Chapter 2: Problem 49
Identify the acidic hydrogens in the following compounds.
Short Answer
Expert verified
Acidic H's: Carboxylic H's in compounds 1, 3, 5, 6, and MES; N-H in barbituric acid; weak/conditional in piperidine, leucine, lysine.
Step by step solution
01
Understand Acidity in Organic Compounds
Acidic hydrogens are typically those attached to highly electronegative atoms such as oxygen or nitrogen, where the conjugate base is stabilized by resonance or inductive effects. Often, acidic hydrogens are part of carboxylic acids (RCOOH) or are alpha hydrogens to carbonyls in ketones and aldehydes.
02
Analyze Each Compound
Start by analyzing each compound provided. Look for functional groups like carboxylic acids, phenols, thiols, and other groups known for acidic properties.
03
Oxalic Acid Derivative
For the compound with SMILES notation "O=C(O)CC(O)(CC(=O)O)C(=O)O", identify the carboxylic acid groups (COOH) as acidic. There are three carboxylic acid groups each possessing one acidic hydrogen.
04
Piperidine
Piperidine does not have any acidic hydrogen since it's a six-membered ring containing secondary amine. These hydrogen atoms are not particularly acidic.
05
Citric Acid
Citric acid is a tricarboxylic acid, containing three carboxyl groups. Each of these groups has one acidic hydrogen.
06
Isobutylbenzene
In the SMILES notation "CC(C)c1ccccc1", the compound is an alkyl benzene which does not contain any strongly acidic hydrogens.
07
Leucine Derivative
For SMILES "CC(=O)C(N)CCCCN," the amine hydrogens are weakly acidic, and the carboxylic acid group has one strongly acidic hydrogen. The compound contains an NH3+ group on one end which also contains acidic hydrogens.
08
Oxalic Acid
For the SMILES "O=C(O)C(=O)O", identify each carboxylic acid group has one acidic hydrogen, totaling two acidic hydrogens in oxalic acid.
09
Lysine
Lysine contains a carboxylic acid group, which has one acidic hydrogen, and an amino terminal group having weakly (and conditionally) acidic hydrogens.
10
Barbituric Acid
Barbituric acid has acidic hydrogen atoms on the nitrogen atoms, which are considered acidic due to resonance stabilization in the deprotonated form.
11
Morpholine Derivative
For the SMILES notation "CN1CCOCC1", morpholine does not contain truly acidic hydrogens as the heteroatom nitrogen and oxygen are part of a stable ring.
12
Sulfonate Compound
In the SMILES "CCS(=O)(=O)[O-]", look for sulfonyl groups, which can form acidic hydrogens when protonated, although this representation shows it as a deprotonated sulfate.
13
MES Buffer
MES contains a sulfonate group and often is written in its deprotonated form since it acts primarily as a buffering agent at neutral pHs; under protonated forms, one hydrogen is acidic enough in specific conditions.
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Organic Acids
Organic acids are a fundamental part of organic chemistry, characterized by their ability to donate protons (
H^+
) in a solution. This behavior is primarily observed in molecules that possess functional groups capable of releasing hydrogen ions. One of the most common functional groups responsible for acidity in organic compounds is the carboxylic acid group (
RCOOH
). This group consists of a carbonyl (
C=O
) linked to a hydroxyl group (
OH
), and upon deprotonation, it forms a stable carboxylate ion (
RCOO^-
). This stability is largely due to resonance which spreads the negative charge over the oxygen atoms.
The concept of organic acids extends beyond carboxyl groups. Although less acidic, phenols and thiols also show acidic properties. Even hydrogens that are adjacent to carbonyl groups (known as alpha-hydrogens ) can be acidic under the right conditions, due to the stabilization provided by the carbonyl group's electron-withdrawing effects.
The concept of organic acids extends beyond carboxyl groups. Although less acidic, phenols and thiols also show acidic properties. Even hydrogens that are adjacent to carbonyl groups (known as alpha-hydrogens ) can be acidic under the right conditions, due to the stabilization provided by the carbonyl group's electron-withdrawing effects.
