Chapter 6: Problem 18
Draw a structural formula of an alkene that undergoes acid-catalyzed hydration to give each alcohol as the major product (more than one alkene may give each alcohol as the major product). (a) S-Hexanol (b) 1-Methylcyclobutanol (c) 2-Methyl-2-butanol (d) 2-Propanol
Short Answer
Expert verified
Answer: The alkenes that will produce the specified alcohols upon acid-catalyzed hydration are (a) 2-Hexene, (b) 1-Methylcyclobutene, (c) 2-Methyl-1-Butene, and (d) 1-Propene.
Step by step solution
01
Identify the alcohol structure
S-Hexanol has a hydroxyl group (-OH) on the third carbon atom in a straight-chain hexane molecule.
Structure: CH3-CH2-CH(OH)-CH2-CH2-CH3
02
Determine the alkene that will produce S-Hexanol upon acid-catalyzed hydration
We need to find an alkene that will follow Markovnikov's rule and produce the observed alcohol when an -OH group is added. The alkene which will produce S-Hexanol upon hydration is:
Alkene: CH3-CH2-CH=CH-CH2-CH3 (2-Hexene)
(b) 1-Methylcyclobutanol:
03
Identify the alcohol structure
1-Methylcyclobutanol has a hydroxyl group (-OH) on the first carbon atom and a methyl group (CH3) on the second carbon atom in a cyclobutane ring.
Structure:
CH3
|
C
/ \
C - OH
/ \
C C
04
Determine the alkene that will produce 1-Methylcyclobutanol upon acid-catalyzed hydration
The alkene which will produce 1-Methylcyclobutanol upon hydration is:
Alkene:
CH3
|
C
/ \
C = C
/ \
C C
(c) 2-Methyl-2-butanol:
05
Identify the alcohol structure
2-Methyl-2-butanol has a hydroxyl group (-OH) on the second carbon atom and a methyl group (CH3) on the same carbon atom in a straight-chain butane molecule.
Structure: CH3-C(CH3)(OH)-CH2-CH3
06
Determine the alkene that will produce 2-Methyl-2-butanol upon acid-catalyzed hydration
The alkene which will produce 2-Methyl-2-butanol upon hydration is:
Alkene: CH3-C(CH3)=CH-CH3 (2-Methyl-1-Butene)
(d) 2-Propanol:
07
Identify the alcohol structure
2-Propanol has a hydroxyl group (-OH) on the second carbon atom in a straight-chain propane molecule.
Structure: CH3-CH(OH)-CH3
08
Determine the alkene that will produce 2-Propanol upon acid-catalyzed hydration
The alkene which will produce 2-Propanol upon hydration is:
Alkene: CH3-CH=CH2 (1-Propene)
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Alkene
Alkenes are a fundamental component of organic chemistry. They are hydrocarbons characterized by the presence of at least one carbon-carbon double bond (C=C).
This double bond is the source of their unique chemical reactivity, setting them apart from alkanes, which only contain single bonds. Alkenes are unsaturated compounds, meaning they have fewer hydrogen atoms than alkanes with the same number of carbon atoms.
The double bond allows alkenes to participate in various chemical reactions, including additions, where new atoms can be added to the carbon atoms of the double bond.
In acid-catalyzed hydration, an alkene reacts with water in the presence of an acid to form an alcohol. This reaction involves the addition of a hydroxyl group (-OH) and follows Markovnikov's rule to identify the major product.
This double bond is the source of their unique chemical reactivity, setting them apart from alkanes, which only contain single bonds. Alkenes are unsaturated compounds, meaning they have fewer hydrogen atoms than alkanes with the same number of carbon atoms.
The double bond allows alkenes to participate in various chemical reactions, including additions, where new atoms can be added to the carbon atoms of the double bond.
In acid-catalyzed hydration, an alkene reacts with water in the presence of an acid to form an alcohol. This reaction involves the addition of a hydroxyl group (-OH) and follows Markovnikov's rule to identify the major product.
