/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 85 Draw the condensed structural fo... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Draw the condensed structural formula for each of the following: (17.4) a. 3 -bromo-2-pentanol b. 2 -methyl-1-propanol c. methyl propyl ether

Short Answer

Expert verified
a. CH3-CH(Br)-CH(OH)-CH2-CH3, b. (CH3)2CH-CH2OH, c. CH3-O-CH2-CH2-CH3

Step by step solution

01

Identify the Base Structure

Start by identifying the parent hydrocarbon chain for each compound.
02

Incorporate Substituents

Add the substituents (bromo, methyl, hydroxyl groups) onto their respective carbon atoms as specified in the compound names.
03

Convert to Condensed Structural Formula

Write the condensed structural formula by grouping the hydrogen atoms with the carbon atoms they are bonded to, following the structure modified by the substituents.
04

Draw 3-bromo-2-pentanol

The structure is: CH3-CH(Br)-CH(OH)-CH2-CH3
05

Draw 2-methyl-1-propanol

The structure is: (CH3)2CH-CH2OH
06

Draw methyl propyl ether

The structure is: CH3-O-CH2-CH2-CH3

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

organic chemistry
Organic chemistry is a branch of chemistry focused on compounds containing carbon atoms. These compounds are incredibly diverse. They range from simple molecules like methane (CH4) to complex polymers and large biomolecules.
Understanding organic chemistry is essential for many fields, including medicine, biology, and environmental science.
It involves the study of how these carbon-containing compounds react and interact with other substances.
hydrocarbon chain
A hydrocarbon chain is a series of carbon atoms connected to each other, with hydrogen atoms attached to the carbons. These chains can be straight, branched, or even form rings.
Hydrocarbon chains are fundamental structures in organic chemistry.
They form the backbone for most organic molecules.
If the chain has only single bonds, it's called an alkane. Double bonds make it an alkene, and triple bonds make it an alkyne.
For instance, in the exercise, the parent chain in 3-bromo-2-pentanol is pentane, a five-carbon hydrocarbon chain.
substituents
Substituents are groups of atoms that replace hydrogen atoms on the hydrocarbon chain.
They can significantly change the chemical properties and reactivity of the molecule.
In the given exercise, bromine (Br), methyl (CH3), and hydroxyl (OH) groups are substituents.
The position of substituents is crucial and is specified by numbering the carbon atoms in the parent chain.
For example, in 3-bromo-2-pentanol, a bromine substituent is attached to the third carbon, and a hydroxyl group is attached to the second carbon.
structural formula
A structural formula represents the arrangement of atoms within a molecule.
One type is the condensed structural formula, which groups together hydrogen atoms with the carbon atoms to which they are bonded.
This helps simplify the representation without losing crucial information.
For instance, the condensed structural formula for 3-bromo-2-pentanol is CH3-CH(Br)-CH(OH)-CH2-CH3.
Each part of this formula tells you where each atom or group is placed within the molecule.
These formulas are essential in organic chemistry to visualize and understand the molecule's structure and reactivity.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Study anywhere. Anytime. Across all devices.