Chapter 12: Problem 57
Draw the condensed structural or line-angle formula, if cyclic, for each of the following: (12.3) a. 4 -chlorobenzaldehyde b. 3 -chloropropionaldehyde c. ethyl methyl ketone d. 3 -methylhexanal
Short Answer
Expert verified
a. Cl-C6H4-CHO; b. Cl-CH2-CH2-CHO; c. CH3COCH2CH3; d. CH3-CH2-CH(CH3)-CH2-CH2-CHO.
Step by step solution
01
- Understanding the Problem
Identify the names of the compounds provided and understand the functional groups and substituents involved.
02
- Analyzing 4-chlorobenzaldehyde
4-chlorobenzaldehyde contains a benzene ring with a formyl group (-CHO) at the first position and a chlorine atom at the fourth position. Draw the benzene ring, then add the formyl group at the first position and the chlorine atom at the fourth position.
03
- Drawing 4-chlorobenzaldehyde
The structure can be drawn as follows: a hexagonal benzene ring with alternating double bonds, a -CHO group attached to carbon 1, and a Cl atom attached to carbon 4. The condensed structure is: Cl-C6H4-CHO.
04
- Analyzing 3-chloropropionaldehyde
3-chloropropionaldehyde has a three-carbon chain with an aldehyde group (-CHO) at the first carbon and a chlorine atom at the third carbon.
05
- Drawing 3-chloropropionaldehyde
The structure is a linear chain: Cl-CH2-CH2-CHO.
06
- Analyzing ethyl methyl ketone
Ethyl methyl ketone has a carbonyl group (C=O) between an ethyl group (-CH2CH3) and a methyl group (-CH3).
07
- Drawing ethyl methyl ketone
The structure can be drawn as: CH3-CO-CH2-CH3 (or its condensed form: CH3COCH2CH3).
08
- Analyzing 3-methylhexanal
3-methylhexanal has a six-carbon chain with an aldehyde group (-CHO) at the first carbon and a methyl group (-CH3) at the third carbon.
09
- Drawing 3-methylhexanal
The structure is: CH3-CH2-CH(CH3)-CH2-CH2-CHO.
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Condensed Structural Formula
In organic chemistry, the condensed structural formula is a way to represent molecules in a shorthand format without drawing every single bond. It groups together atoms that are connected, so you can quickly see the structure of more complex molecules. For example, the condensed structural formula for ethyl methyl ketone is written as CH3-CO-CH2-CH3, where the carbonyl group (CO) is shown between the ethyl group (CH2-CH3) and the methyl group (CH3). This format is very useful for simplifying large structures and making them easier to read.
Functional Groups
Functional groups are specific groups of atoms within molecules that have their own characteristic properties. These groups are responsible for the chemical reactions of the molecule. Common functional groups include:
- -OH (hydroxyl group)
- -CHO (aldehyde group)
- -CO (carbonyl group for ketones)
- -COOH (carboxyl group for acids)
Aldehydes
Aldehydes are organic compounds containing a formyl group, which is written as -CHO. This group consists of a carbon atom double-bonded to an oxygen atom (carbonyl group) and single-bonded to a hydrogen atom. Aldehydes are found at the end of a carbon chain. Examples of aldehydes in the exercise are 4-chlorobenzaldehyde and 3-chloropropionaldehyde. In these molecules, the formyl group determines most of the chemical properties and reactions it undergoes. For instance, 4-chlorobenzaldehyde has its -CHO group attached to a benzene ring, making it more reactive due to the presence of the aromatic system.
Ketones
Ketones are another class of organic compounds that feature a carbonyl group, written as C=O. Unlike aldehydes, the carbonyl group in ketones is bonded to two carbon atoms, usually within a carbon chain. This makes ketones less reactive than aldehydes. An example from the exercise is ethyl methyl ketone (CH3-CO-CH2-CH3). Here, the carbonyl group sits between an ethyl group and a methyl group. The placement of the carbonyl group in the middle of the chain affects the molecule's properties and the types of reactions it may undergo.
Substituents
Substituents are atoms or groups of atoms that replace hydrogen atoms on the carbon skeleton of an organic molecule. They significantly alter the properties and reactivity of the molecule. For example:
- In 4-chlorobenzaldehyde, the chlorine atom is a substituent attached to the fourth carbon of the benzene ring.
- In 3-chloropropionaldehyde, the chlorine atom is attached to the third carbon of the three-carbon chain.