- Formula: general formula for alkenes is CnH2n.
- Reactivity: highly reactive due to the presence of the double bond.
- Structure: planar around the double bond allowing for reactions to take place.
Markovnikov's Rule
Markovnikov's rule is a key principle in predicting the outcome of reactions involving addition across an unsymmetrical double bond in alkenes. Named after the Russian chemist Vladimir Markovnikov, it states that when an unsymmetrical reagent, such as HX or water (in acid-catalyzed hydration), adds to an unsymmetrical alkene, the hydrogen atom (H) will attach to the carbon with more hydrogen atoms, and the other part (X or OH) will attach to the carbon with fewer hydrogen atoms.
Essentially, "hydrogen will go where hydrogen is already present," leading to the more stable carbocation intermediate. This helps in determining the structure of the major product of such reactions.
For instance, applying Markovnikov's rule will correctly predict that in acid-catalyzed hydration, the -OH group will attach to the more substituted carbon atom in the alkene:
Essentially, "hydrogen will go where hydrogen is already present," leading to the more stable carbocation intermediate. This helps in determining the structure of the major product of such reactions.
For instance, applying Markovnikov's rule will correctly predict that in acid-catalyzed hydration, the -OH group will attach to the more substituted carbon atom in the alkene:
- Stability: more stable carbocation intermediates are formed.
- Predicts Products: used to determine major product with greater accuracy.
- Solution Guide: helps in exercises where multiple products can form.
Structural Formula
A structural formula is a way to represent a molecule showing how the atoms are arranged and bonded together. It provides more information than a simple molecular formula, which only shows the number and type of atoms.
In organic chemistry, structural formulas are crucial because they depict the connectivity and arrangement of atoms explicitly. This includes the position of functional groups like hydroxyls (-OH) in alcohols.
For alkenes, the structural formula highlights the location of double bonds within the compound, which is crucial for predicting the behavior in reactions like hydrations. Understanding the structural formula allows chemists to visualize molecular shapes, which can influence reaction pathways and mechanisms.
In organic chemistry, structural formulas are crucial because they depict the connectivity and arrangement of atoms explicitly. This includes the position of functional groups like hydroxyls (-OH) in alcohols.
For alkenes, the structural formula highlights the location of double bonds within the compound, which is crucial for predicting the behavior in reactions like hydrations. Understanding the structural formula allows chemists to visualize molecular shapes, which can influence reaction pathways and mechanisms.
- Detail: shows both structural arrangement and connectivity of atoms.
- Guides Reaction Understanding: predicting reaction progressions and outcomes.
- Functional Groups: identifies critical parts influencing reactivity in the molecule.
Organic Chemistry
Organic chemistry is the branch of chemistry that deals with the structure, properties, and reactions of organic compounds, which contain carbon atoms.
It's a vast field because carbon can form stable bonds with many other elements, including hydrogen, oxygen, nitrogen, and many others, forming a limitless variety of compounds.
Alkenes are a part of this domain, and understanding their chemistry, including reactions like acid-catalyzed hydration, is essential for many applications in both academic and industrial settings. Organic chemistry also covers concepts like isomerism, molecular structures, reaction mechanisms, and synthesis techniques that are vital for creating and modifying organic molecules.
It's a vast field because carbon can form stable bonds with many other elements, including hydrogen, oxygen, nitrogen, and many others, forming a limitless variety of compounds.
Alkenes are a part of this domain, and understanding their chemistry, including reactions like acid-catalyzed hydration, is essential for many applications in both academic and industrial settings. Organic chemistry also covers concepts like isomerism, molecular structures, reaction mechanisms, and synthesis techniques that are vital for creating and modifying organic molecules.
- Carbon's Versatility: forms diverse and complex molecules.
- Relevance in Life: core to biomolecules and materials.
- Applications: used in designing pharmaceuticals, dyes, plastics, etc.