/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 47 Draw the structure of a dihalide... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Draw the structure of a dihalide that could be used to prepare each alkyne. There may be more than one possible dihalide. a. \(\mathrm{CH}_{3} \mathrm{C} \equiv \mathrm{CCH}_{3}\) b. C#CC(C)(C)C C. C(=Cc1ccccc1)c1ccccc1

Short Answer

Expert verified
Part a: 1,2-dihaloethane; Part b: 2,3-dihalo-3,3-dimethylbutane; Part c: 2,3-dihalostilbene.

Step by step solution

01

Understand the Target Alkynes

The exercise involves creating a dihalide precursor for each alkyne. For part a, the target alkyne is \(\mathrm{CH}_{3} \mathrm{C} \equiv \mathrm{CCH}_{3}\). Part b provides an alkyne with structure \(\mathrm{C} \equiv \mathrm{C}(\mathrm{C}(\mathrm{C})(\mathrm{C})\mathrm{C})\). Part c's alkyne is \(\mathrm{C}(=\mathrm{Cc}_{1}\mathrm{ccccc}_{1})\mathrm{c}_{1}\mathrm{ccccc}_{1}\). Recognizing these structures is crucial for identifying possible dihalides.
02

Create Strategy for Alkynes

To form an alkyne, we can use the elimination of dihalides. For an alkyne with a structure \(\mathrm{R}-\mathrm{C} \equiv \mathrm{C}-\mathrm{R}\), the dihalide should be \(\mathrm{R}-\mathrm{C}X-\mathrm{C}X-\mathrm{R}\). The elimination reaction typically involves the removal of two halogen atoms and the formation of a triple bond in between.
03

Devise Dihalide for Part a

For \(\mathrm{CH}_{3} \mathrm{C} \equiv \mathrm{CCH}_{3}\), the dihalide could be 1,2-dibromo- or 1,2-dichloro-ethane, i.e., \(\mathrm{CH}_3 \mathrm{CX} \mathrm{CXCH}_3\). Both bromine and chlorine can be used effectively as leaving groups in elimination reactions to create the alkyne.
04

Propose Dihalide for Part b

The alkyne \(\mathrm{C} \equiv \mathrm{C}(\mathrm{C}(\mathrm{C})(\mathrm{C})\mathrm{C})\) suggests a dihalide such as 2,3-dibromo- or 2,3-dichloro-3,3-dimethylbutane. The halogens would be on carbon atoms adjacent to the future triple bond, allowing for the creation of the alkyne by dehydrohalogenation.
05

Suggest Dihalide for Part c

For the alkyne \(\mathrm{C}(=\mathrm{Cc}_{1}\mathrm{ccccc}_{1})\mathrm{c}_{1}\mathrm{ccccc}_{1}\), the corresponding dihalide is likely a geminal or vicinal dihalide like 2,3-dibromostilbene or 2,3-dichlorostilbene. The goal is to place halogens on the carbon adjacent to the double bond to allow formation of the alkyne bond through elimination.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Structure of Alkynes
Alkynes are fascinating organic compounds characterized by the presence of at least one carbon-carbon triple bond. This functional group significantly influences the chemical properties of alkynes, including their reactivity and stability. An alkyne can be recognized by its general formula, \( ext{C}_n ext{H}_{2n-2}\), which denotes the reduced hydrogen content compared to alkanes and alkenes.

The carbon-carbon triple bond consists of one sigma bond and two pi bonds, which are responsible for the linear geometry around the triple-bonded carbons. This configuration leads to a bond angle of approximately 180°. Because of the triple bond's rigidity, alkynes have a unique structure and are less flexible compared to other hydrocarbons.

The simplest alkyne, acetylene \( ext{CH} \equiv \text{CH}\), serves as a building block for more complex alkynes, which can include additional carbon atoms and functional groups. The triple bond endows alkynes with unique capabilities in synthetic chemistry, allowing for further functionalization through various reactions.
Elimination Reactions
Elimination reactions are fundamental in the transformation of dihalides into alkynes. In organic chemistry, elimination reactions involve the removal of atoms or groups from a molecule, leading to the formation of a multiple bond. These reactions are crucial for converting a two-dimensional dihalide into a three-dimensional alkyne structure.

During the elimination process, two halogen atoms (e.g., bromine or chlorine) are typically removed along with adjacent hydrogen atoms. This removal facilitates the formation of a pi bond, and ultimately, in the case of alkynes, a triple bond.

