/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 4 Draw the structure for each comp... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Draw the structure for each compound. a. 3-methylpentane b. \(2,2,5\) -trimethylhexane c. 4 -ethyl-3-methyloctane

Short Answer

Expert verified
a. CH3-CH2-CH(CH3)-CH2-CH3; b. CH3-C(CH3)2-CH2-CH2-CH(CH3)-CH3; c. CH3-(CH2)2-CH(CH3)-CH(CH2CH3)-(CH2)3-CH3.

Step by step solution

01

Understanding naming conventions

3-methylpentane, 2,2,5-trimethylhexane, and 4-ethyl-3-methyloctane are names given to organic compounds following IUPAC rules. The number refers to the position of the substituents on the main carbon chain, while the rest indicates the type of substituent and the length of the main carbon chain (pentane, hexane, octane). Analyzing each name helps in determining the structure of the compound.
02

Draw the structure for 3-methylpentane

Start with the main chain, which is 'pentane' (5 carbons long). Number the chain from 1 to 5. Attach a methyl group (CH3) to the 3rd carbon. The structure would look like: CH3-CH2-CH(CH3)-CH2-CH3.
03

Draw the structure for 2,2,5-trimethylhexane

The main chain is 'hexane' (6 carbons long). Number the hexane chain from 1 to 6. Attach a methyl group (CH3) to both the 2nd carbon and another at the same carbon, and also a methyl group to the 5th carbon. The structure should be: CH3-C(CH3)2-CH2-CH2-CH(CH3)-CH3.
04

Draw the structure for 4-ethyl-3-methyloctane

Start with the main chain 'octane' (8 carbons long). Number the chain from 1 to 8. Attach an ethyl group (CH2CH3) to the 4th carbon and a methyl group (CH3) to the 3rd carbon. The structure is: CH3-(CH2)2-CH(CH3)-CH(CH2CH3)-(CH2)3-CH3.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Organic Chemistry
Organic chemistry is a branch of chemistry that revolves around the study of carbon-containing compounds. It is a vast and fascinating field, predominantly focusing on compounds made up of carbon atoms bonded with elements like hydrogen, oxygen, nitrogen, and others. Carbon's unique bonding ability allows for a variety of structures, leading to countless organic compounds with diverse properties and functions.

In organic chemistry, compounds are often classified into families based on their structure and functional groups. Alkanes are the simplest organic compounds and consist solely of carbon and hydrogen atoms, connected by single bonds only. They have the general formula of C\( _n \)H\( _{2n+2} \). Learning to name and draw these structures is fundamental to understanding more complex organic chemistry concepts.

The IUPAC (International Union of Pure and Applied Chemistry) nomenclature rules provide a systematic way of naming organic compounds. This guarantees that each compound has a distinct name, typically reflecting its structure. For example, in IUPAC names, the longest continuous carbon chain is identified as the parent compound, and substituents, such as alkyl groups, are indicated along with their position on this chain.
Alkane Structures
Alkane structures form the backbone of organic chemistry. They consist of chains, branches, or rings of carbon atoms fully saturated with hydrogen atoms. Understanding alkane structures is the key to unraveling more complex molecules in organic chemistry.

In alkanes, each carbon atom forms four single covalent bonds with other atoms. This configuration makes them relatively stable and non-reactive compared to other organic compounds. Alkanes are generally depicted in a linear or branched line structure.

When naming alkanes under the IUPAC system, it's important to identify the longest continuous chain of carbon atoms as the base structure. This is called the parent chain, and determines the "root" name of the compound. For example, 'pentane', 'hexane', and 'octane' indicate chains of five, six, and eight carbon atoms respectively. Any side chains or substituents are noted as prefixes, along with their position on the parent chain to ensure clarity in the compound's structure.
Structural Isomerism
A fascinating aspect of organic chemistry is structural isomerism. This occurs when compounds have the same molecular formula but different structural arrangements of atoms. It often results in distinct physical and chemical properties.

Alkanes exhibit structural isomerism, particularly as the number of carbon atoms increases. For example, the molecular formula C\( _5 \)H\( _{12} \) represents multiple isomers, including pentane and its branched versions like 2-methylbutane and 2,2-dimethylpropane.

Identifying and drawing structural isomers requires understanding where and how atoms can be rearranged while maintaining the same overall formula. This involves recognizing possible branching points and variations of connecting groups. Each unique structure is named using IUPAC nomenclature, ensuring accurate representation of each isomer's distinct configuration.

Exploring structural isomerism enriches the understanding of organic chemistry, as even subtle differences in structure can lead to varied reactivities, boiling points, and other properties.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Study anywhere. Anytime. Across all devices.