/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 49 Following is a retrosynthetic an... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Following is a retrosynthetic analysis for the acaracide (killing mites and ticks) and fungicide dinocap. CC=CC(=O)Oc1c(C(C)C)cc([N+](=O)[O-])cc1[N+](=O)[O-] CC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1 Oc1ccccc1 Dinocap (a) Given this analysis, propose a synthesis for dinocap from phenol and l-octene. (b) Is dinocap chiral? If so, which of the possible stereoisomers are formed in this synthesis?

Short Answer

Expert verified
Question: Propose a synthesis of dinocap from phenol and l-octene based on the given retrosynthetic analysis and determine if dinocap is chiral and identify the possible stereoisomers formed in the synthesis. Answer: The synthesis of dinocap from phenol and l-octene involves three main steps. First, nitration of phenol to form 2,4-dinitrophenol. Second, reaction between 2,4-dinitrophenol and l-octene to form an intermediate with l-octene side chain in ortho position. Finally, esterification of the intermediate with l-octene to form dinocap. Dinocap is chiral and has two possible stereoisomers: R and S configurations, and during the synthesis, both enantiomers are likely to form, resulting in a racemic mixture of both stereoisomers.

Step by step solution

01

Identify the key starting materials and intermediates

Based on the given retrosynthetic analysis, we can identify the following important chemicals: 1. Dinocap: CC=CC(=O)Oc1c(C(C)C)cc([N+](=O)[O-])cc1[N+](=O)[O-] 2. Intermediate 1: CC(C)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O 3. Intermediate 2: O=[N+]([O-])c1ccc(O)c([N+](=O)[O-])c1 4. Phenol: Oc1ccccc1 5. l-Octene: CC=CCCCCC
02

Propose synthesis of dinocap from intermediates

Based on the given intermediates, the synthesis of dinocap can be proposed as follows: (a) Nitration of phenol (starting material) to form Intermediate 2: Phenol reacts with a nitrating agent, such as nitric acid (HNO3) and sulfuric acid (H2SO4), to form 2,4-dinitrophenol via electrophilic aromatic substitution. (b) Reaction between Intermediate 2 and l-octene (starting material) to form Intermediate 1: Intermediate 2 reacts with l-octene in the presence of an acid catalyst, for instance, sulfuric acid (H2SO4), through a Friedel-Crafts alkylation to form Intermediate 1, which contains the l-octene side chain in ortho position. (c) Formation of dinocap from Intermediate 1 via esterification: Intermediate 1 reacts with l-octene (starting material) in the presence of an acid catalyst or sulfuric acid (H2SO4) to form the dinocap product through esterification reaction, where the l-octene side chain becomes an ester functional group.
03

Determine chirality and possible stereoisomers of dinocap

Dinocap has a stereogenic center around the carbon next to the phenol group which has four different substituents: hydrogen, a methyl group, a phenol group, and an ester group. Therefore, dinocap is chiral and has two possible stereoisomers: R and S configurations. During the synthesis, both R and S enantiomers are likely to form, which would result in a racemic mixture of both stereoisomers.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Chirality
Chirality is a crucial concept in organic chemistry. It's like your hands; they are mirror images but not identical, meaning they cannot be superimposed on each other. This is essentially what chirality is about in molecules. A molecule is chiral if it has an atom, often carbon, connected to four different groups.

Such an atom is called a stereogenic center. In the case of dinocap, there is a stereogenic center at the carbon next to the phenol group. This carbon is connected to a hydrogen, a methyl group, a phenol group, and an ester group, making it chiral.

Understanding chirality is crucial because chiral molecules can exist in two forms, known as enantiomers. These enantiomers can interact differently with biological systems, much like how a left-handed glove won't fit a right hand.
Stereoisomers
Stereoisomers are molecules with the same molecular formula and sequence of bonded atoms but different three-dimensional orientations. In the world of stereochemistry, it's like having different arrangements while having the same components.

Enantiomers, which arise from chirality, are a type of stereoisomers. They are mirror images of each other, like left and right hands, and are not superimposable.

For dinocap, there are two stereoisomers: the R and S configurations. The R and S configurations specify the spatial arrangement and priority of substituents around the stereogenic center.

Stereoisomers are important because even small changes in the 3D arrangement can significantly influence a molecule's properties and interactions.
Electrophilic Aromatic Substitution
Electrophilic Aromatic Substitution (EAS) is a fundamental reaction in organic chemistry where an atom, usually hydrogen, on an aromatic ring is replaced by an electrophile. This type of reaction is very common in the synthesis of complex aromatic compounds.

In the synthesis of dinocap, nitration of phenol is an example of EAS. Phenol reacts with a nitrating agent, usually a mixture of nitric and sulfuric acids, introducing nitro groups into the ring to form 2,4-dinitrophenol.

The process involves the generation of a nitronium ion \(NO_2^+\), which attacks the electron-rich aromatic ring. This attack leads to the formation of a sigma complex, followed by deprotonation to restore aromaticity. The result is a substitution of a hydrogen atom by a nitro group.
Friedel-Crafts Alkylation
Friedel-Crafts Alkylation is a powerful method used to attach an alkyl group to an aromatic ring. This reaction involves the use of an alkyl halide and a Lewis acid catalyst, such as AlCl3, to form a more reactive species that can substitute a hydrogen atom on the aromatic ring.

In the synthesis of dinocap, a Friedel-Crafts Alkylation introduces an alkyl side chain from l-octene onto the nitrated phenol. The presence of sulfuric acid assists in this process, generating a carbocation from the alkene, which then attacks the aromatic ring.

This reaction highlights how modifications can be made selectively to complex molecules, building up structures through substitution reactions.
Esterification Reaction
Esterification is a chemical reaction that forms an ester as a product. Typically, this is achieved by reacting an alcohol with an acid, usually in the presence of an acid catalyst.

In the final step of dinocap synthesis, the l-octene side chain forms an ester linkage through reaction with a carboxylic acid intermediate. This conversion is crucial as it finalizes the complex structure of dinocap.

During esterification, the hydroxyl group (OH) from the acid and the hydrogen from the alcohol's OH group combine to release water, linking the remaining parts of the molecules to form an ester.
  • This reaction is important in producing flavors, fragrances, and as intermediates in pharmaceuticals.
  • Many esters are responsible for the aromas and flavors of fruits.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.