b. \(20.0 \mathrm{~mL}\) e. \(80.0 \mathrm{~mL}\) c. \(30.0 \mathrm{~mL}\)

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.