There are several types of elimination reactions, including E1, E2, and E1cb. The choice of reaction conditions, such as temperature, solvent, and base, significantly impacts the efficiency and mechanism of the elimination process. By carefully selecting these conditions, chemists can specifically direct the formation of alkynes from vicinal or geminal dihalides.
Vicinal and Geminal Dihalides
Understanding the difference between vicinal and geminal dihalides is essential when synthesizing alkynes. Vicinal dihalides have two halogen atoms on adjacent carbon atoms. This arrangement is perfect for synthesis reactions that rely on a single-step elimination to form a double or triple bond.

In contrast, geminal dihalides have both halogen atoms attached to the same carbon atom. This structure often requires a stepwise mechanism to form a desired alkyne, as it involves the conversion of a single-bond environment to a multi-bond scenario.

The consideration of whether a dihalide is vicinal or geminal helps dictate the number of steps and type of conditions necessary to produce a triple-bonded product. Recognizing these molecular nuances is especially useful in planning the most efficient path toward alkyne formation.
Dehydrohalogenation
Dehydrohalogenation is a critical reaction for transforming dihalides into alkynes. This process involves the removal of hydrogen and halogen atoms, commonly facilitated by bases such as potassium hydroxide (KOH) or sodium amide (NaNHâ‚‚).

In dehydrohalogenation, the base abstracts a hydrogen atom from the carbon adjacent to the halogen. This action initiates the elimination of the halogen as a leaving group, leading to the formation of a new bond. For example, in the conversion of 1,2-dibromoethane to acetylene, a two-step dehydrohalogenation will first generate an alkene and subsequently an alkyne.

Controlled dehydrohalogenation conditions, such as solvent choice and temperature, are crucial to prevent side reactions and achieve the desired alkyne efficiently. Mastery of this reaction is pivotal for constructing complex alkyne structures in synthetic organic chemistry.
Triple Bond Formation
The formation of a triple bond in an alkyne is a fascinating transformation that often begins with dihalides. Triple bonds are the strongest and shortest types of carbon-carbon bonds, comprised of one sigma bond and two relatively weaker pi bonds.

To achieve triple bond formation, chemists leverage elimination reactions where the removal of atoms or groups is thoughtfully orchestrated to introduce consecutive pi bonds alongside the existing sigma bond. The integrity and alignment of these bonds give alkynes their distinctive linear geometry and high-energy characteristics.

Achieving triple bond formation requires a precise understanding of reaction mechanisms and conditions that encourage bond completeness and stability. Particularly in synthetic chemistry, controlling the factors that influence bond formation, such as the nature of starting materials (vicinal or geminal dihalides), the base used, and reaction temperature, is crucial to synthesizing targeted alkyne compounds successfully.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Rank the alkyl halides in each group in order of increasing reactivity in an E2 reaction. a. \(\left(\mathrm{CH}_{3}\right)_{2} \mathrm{C}(\mathrm{Br}) \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{3}\) \(\left(\mathrm{CH}_{3}\right)_{2} \mathrm{CHCH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{Br}\) \(\left(\mathrm{CH}_{3}\right)_{2} \mathrm{CHCH}_{2} \mathrm{CH}(\mathrm{Br}) \mathrm{CH}_{3}\) b. ClCCC1CCCCC1 CC1(Cl)CCCCC1 CC1CCCC(Cl)C1

Classify each alkene in the following vitamins by the number of carbon substituents bonded to the double bond. a. CC(C=CC=CC(C)=CC1=C(C)CCCC1(C)C)=CCO b.

Draw all constitutional isomers formed in each elimination reaction. Label the mechanism as E2 or E1. \(\mathrm{OCH}_{3}\) a. CCC(C)Br CCCCCI CC(C)C1CCC(Cl)CC1 \- OH b. CCC(C)Br \(\mathrm{CH}_{3} \mathrm{OH}, \mathrm{d.}\left[\mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{CH}_{3} \stackrel{\mathrm{H}_{2} \mathrm{f} .}{ }\right.\) CC(C)C1CCCC(Cl)C1

How does each of the following changes affect the rate of an E1 reaction? a. doubling [RX] d. changing the leaving group from \(\mathrm{Cl}^{-}\) to \(\mathrm{Br}\) b. doubling [B:] e. changing the solvent from DMSO to \(\mathrm{CH}_{3} \mathrm{OH}\) c. changing the halide from \(\left(\mathrm{CH}_{3}\right)_{3} \mathrm{CBr}\) to \(\mathrm{CH}_{3} \mathrm{CH}_{2} \mathrm{CH}_{2} \mathrm{Br}\)

Rank the alkyl halides in each group in order of increasing E2 reactivity. Then do the same for E1 reactivity. a. CC(C)CCC(C)Br CCCCC(C)(C)Br CC(C)CCCCBr b. CC1(Cl)CCCC1 CC1CCC(Cl)C1 CC1(Br)CCCC1

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.