Acidity in Organic Molecules
Acidity in organic molecules is predominantly defined by the ability of a molecule to release a hydrogen ion (
H^+
) into solution. This ability is enhanced when the conjugate base (
the deprotonated form
) is stabilized.
Several factors contribute to this stabilization. One of the key factors is the presence of electronegative atoms nearby, which help to stabilize the excess negative charge via inductive effect. Electronegativity allows the remaining atoms to draw electron density away from the negatively charged site, thus reducing the concentration of charge.
Moreover, resonance plays a crucial role. In resonance, delocalization of electrons across adjacent pi-systems or lone pairs helps distribute the charge over a larger area, which diminishes the intensity of the electron density at any single point, making the conjugate base more stable.
All these aspects combined, the ease of releasing an acidic hydrogen, and the stability of the resulting anion, define the acidity of organic molecules.
Several factors contribute to this stabilization. One of the key factors is the presence of electronegative atoms nearby, which help to stabilize the excess negative charge via inductive effect. Electronegativity allows the remaining atoms to draw electron density away from the negatively charged site, thus reducing the concentration of charge.
Moreover, resonance plays a crucial role. In resonance, delocalization of electrons across adjacent pi-systems or lone pairs helps distribute the charge over a larger area, which diminishes the intensity of the electron density at any single point, making the conjugate base more stable.
All these aspects combined, the ease of releasing an acidic hydrogen, and the stability of the resulting anion, define the acidity of organic molecules.
Carboxylic Acid Functional Group
The carboxylic acid functional group is one of the cornerstones of organic acids. Consisting of a carbonyl (
C=O
) and a hydroxyl group (
OH
) connected to a carbon atom (
COOH
), it is this specific structure that imparts the compound with its acidic properties. In a reaction, the hydrogen attached to the oxygen in the hydroxyl group is the acidic part.
Upon losing this hydrogen, the group transforms into a carboxylate ion. This ion is particularly stable due to the ability of the two oxygen atoms to share the extra electron pair, thanks to their resonance structures.
In addition to the structure's inherent stability, different substituents attached to the carboxyl group can further influence its acidity. For example, electron-withdrawing groups can enhance acidity by further stabilizing the carboxylate ion, while electron-donating groups may reduce acidity by destabilizing it.
Upon losing this hydrogen, the group transforms into a carboxylate ion. This ion is particularly stable due to the ability of the two oxygen atoms to share the extra electron pair, thanks to their resonance structures.
In addition to the structure's inherent stability, different substituents attached to the carboxyl group can further influence its acidity. For example, electron-withdrawing groups can enhance acidity by further stabilizing the carboxylate ion, while electron-donating groups may reduce acidity by destabilizing it.
Resonance and Inductive Effects
Two significant mechanisms that enhance the acidity of organic acids are the resonance and inductive effects. These effects contribute to the stability of the conjugate base, thereby influencing overall acidity.
Resonance involves the delocalization of electrons. When a molecule can spread out its charge over several atoms, it enhances stability. A well-known instance is the carboxylate ion formed post-deprotonation of a carboxylic acid. The negative charge is shared between the two oxygens, making the ion more stable than if the charge were localized to a single atom.
In contrast, the inductive effect involves the ability of atoms or groups within a molecule to withdraw or donate electron density through sigma bonds. Electronegative atoms near an acidic site can pull electron density through the molecule, leading to the stabilization of the negative charge formed when hydrogen is released. This inductive withdrawal complements resonance, jointly enhancing molecule acidity.
Resonance involves the delocalization of electrons. When a molecule can spread out its charge over several atoms, it enhances stability. A well-known instance is the carboxylate ion formed post-deprotonation of a carboxylic acid. The negative charge is shared between the two oxygens, making the ion more stable than if the charge were localized to a single atom.
In contrast, the inductive effect involves the ability of atoms or groups within a molecule to withdraw or donate electron density through sigma bonds. Electronegative atoms near an acidic site can pull electron density through the molecule, leading to the stabilization of the negative charge formed when hydrogen is released. This inductive withdrawal complements resonance, jointly enhancing molecule acidity.
- Resonance and inductive effects are both crucial in stabilizing conjugate bases.
- These effects are often present together, playing roles in determining the strength and behavior of acids.