/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 22 The increasing order of atomic r... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

The increasing order of atomic radii of the following Group 13 elements is (A) \(\quad \mathrm{Al}<\mathrm{Ga}<\operatorname{In}<\mathrm{Tl}\) (B) \(\quad G a

Short Answer

Expert verified
The increasing order of atomic radii is \textbf{(D) Al < Ga < Tl < In}.

Step by step solution

01

Understand the Periodic Trend

The general trend for atomic radii is that it increases down a group as each element has an additional electron shell. In group 13, Thallium (Tl) has the most electron shells, followed by Indium (In), Gallium (Ga), and then Aluminum (Al).
02

Consider Anomalies in the Trend

Due to the presence of the d-block and the f-block elements, certain irregularities can arise. Gallium (Ga) has a slightly smaller atomic radius than expected because of the addition of d electrons, which do not shield the outer electrons as effectively. This results in a higher effective nuclear charge and subsequently, a smaller radius.
03

Arrange the Elements

Given the periodic trend and the exceptions, the correct order of increasing atomic radii is: Aluminum (Al) has the smallest radius, followed by Gallium (Ga), as it is anomalously small. The next larger radius belongs to Thallium (Tl), which has more electron shells, and finally, Indium (In) has the largest radius.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Periodic Trends in Atomic Radii
Understanding the periodic trends in atomic radii is crucial for grasping the properties of elements within the periodic table. The atomic radius refers to the size of an atom, typically measured by the distance from the nucleus to the outer boundary of the electron cloud.

Generally speaking, atomic radii increase going down a group in the periodic table. This trend occurs because each subsequent element down a group has an additional electron shell, adding another layer of electrons that increases the overall size of the atom. As each new layer is further from the nucleus, the electrons experience less attraction from the nuclear charge, allowing the radius to expand.

For instance, Group 13 elements showcase this trend with Thallium (Tl) having more electron shells than Indium (In), which in turn has more than Gallium (Ga) and Aluminum (Al). As we move down from Aluminum to Thallium, we can generally expect an increase in atomic size.
Atomic Radius Anomalies
Although periodic trends can guide our understanding, various anomalies can disrupt the expected pattern of atomic sizes. One such anomaly occurs in Group 13, especially notable with Gallium (Ga). In an anomaly within the periodic trend, Gallium has an atomic radius smaller than expected when compared to Aluminum (Al).

This surprising result is due to Gallium's electronic structure. Gallium has electron shells that contain d-electrons from the preceding transition metal series, which are poor at shielding the nuclear charge from the outermost s- and p-electrons. This reduced shielding effect leads to a greater effective nuclear charge felt by the outer electrons, pulling them closer to the nucleus and decreasing the atomic radius.

Understanding these anomalies is crucial because they help explain deviations from the expected trend and assist in predicting the chemical and physical properties of elements.
Effective Nuclear Charge
The effective nuclear charge (Zeff) is a fundamental concept that gets to the heart of why atomic radius anomalies occur. Zeff is the net positive charge experienced by an electron in a multi-electron atom. It is the actual nuclear charge (Z) minus the shielding effect caused by the electrons between the nucleus and the electron of interest.

As the number of protons in the nucleus increases across a period, so does the nuclear charge. However, electrons in the same shell are not very effective at shielding each other from this charge. Consequently, the effective nuclear charge felt by the outer electrons increases, pulling them closer to the nucleus and resulting in smaller atomic radii.

For example, in Gallium (Ga), despite having more protons than Aluminum (Al), the d-electrons do not provide efficient shielding. Thus, Ga's outer electrons feel a stronger Zeff, reducing its radius unexpectedly when compared to the general trend. Understanding Zeff helps explain why certain elements break from the expected pattern, providing a deeper insight into the structure and behavior of atoms in various groups of the periodic table.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

The position vector \(\vec{r}\) of a particle of mass \(m\) is given by the following equation $$ \vec{r}(t)=\alpha t^{3} \hat{i}+\beta t^{2} \hat{j}, $$ where \(\alpha=10 / 3 \mathrm{~m} \mathrm{~s}^{-3}, \beta=5 \mathrm{~m} \mathrm{~s}^{-2}\) and \(m=0.1 \mathrm{~kg} .\) At \(t=1 \mathrm{~s}\), which of the following statement(s) is(are) true about the particle? (A) The velocity \(\vec{v}\) is given by \(\vec{v}=(10 \hat{i}+10 \hat{j}) \mathrm{ms}^{-1}\) (B) The angular momentum \(\vec{L}\) with respect to the origin is given by \(\vec{L}=-(5 / 3) \hat{k} \mathrm{~N} \mathrm{~m} \mathrm{~s}\) (C) The force \(\vec{F}\) is given by \(\vec{F}=(\hat{i}+2 \hat{j}) \mathrm{N}\) (D) The torque \(\vec{t}\) with respect to the origin is given by \(\vec{t}=-(20 / 3) \hat{k} \mathrm{Nm}\)

Positive Tollen's test is observed for (A) O=Cc1ccccc1 (B) O=Cc1ccccc1 (C) O=C(O)C(c1ccccc1)c1ccccc1 (D) O=C(C=Cc1ccccc1)c1ccccc1

Let \(R S\) be the diameter of the circle \(x^{2}+y^{2}=1\), where \(S\) is the point \((1,0)\). Let \(P\) be a variable point (other than \(R\) and \(S\) ) on the circle and tangents to the circle at \(S\) and \(P\) meet at the point \(Q .\) The normal to the circle at \(P\) intersects a line drawn through \(Q\) parallel to \(R S\) at point \(E\). Then the locus of \(E\) passes through the point(s) (A) \(\left(\frac{1}{3}, \frac{1}{\sqrt{3}}\right)\) (B) \(\left(\frac{1}{4}, \frac{1}{2}\right)\) (C) \(\left(\frac{1}{3},-\frac{1}{\sqrt{3}}\right)\) (D) \(\left(\frac{1}{4},-\frac{1}{2}\right)\)

Let \(-\frac{\pi}{6}<\theta<-\frac{\pi}{12} .\) Suppose \(\alpha_{1}\) and \(\beta_{1}\) are the roots of the equation \(x^{2}-2 x \sec \theta+1=0\) and \(\alpha_{2}\) and \(\beta_{2}\) are the roots of the equation \(x^{2}+2 x \tan \theta-1=0\). If \(\alpha_{1}>\beta_{1}\) and \(\alpha_{2}>\beta_{2}\), then \(\alpha_{1}+\beta_{2}\) equals (A) \(2(\sec \theta-\tan \theta)\) (B) \(2 \sec \theta\) (C) \(-2 \tan \theta\) (D) 0

An incandescent bulb has a thin filament of tungsten that is heated to high temperature by passing an electric current. The hot filament emits black-body radiation. The filament is observed to break up at randon locations after a sufficiently long time of operation due to non-uniform evaporation of tungsten from the filament. If the bulb is powered at constant voltage, which of the following statement(s) is(are) true? (A) The temperature distribution over the filament is uniform (B) The resistance over small sections of the filament decreases with time (C) The filament emits more light at higher band of frequencies before it breaks up (D) The filament consumes less electrical power towards the end of the life of the bulb

See all solutions

Recommended explanations on English Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.