Chapter 15: Problem 41
Draw the condensed structural formula for the cephalin that contains glycerol, two palmitic acids, phosphate, and ethanolamine (ionized).
Short Answer
Expert verified
CH2(O-C(=O)-C15H31)-CH(O-C(=O)-C15H31)-CH2(OPO3-O-CH2-CH2-NH3^+)
Step by step solution
01
Identify the Components of Cephalin
Cephalin is a type of phospholipid that contains glycerol, fatty acids, phosphate group, and an alcohol group. For this specific cephalin, the components are glycerol, two palmitic acid molecules, a phosphate group, and ionized ethanolamine.
02
Draw the Glycerol Backbone
Draw the basic structure of glycerol which is a three-carbon molecule with hydroxyl (OH) groups attached to each carbon: CH2(OH)-CH(OH)-CH2(OH).
03
Attach the Fatty Acids
Attach each palmitic acid (C15H31COOH) to two of the hydroxyl groups of glycerol by forming ester linkages. Palmitic acid's structure is CH3(CH2)14COOH. The resulting structure for each fatty acid attached to glycerol is CH3(CH2)14COO-: CH2(O-C(=O)-C15H31)-CH(O-C(=O)-C15H31)-CH2(OH).
04
Attach the Phosphate Group
Attach the phosphate group (PO4^-) to the remaining hydroxyl group on glycerol. The resulting structure is CH2(O-C(=O)-C15H31)-CH(O-C(=O)-C15H31)-CH2(OPO3^-).
05
Attach the Ethanolamine Group
Ionized ethanolamine is -O-CH2-CH2-NH3^+. Attach this group to the phosphate group to complete the cephalin structure: CH2(O-C(=O)-C15H31)-CH(O-C(=O)-C15H31)-CH2(OPO3-O-CH2-CH2-NH3^+).
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
phospholipid structure
Phospholipids are fundamental components of cell membranes. They consist of a lipid molecule incorporating a phosphate group. This unique structure provides phospholipids with both hydrophilic (water-attracting) and hydrophobic (water-repelling) properties. Phospholipids are essential for creating the semi-permeable membranes that protect and organize cells.
Typically, the phospholipid molecule includes:
Typically, the phospholipid molecule includes:
- A glycerol backbone
- Two fatty acids attached via ester linkages
- A phosphate group
- An additional molecule attached to the phosphate, often an alcohol The specific structure causes the molecule to align in a double-layered membranous structure in water, with hydrophobic tails facing inward and hydrophilic heads facing outwards.
glycerol backbone
The glycerol backbone serves as the core structure in many types of lipids, including phospholipids like cephalin. Glycerol is a simple three-carbon molecule where each carbon holds a hydroxyl group (-OH). Its structure is written as CH2(OH)-CH(OH)-CH2(OH).
In phospholipids, these hydroxyl groups are key for attaching other functional groups, such as fatty acids and phosphate groups, through ester or phospho-ester linkages. The central position of the glycerol molecule makes it an ideal scaffold for building the diverse lipids found in biological membranes.
The glycerol backbone thus acts as the anchor, holding the hydrophobic and hydrophilic parts of the phospholipid together, ensuring the molecule can play its role in forming cellular membranes efficiently.
In phospholipids, these hydroxyl groups are key for attaching other functional groups, such as fatty acids and phosphate groups, through ester or phospho-ester linkages. The central position of the glycerol molecule makes it an ideal scaffold for building the diverse lipids found in biological membranes.
The glycerol backbone thus acts as the anchor, holding the hydrophobic and hydrophilic parts of the phospholipid together, ensuring the molecule can play its role in forming cellular membranes efficiently.
fatty acid ester linkages
Fatty acids are long hydrocarbon chains capped with a carboxyl group (COOH), which can form ester bonds with the hydroxyl groups on glycerol. In the context of cephalin, specifically two palmitic acids are attached to the first and second carbons of glycerol.
The esterification process involves the reaction between the hydroxyl group of glycerol and the carboxy group of the fatty acid, releasing a water molecule and forming the ester linkage.
Here's the structure for each fatty acid linked to glycerol: CH2(O-C(=O)-C15H31)-CH(O-C(=O)-C15H31)-CH2(OH).
This ester linkage is crucial because it connects the hydrophobic fatty acid chains to the glycerol backbone, contributing to the amphipathic nature of the phospholipid.
The esterification process involves the reaction between the hydroxyl group of glycerol and the carboxy group of the fatty acid, releasing a water molecule and forming the ester linkage.
Here's the structure for each fatty acid linked to glycerol: CH2(O-C(=O)-C15H31)-CH(O-C(=O)-C15H31)-CH2(OH).
This ester linkage is crucial because it connects the hydrophobic fatty acid chains to the glycerol backbone, contributing to the amphipathic nature of the phospholipid.
phosphate group attachment
In phospholipids, including cephalin, the phosphate group attaches to the glycerol backbone at the third carbon position. The structure changes from a simple tri-glycerol molecule by substituting one fatty acid chain with a phosphate group.
The phosphate group introduces a significant hydrophilic character to the phospholipid. It has the formula PO4^- and when attached to the glycerol backbone, the structure is CH2(O-C(=O)-C15H31)-CH(O-C(=O)-C15H31)-CH2(OPO3^-).
This phospho-ester linkage is essential for the molecule's orientation in the cell membrane. The phosphate's negative charge allows the head of the phospholipid to interact with aqueous environments, facilitating diverse functions like cellular signaling and membrane organization.
The phosphate group introduces a significant hydrophilic character to the phospholipid. It has the formula PO4^- and when attached to the glycerol backbone, the structure is CH2(O-C(=O)-C15H31)-CH(O-C(=O)-C15H31)-CH2(OPO3^-).
This phospho-ester linkage is essential for the molecule's orientation in the cell membrane. The phosphate's negative charge allows the head of the phospholipid to interact with aqueous environments, facilitating diverse functions like cellular signaling and membrane organization.
ionized ethanolamine group
The final component to understand in the structure of cephalin is ionized ethanolamine. Ethanolamine consists of an ethyl group (CH2-CH2) linked to an amino group (NH2), which gets ionized in physiological conditions to NH3^+.
In cephalin, the ionized ethanolamine attaches to the phosphate group, forming the complete head group of the phospholipid. The structure, therefore, becomes CH2(O-C(=O)-C15H31)-CH(O-C(=O)-C15H31)-CH2(OPO3^-O- CH2-CH2-NH3^+).
This attachment is crucial because it gives the phospholipid its distinct properties, allowing interaction with other molecules and ions in the cell membrane.
The ionized ethanolamine group enhances the molecule's hydrophilic nature, ensuring the head group is highly polarized and thus able to stabilize lipid bilayers effectively.
In cephalin, the ionized ethanolamine attaches to the phosphate group, forming the complete head group of the phospholipid. The structure, therefore, becomes CH2(O-C(=O)-C15H31)-CH(O-C(=O)-C15H31)-CH2(OPO3^-O- CH2-CH2-NH3^+).
This attachment is crucial because it gives the phospholipid its distinct properties, allowing interaction with other molecules and ions in the cell membrane.
The ionized ethanolamine group enhances the molecule's hydrophilic nature, ensuring the head group is highly polarized and thus able to stabilize lipid bilayers effectively.