/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 24 According to the Arrhenius equat... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

According to the Arrhenius equation, (A) a high activation energy usually implies a fast reaction. (B) rate constant increases with increase in temperature. This is due to a greater number of collisions whose energy exceeds the activation energy. (C) higher the magnitude of activation energy, stronger is the temperature dependence of the rate constant. (D) the pre-exponential factor is a measure of the rate at which collisions occur, irrespective of their energy.

Short Answer

Expert verified
The correct statements are (B) rate constant increases with an increase in temperature, (C) higher activation energy results in stronger temperature dependence of the rate constant, and (D) the pre-exponential factor measures the rate of collisions regardless of energy.

Step by step solution

01

Understand the Arrhenius Equation

The Arrhenius equation describes how the rate constant (k) of a chemical reaction depends on temperature and the activation energy (Ea). The equation is given by \[ k = A e^{\frac{-Ea}{RT}} \] where \( k \) is the rate constant, \( A \) is the pre-exponential factor (or frequency factor), \( Ea \) is the activation energy, \( R \) is the gas constant, and \( T \) is the temperature in Kelvin.
02

Analyze Option (A)

Option (A) suggests that a high activation energy implies a fast reaction. This is not correct because a higher activation energy means that fewer molecules will have sufficient energy to overcome the energy barrier at a given temperature, leading to a slower reaction. Thus, the rate of a reaction decreases with increasing activation energy.
03

Validate Option (B)

Option (B) claims that the rate constant increases with an increase in temperature. This is correct because, as temperature increases, more molecules have sufficient kinetic energy to overcome the activation energy barrier, resulting in more successful collisions and a higher rate constant.
04

Evaluate Option (C)

Option (C) states that a higher magnitude of activation energy results in a stronger temperature dependence of the rate constant. This is true because according to the Arrhenius equation, a larger \( Ea \) results in a more significant change in \( k \) for a given change in temperature, since \( e^{\frac{-Ea}{RT}} \) is more sensitive to changes in \( T \) when \( Ea \) is large.
05

Consider Option (D)

Option (D) remarks that the pre-exponential factor \( A \) is a measure of the rate at which collisions occur, irrespective of their energy. This is accurate as \( A \) includes factors like the frequency of collisions and their orientation, but it does not consider the energy of the collisions. The energy aspect is accounted for by the exponential term involving activation energy in the Arrhenius equation.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Chemical Reaction Rate
The speed at which a chemical reaction occurs is referred to as the chemical reaction rate. This rate can be affected by several factors, including the presence of catalysts, the concentration of reactants, and the temperature of the reaction environment. The rate at which reactants are converted to products is essential for understanding how quickly a reaction proceeds and is usually expressed in terms of the change in concentration of a reactant or product over time.

According to the Arrhenius equation, the rate of a reaction is directly related to the rate constant (\( k \)). A higher rate constant indicates a faster reaction, given that all other conditions remain the same. This concept is crucial for students to grasp as they explore how different variables can influence the speed of chemical transformations.
Activation Energy
The term activation energy (\( E_a \)) refers to the minimum amount of energy that reacting molecules must possess for a reaction to occur. It represents an energy barrier that reactants must overcome to transform into products. A higher activation energy means that fewer molecules have the requisite energy to react at a given temperature, leading to a slower reaction rate.

Understanding activation energy is critical because it explains why some reactions proceed readily at room temperature while others require the addition of heat. The concept helps students comprehend why certain reactions are inherently faster or slower irrespective of the conditions.
Temperature Dependence
The temperature dependence of a reaction rate is described by the Arrhenius equation, which shows how the rate constant (\( k \)) changes with temperature (\( T \)). Generally, as temperature increases, so does the rate constant, and thus the reaction rate accelerates. This increase occurs because a higher temperature provides more energy to the reactant molecules, which in turn increases the chances that collisions will have enough energy to overcome the activation barrier.

Understanding the temperature dependency helps students predict how varying temperatures will affect the speed of chemical reactions. It is especially important in chemical engineering and industrial processes where precise control of reaction rates is necessary.
Rate Constant
The rate constant (\( k \)) in the Arrhenius equation is a proportionality constant that relates the reaction rate to the concentration of reactants. It is a measure of the intrinsic reactivity of a reaction system at a specific temperature. The value of the rate constant provides insight into the kinetics of a reaction and changes with temperature as described by the Arrhenius equation: \[ k = A e^{\frac{-Ea}{RT}} \]

The examination of rate constants allows students to predict reaction behavior under different conditions and is fundamental to the study of reaction kinetics. By understanding how the rate constant varies, students can better understand the factors that control the speed of reactions.
Pre-exponential Factor
The pre-exponential factor (\( A \)) in the Arrhenius equation is also called the frequency factor. It represents the frequency of collisions and the correct orientation of reactant molecules necessary for a reaction to occur. It is important to note that while this factor includes the number of collisions, it does not take into account their energies; this energy aspect is instead represented by the exponential term involving activation energy.

The pre-exponential factor helps in understanding how molecular interactions and steric factors affect the reaction rate. For students, grasping the concept of the pre-exponential factor is essential in predicting how variations in molecular size, shape, and chemical environment can influence the rate of reactions.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

The reagent/s) that can selectively precipitate \(\mathrm{S}^{2-}\) from a mixture of \(\mathrm{S}^{2-}\) and \(\mathrm{SO}_{4}{ }^{2-}\) in aqueous solution is(are) (A) \(\mathrm{CuCl}_{2}\) (B) \(\mathrm{BaCl}_{2}\) (C) \(\mathrm{Pb}\left(\mathrm{OOCCH}_{3}\right)_{2}\) (D) \(\mathrm{Na}_{2}\left[\mathrm{Fe}(\mathrm{CN})_{5} \mathrm{NO}\right]\)

A uniforin wooden stick of mass \(1.6 \mathrm{~kg}\) and length \(i\) rests in an inclined manner on a smooth, vertical wall of height \(h(

An incandescent bulb has a thin filament of tungsten that is heated to high temperature by passing an electric current. The hot filament emits black-body radiation. The filament is observed to break up at randon locations after a sufficiently long time of operation due to non-uniform evaporation of tungsten from the filament. If the bulb is powered at constant voltage, which of the following statement(s) is(are) true? (A) The temperature distribution over the filament is uniform (B) The resistance over small sections of the filament decreases with time (C) The filament emits more light at higher band of frequencies before it breaks up (D) The filament consumes less electrical power towards the end of the life of the bulb

One mole of an ideal gas at \(300 \mathrm{~K}\) in thermal contact with surroundings expands isothermally from \(1.0 \mathrm{~L}\) to \(2.0 \mathrm{~L}\) against a constant pressure of \(3.0\) atm. In this process, the change in entropy of surroundings \(\left(\triangle S_{\text {aur }}\right)\) in \(J \mathrm{~K}^{-1}\) is \((1 \mathrm{~L}\) atm \(=101.3 \mathrm{~J}\) ) (A) \(5.763\) (B) \(1.013\) (C) \(-1.013\) (D) \(-5.763\)

Positive Tollen's test is observed for (A) O=Cc1ccccc1 (B) O=Cc1ccccc1 (C) O=C(O)C(c1ccccc1)c1ccccc1 (D) O=C(C=Cc1ccccc1)c1ccccc1

See all solutions

Recommended explanations on English Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.