/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 21 Draw the condensed structural fo... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Draw the condensed structural formula of each of the following: a. propyl butyrate b. butyl formate c. ethyl pentanoate

Short Answer

Expert verified
a. C3H7COO(C3H7) b. C3H7OCHO c. C2H5COO(C4H9)

Step by step solution

01

Understanding Condensed Structural Formulas

Condensed structural formulas list atoms sequentially but show most of the bonds as connected letters. We need to know how each molecule in our task is broken into its organic components.
02

Propyl Butyrate

Propyl Butyrate is an ester formed from propanol (C3H7OH) and butyric acid (C4H8O2). Its structure is CH3-CH2-CH2-O-C(=O)-CH2-CH2-CH3. Therefore, the condensed structural formula for propyl butyrate is C3H7COO(C3H7).
03

Butyl Formate

Butyl Formate is an ester formed from butanol (C4H9OH) and formic acid (HCOOH). Its structure is CH3-CH2-CH2-CH2-O-C(=O)-H. Therefore, the condensed structural formula for butyl formate is C3H7OCHO.
04

Ethyl Pentanoate

Ethyl Pentanoate is an ester formed from ethanol (C2H5OH) and pentanoic acid (C5H10O2). Its structure is CH3-CH2-O-C(=O)-CH2-CH2-CH2-CH2-CH3. Therefore, the condensed structural formula for ethyl pentanoate is C2H5COO(C4H9).

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Organic Chemistry
Organic chemistry is the branch of chemistry focused on carbon-containing compounds.
These compounds can range from simple molecules, like methane, to complex structures, such as proteins.
A primary focus of organic chemistry is understanding how carbon atoms bond with other elements, creating diverse chemical structures.

Esters, like those in the provided exercise, are a family of organic compounds. They are formed in reactions between alcohols and carboxylic acids.
Each ester has unique properties and is often noted for pleasant odors. Esters are prevalent in nature, found in fruits and flowers.
They are also used in synthetic applications, including perfumes and flavors.

Organic chemists often study these compounds to understand their behavior, reactions, and uses in various applications. With compounds like esters, their structural formulas inform us of their chemical makeup and how they form from simpler molecules.
Esters
Esters are organic compounds formed from reactions between alcohols and carboxylic acids.
They have distinctive names derived from the parent alcohol and acid.
For example, propyl butyrate is derived from propanol and butyric acid.

Uses of esters are far-ranging. In nature, they are responsible for the aroma in fruits.
In industry, they are used for fragrances, flavors, and even solvents.
The structure of esters typically involves an \(\text{–COO–}\) group, connecting the carbon chain of the alcohol to the carboxylic acid group.

Understanding the structural formulas of esters helps you predict their behavior and interactions in chemical processes.
For example, the ester propyl butyrate has a structure that influences its reactivity and physical properties, like boiling point and solubility.
In exams and homework, you'll often be asked to draw or interpret these structures, reinforcing their importance in organic chemistry.
Structural Formulas
Structural formulas in organic chemistry provide a visual representation of a molecule's structure using letters and lines.
They can be displayed in several forms, including condensed formulas like us in the exercise, where bonds are implied rather than shown explicitly.

Condensed structural formulas efficiently show the arrangement of atoms within a molecule without drawing every single bond.
For example, the formula for propyl butyrate (C3H7COO(C3H7)) neatly represents the ester group and linked carbon chains without excessive details.

These formulas help students understand molecule composition and connectivity, facilitating the prediction of chemical reactions and properties.
In complex molecules, reading and writing condensed structural formulas becomes useful in efficiently communicating chemical structures.
Practicing these representations will make it easier to work with larger and more intricate organic compounds in advanced coursework.
Chemical Structure Representation
Accurately representing chemical structures is crucial for understanding and communicating in organic chemistry.
Different methods include Lewis structures, skeletal formulas, and condensed structural formulas.

Condensed structural formulas are particularly useful for simplifying large molecules.
They often list the carbon (C) atoms sequentially while representing hydrogen (H) atoms and other groups using subscript numbers or parentheses.
This technique reduces clutter and makes it easier to interpret complex molecules.

For example, the condensed structural formula of butyl formate, C3H7OCHO, simplifies the detailed Lewis structure into a more manageable form.
This aids in quickly recognizing the ester group and the carbon chain length connected to it.

Mastering these representations helps students quickly analyze and understand chemical properties and reactions.
Practice drawing and interpreting these formulas to strengthen your grasp of organic molecular structures, a fundamental skill in organic chemistry.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Study anywhere. Anytime. Across all devices.