Chapter 18: Problem 1
Draw the structure for each peptide. a. gly-val b. val-gly
Short Answer
Expert verified
Gly-Val: NH2-CH2-CONH-CH(CH3)2-COOH; Val-Gly: NH2-CH(CH3)2-CONH-CH2-COOH.
Step by step solution
01
Understand the Basics of a Peptide Bond
Peptides are short chains of amino acids joined by peptide bonds. A peptide bond is formed between the carboxyl group of one amino acid and the amino group of the next amino acid.
02
Identify the Amino Acids for Gly-Val
The peptide 'gly-val' has two amino acids: glycine (gly) as the first amino acid and valine (val) as the second.
03
Draw Glycine (Gly) Structure
Glycine, the simplest amino acid, has the structure: NH2-CH2-COOH.
04
Draw Valine (Val) Structure
Valine, a branched-chain amino acid, has the structure: NH2-CH(CH3)2-COOH.
05
Form the Gly-Val Peptide
Connect the glycine and valine by a peptide bond. Remove an OH from the carboxyl group of glycine and a H from the amino group of valine to create a peptide bond (C-N) between them, resulting in: NH2-CH2-CONH-CH(CH3)2-COOH.
06
Identify the Amino Acids for Val-Gly
The peptide 'val-gly' has two amino acids: valine (val) as the first amino acid and glycine (gly) as the second.
07
Form the Val-Gly Peptide
Connect the valine and glycine by a peptide bond. Remove an OH from the carboxyl group of valine and a H from the amino group of glycine to create a peptide bond (C-N) between them, resulting in: NH2-CH(CH3)2-CONH-CH2-COOH.
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Amino Acids
Amino acids are the building blocks of proteins and peptides. They are organic compounds, typically composed of three main parts:
- an amino group \(NH_2\)
- a carboxyl group \(COOH\)
- a unique side chain or R group, which varies for each amino acid
Peptide Bond Formation
The formation of a peptide bond is an essential process in connecting amino acids. This occurs during protein synthesis through a reaction called a dehydration synthesis. The carboxyl group (COOH) of one amino acid reacts with the amino group (NH_2) of another, releasing a molecule of water (Hâ‚‚O).
This reaction forms a peptide bond, characterized by a C-N bond, linking the two amino acids together to form a dipeptide. For example, when forming a gly-val peptide, the peptide bond is formed from the carboxyl group of glycine and the amino group of valine. This bond is fundamental in creating chains of amino acids, ranging from small peptides to entire proteins. Peptide bonds are strong and stable under physiological conditions, allowing for durable and functional biological molecules.
This reaction forms a peptide bond, characterized by a C-N bond, linking the two amino acids together to form a dipeptide. For example, when forming a gly-val peptide, the peptide bond is formed from the carboxyl group of glycine and the amino group of valine. This bond is fundamental in creating chains of amino acids, ranging from small peptides to entire proteins. Peptide bonds are strong and stable under physiological conditions, allowing for durable and functional biological molecules.
Glycine Structure
Glycine is the simplest of all amino acids. Its structure is simple yet elegant, consisting of an amino group, a carboxyl group, a hydrogen atom, and a hydrogen side chain (R group). Hence, its complete structure is written as \(NH_2-CH_2-COOH\).
The absence of a bulky side chain imparts glycine with unique properties:
The absence of a bulky side chain imparts glycine with unique properties:
- It is achiral, meaning it does not rotate plane polarized light, due to its symmetrical nature.
- Glycine is flexible, often found in proteins where tight turns are necessary because it can adopt conformations impossible for other amino acids.
Valine Structure
Valine is known as a branched-chain amino acid, identified by its distinct side chain configuration. Its structure consists of an amino group, a carboxyl group, a hydrogen atom, and a complex side chain featuring two methyl groups: \(CH(CH_3)_2\). Thus, its full structure reads as \(NH_2-CH(CH_3)_2-COOH\).
Key characteristics of valine include:
Key characteristics of valine include:
- It is a chiral molecule, as most amino acids are, which means it has a mirror-image isomer not superimposable on itself.
- Valine is hydrophobic due to its non-polar side chain. This property helps in folding proteins where valine can be buried away from water.