Chapter 25: Problem 75
Draw the structures of the dipeptides that can be formed from the reaction between the amino acids glycine and lysine.
Short Answer
Expert verified
The dipeptides are glycyl-lysine and lysyl-glycine.
Step by step solution
01
Understand Amino Acid Structure
First, we need to understand the structure of the amino acids involved. Glycine is the simplest amino acid, with the formula NH2CH2COOH, where the side chain is a hydrogen atom. Lysine has the formula NH2(CH2)4CH(NH2)COOH, with a side chain of (CH2)4NH2, giving it a basic character.
02
Know What Dipeptides Are
A dipeptide is a molecule formed by joining two amino acids. One amino acid contributes an amino group (NH2), and the other contributes a carboxyl group (COOH), forming a peptide bond (CONH) and releasing a molecule of water (H2O).
03
Forming Dipeptide Glycyl-Lysine
In the glycyl-lysine dipeptide, glycine contributes its NH2 group, and lysine contributes its COOH group. Remove a water molecule (by removing an OH from the carboxyl of lysine and an H from the amino of glycine), forming the peptide bond NH2CH2CONH(CH2)4CH(NH2)COOH.
04
Forming Dipeptide Lysyl-Glycine
In the lysyl-glycine dipeptide, lysine contributes its NH2 group, and glycine contributes its COOH group. Remove a water molecule (by removing an OH from the carboxyl of glycine and an H from the amino of lysine), forming the peptide bond NH2(CH2)4CH(NH2)CONHCH2COOH.
05
Verify Structures
Double-check the structures to ensure that each amino acid's side chain and backbone are properly represented. Ensure the peptide bonds (CONH) are formed correctly in both dipeptides.
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Amino Acids
Amino acids are the building blocks of proteins, which play crucial roles in nearly every biological process. They are organic compounds that contain both an amino group (-NH2) and a carboxyl group (-COOH).
This structure allows amino acids to link together, forming proteins or peptides.
There are 20 standard amino acids, each with a unique side chain or R group, which determines its properties and role in the structure and function of proteins.
This structure allows amino acids to link together, forming proteins or peptides.
There are 20 standard amino acids, each with a unique side chain or R group, which determines its properties and role in the structure and function of proteins.
- The amino group acts as a base, while the carboxyl group behaves as an acid.
- They bond together to form peptides, in which sequences can be tailored for specific functions.
- The sequence and combination of amino acids define the characteristics of the resulting protein or peptide.
Glycine
Glycine is the simplest and smallest amino acid, with a side chain consisting of just a hydrogen atom. Its chemical formula is NH2CH2COOH, making it unique among amino acids.
Because of its small size, glycine is highly flexible and can fit into tight spaces within protein structures.
Because of its small size, glycine is highly flexible and can fit into tight spaces within protein structures.
- Its lack of a complex side chain allows it to contribute minimal steric hindrance.
- It often appears in protein structures that require tight turns or bends.
- Glycine plays a crucial role in the formation of proteins like collagen, providing flexibility.
Lysine
Lysine is a basic amino acid known for its long side chain, which comprises four methylene groups capped with an amino group (NH2). The chemical formula for lysine is NH2(CH2)4CH(NH2)COOH.
This structure imparts lysine with a basic character, enabling it to participate in electrostatic interactions important for protein structure.
This structure imparts lysine with a basic character, enabling it to participate in electrostatic interactions important for protein structure.
- Lysine's side chain can form ionic bonds due to the presence of the terminal amino group.
- It is an essential amino acid, meaning it must be ingested through diet as the body cannot synthesize it.
- Lysine is crucial in protein interactions, where it often facilitates bonding and stabilization.
Peptide Bond
Peptide bonds are the chemical bonds that link amino acids together in proteins and peptides. These bonds are formed through a dehydration synthesis reaction, where a molecule of water is released as a bond is formed between the amino group of one amino acid and the carboxyl group of another.
This bond is represented as (-CONH-), and is critical in maintaining the structure of dipeptides and proteins.
This bond is represented as (-CONH-), and is critical in maintaining the structure of dipeptides and proteins.
- The formation of a peptide bond results in a covalent linkage that is strong and stable.
- As peptide bonds form along a chain of amino acids, they create a backbone that defines the primary structure of proteins.
- Peptide bonds determine the sequence of amino acids, which further influences the protein's function and stability.