Chapter 14: Problem 16
Draw the condensed structural formula of the ester formed when each of the following reacts with ethyl alcohol: a. formic acid b. propionic acid c. 2 -methylpentanoic acid
Short Answer
Expert verified
The esters formed are HCOOCH2CH3, CH3CH2COOCH2CH3, and CH3CH2CH(CH3)CH2COOCH2CH3.
Step by step solution
01
Understanding Esters
Esters are formed when carboxylic acids react with alcohols in a condensation reaction. The general reaction is: carboxylic acid + alcohol → ester + water.
02
Identify Functional Groups
For each reaction, identify the carboxylic acid (which provides the -COOH group) and the alcohol (which provides the -OH group). Here the alcohol is ethyl alcohol (CH3CH2OH).
03
Write Reaction for Formic Acid
Formic acid (HCOOH) reacts with ethyl alcohol (CH3CH2OH) forming an ester. The reaction is: HCOOH + CH3CH2OH → HCOOCH2CH3 + H2O.
04
Write Reaction for Propionic Acid
Propionic acid (CH3CH2COOH) reacts with ethyl alcohol (CH3CH2OH) forming an ester. The reaction is: CH3CH2COOH + CH3CH2OH → CH3CH2COOCH2CH3 + H2O.
05
Write Reaction for 2-Methylpentanoic Acid
2-Methylpentanoic acid (CH3CH2CH(CH3)CH2COOH) reacts with ethyl alcohol (CH3CH2OH) forming an ester. The reaction is: CH3CH2CH(CH3)CH2COOH + CH3CH2OH → CH3CH2CH(CH3)CH2COOCH2CH3 + H2O.
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
condensation reaction
A condensation reaction is a crucial concept in organic chemistry. It occurs when two molecules combine to form a larger molecule, with the loss of a small molecule such as water. In the context of ester formation, this reaction is between a carboxylic acid and an alcohol.
For instance, when formic acid (HCOOH) reacts with ethyl alcohol (CH3CH2OH), they combine to form an ester (HCOOCH2CH3) and water (H2O). This type of reaction is common in forming various organic compounds, showing the versatility and importance of condensation reactions.
Key points to remember about condensation reactions in ester formation:
For instance, when formic acid (HCOOH) reacts with ethyl alcohol (CH3CH2OH), they combine to form an ester (HCOOCH2CH3) and water (H2O). This type of reaction is common in forming various organic compounds, showing the versatility and importance of condensation reactions.
Key points to remember about condensation reactions in ester formation:
- They generally produce water as a byproduct.
- They require a carboxylic acid and an alcohol as reactants.
- The resulting compound is an ester, characterized by a specific -COO- functional group.
carboxylic acids
Carboxylic acids are organic acids characterized by the presence of a carboxyl group (-COOH). They are crucial in forming esters when they react with alcohols. Different carboxylic acids can lead to the formation of different esters, each with unique properties.
For example, formic acid (HCOOH), propionic acid (CH3CH2COOH), and 2-methylpentanoic acid (CH3CH2CH(CH3)CH2COOH) can all react with ethyl alcohol to produce different esters.
Important aspects of carboxylic acids include:
For example, formic acid (HCOOH), propionic acid (CH3CH2COOH), and 2-methylpentanoic acid (CH3CH2CH(CH3)CH2COOH) can all react with ethyl alcohol to produce different esters.
Important aspects of carboxylic acids include:
- The carboxyl group (-COOH) is highly reactive, making it essential in many chemical reactions.
- They can react with alcohols to form esters and water in condensation reactions.
- Each carboxylic acid can form a distinct ester, depending on its structure.
ethyl alcohol
Ethyl alcohol, also known as ethanol (CH3CH2OH), is a common alcohol used in many organic reactions, including ester formation. In these reactions, ethyl alcohol provides the -OH group that reacts with the -COOH group of carboxylic acids.
When ethyl alcohol reacts with different carboxylic acids, it forms different esters, all involving the loss of water as a byproduct. For instance:
When ethyl alcohol reacts with different carboxylic acids, it forms different esters, all involving the loss of water as a byproduct. For instance:
- With formic acid (HCOOH), it forms ethyl formate (HCOOCH2CH3).
- With propionic acid (CH3CH2COOH), it forms ethyl propionate (CH3CH2COOCH2CH3).
- With 2-methylpentanoic acid (CH3CH2CH(CH3)CH2COOH), it results in ethyl 2-methylpentanoate (CH3CH2CH(CH3)CH2COOCH2CH3).
functional groups
Functional groups are specific groups of atoms within molecules that have particular chemical properties. They are critical in determining how molecules interact in chemical reactions.
In ester formation, two primary functional groups are involved: the carboxyl group (-COOH) from carboxylic acids and the hydroxyl group (-OH) from alcohols.
When these two functional groups react in a condensation reaction, they form a new functional group called an ester group (-COO-), characterized by:
In ester formation, two primary functional groups are involved: the carboxyl group (-COOH) from carboxylic acids and the hydroxyl group (-OH) from alcohols.
When these two functional groups react in a condensation reaction, they form a new functional group called an ester group (-COO-), characterized by:
- A carbon double-bonded to an oxygen and single-bonded to another oxygen that is bonded to another carbon (R-COO-R').
- This new group defines the ester and contributes to its unique properties, such as its distinct smell.