Chapter 19: Problem 36
Claisen condensation between diethyl phthalate and ethyl acetate followed by saponification, acidification, and decarboxylation forms a diketone, \(\mathrm{C}_{3} \mathrm{H}_{6} \mathrm{O}_{2}\). Propose structural formulas for compounds \(A, B\), and the diketone.
Short Answer
Expert verified
Compound A: C6H4(COOCH2CH3)(COOCH2CH2COCH3)
Compound B: C6H4(COOH)(COOCH2CH2COCH3)
Final diketone: CH3COCOCH3
Step by step solution
01
Claisen condensation between diethyl phthalate and ethyl acetate
For this reaction, the diethyl phthalate acts as an ester, while the ethyl acetate acts as the enolizable reactant. In Claisen condensation, the enolizable ester reacts with the other ester and forms a β-keto ester. The products for this step will be compound A and ethyl alcohol.
Ethyl acetate structure: CH3COOCH2CH3
Diethyl phthalate structure: C6H4(COOC2H5)2
The Claisen condensation reaction proceeds as follow:
(1) Formation of the enolate ion from the ethyl acetate by abstracting the alpha-hydrogen.
CH3COOCH2CH3 → CH3COOCH2CH2¯ (enolate ion) + H^+
(2) The enolate ion attacks the carbonyl carbon on the diethyl phthalate:
CH3COOCH2CH3 + C6H4(COOC2H5)2 → Compound A + C2H5OH
Compound A: C6H4(COOCH2CH3)(COOCH2CH2COCH3)
02
Saponification
In this step, compound A will undergo saponification, which is the base-catalyzed hydrolysis of the ester functional groups. This will result in compound B and ethanol.
Compound A + 2OH¯ → Compound B + 2CH3CH2OH
Compound B: C6H4(COOH)(COOCH2CH2COCH3)
03
Acidification
In this step, compound B will react with an acid HX and remove the acid hydrogen forming a diketo ester and water as a byproduct.
Compound B + HX →Compound C + H2O
Compound C: C6H4(COX)(COOCH2CH2COCH3)
04
Decarboxylation
In the final step, compound C will go through a decarboxylation reaction: the loss of CO2 and formation of the diketone.
Compound C → \(\mathrm{C}_{3} \mathrm{H}_{6} \mathrm{O}_{2}\) + CO2
Final diketone: CH3COCOCH3
In conclusion, the proposed structural formulas for the compounds are:
Compound A: C6H4(COOCH2CH3)(COOCH2CH2COCH3)
Compound B: C6H4(COOH)(COOCH2CH2COCH3)
Diketone: CH3COCOCH3
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Saponification
Saponification is a chemical reaction that involves the conversion of esters into alcohol and an acid or salt, typically using a strong base such as sodium hydroxide (NaOH). It plays a crucial role in various organic transformations. For example, in the Claisen condensation exercise, compound A undergoes saponification. Here, the ester groups present in compound A are hydrolyzed, resulting in the formation of compound B along with the release of ethanol.
The general mechanism involves these steps:
The general mechanism involves these steps:
- The base attacks the carbonyl carbon of the ester, forming a tetrahedral intermediate.
- This intermediate collapses, leading to the displacement of the alcohol and the formation of a carboxylate anion.
- The carboxylate ion is then protonated, forming the corresponding carboxylic acid.
Acylation
Acylation refers to the introduction of an acyl group into a compound, typically through reactions involving acyl chlorides or anhydrides. This process is significant in the synthesis of various organic molecules. Although not directly involved in the solution of this exercise, it complements other reactions like Claisen condensation by modifying functional groups and generating new compounds.
In general acylation reactions:
In general acylation reactions:
- An acyl group (\(RCO-\)) is transferred to a nucleophile.
- The nucleophile could be an alcohol, an amine, or another active group.
- This usually requires a catalyst or driving force such as heat.
Decarboxylation
Decarboxylation is a reaction that involves the removal of a carboxyl group as carbon dioxide (\(CO_2\)). It's a common step in the degradation of organic acids and in various synthetic pathways. In the context of the original exercise, after acidification of compound B to form compound C, decarboxylation takes place, leading to the final diketone product.
During decarboxylation:
During decarboxylation:
- The carboxylic group is usually destabilized by heat or a catalyst.
- This process results in the loss of CO2, often replacing the carboxylic group with a hydrogen atom or another group.
- It significantly alters the molecule by reducing its length by one carbon atom.
Organic Synthesis
Organic synthesis is the overarching process of constructing complex organic molecules from simpler ones. It combines various chemical reactions such as saponification, acylation, and decarboxylation, often following a sequential series of steps. The purpose is to transform starting materials into desired products, like transforming diethyl phthalate and ethyl acetate into a diketone as showcased in the exercise.
Principles of organic synthesis include:
Principles of organic synthesis include:
- Step-by-step transformation using defined reaction pathways.
- Optimization of reaction conditions to maximize yield and minimize byproducts.
- Strategic planning to harness available functional groups effectively.
Beta-keto Ester
A beta-keto ester is an organic compound that contains a ketone (\(C=O\)) group located beta to an ester (\(-COOR\)) group in the carbon chain. These compounds are typically formed through Claisen condensation, where an enolate ion from an ester reacts with another ester molecule.
Characteristics of beta-keto esters include:
Characteristics of beta-keto esters include:
- They are versatile intermediates in organic synthesis.
- They possess acidic hydrogens at the alpha-carbon, making them reactive.
- This makes them suitable for further reactions like alkylation or decarboxylation.