Chapter 25: Problem 10
Write structural formulas showing the constitution of each of the following dipeptides. Rewrite each sequence using one-letter abbreviations for the amino acids. (a) Gly-Ala (b) Ala-Phe (c) Phe-Ala (d) Gly-Glu (e) Lys-Gly (f) d-Ala-d-Ala
Short Answer
Expert verified
GA, AF, PA, GE, KG, AA.
Step by step solution
01
Understand Dipeptides
A dipeptide is formed by two amino acids that are linked by a peptide bond. The peptide bond is formed when the carboxyl group of one amino acid reacts with the amino group of another, releasing a molecule of water in a condensation reaction.
02
Structural Formula of Gly-Ala
Glycine (Gly) has the structure H2N-CH2-COOH, and Alanine (Ala) has H2N-CH(CH3)-COOH. The peptide bond will form between the -COOH of Glycine and the -NH2 of Alanine, resulting in the structure: NH2-CH2-CONH-CH(CH3)-COOH. In one-letter shorthand it is represented as GA.
03
Structural Formula of Ala-Phe
Alanine (Ala) has the structure H2N-CH(CH3)-COOH, and Phenylalanine (Phe) has H2N-CH(C6H5)-COOH. The peptide bond is NH2-CH(CH3)-CONH-CH(C6H5)-COOH. In one-letter shorthand it is represented as AF.
04
Structural Formula of Phe-Ala
Phenylalanine (Phe) is H2N-CH(C6H5)-COOH and Alanine (Ala) is H2N-CH(CH3)-COOH. Connecting Phe to Ala, the peptide bond is NH2-CH(C6H5)-CONH-CH(CH3)-COOH. In one-letter shorthand, it is PA.
05
Structural Formula of Gly-Glu
Glycine (Gly) is H2N-CH2-COOH and Glutamic Acid (Glu) is H2N-CH(C2H4COOH)-COOH. The peptide bond structure is NH2-CH2-CONH-CH(C2H4COOH)-COOH. In one-letter abbreviation, it's GE.
06
Structural Formula of Lys-Gly
Lysine (Lys) has the structure H2N-CH((CH2)4NH2)-COOH, and Glycine (Gly) is H2N-CH2-COOH. The connected structure via peptide bond is NH2-CH((CH2)4NH2)-CONH-CH2-COOH. In one-letter abbreviation, it's KG.
07
Structural Formula of d-Ala-d-Ala
d-Alanine and d-Alanine both have the structure H2N-CH(CH3)-CO-dash (indicating D-configuration). The peptide bond structure is NH2-CH(CH3)-CONH-CH(CH3)-COOH. In one-letter abbreviation, it's AA (d stands for the configuration).
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Amino acids
Amino acids are the building blocks of proteins, playing a crucial role in various biological processes. Each amino acid consists of a central carbon atom bonded to four different groups: an amino group (-NH2), a carboxyl group (-COOH), a hydrogen atom, and a distinctive side chain (R group) that dictates the identity and properties of the amino acid. The R group can range from a simple hydrogen atom, as seen in glycine, to more complex structures like the indole ring in tryptophan.
The twenty standard amino acids differ in the structure of their R groups, leading to varying chemical properties, such as polarity, acidity, and charge. These differences influence the way amino acids interact with one another and with the environment, ultimately shaping protein structure and function. Amino acids can polymerize into peptides and proteins through the formation of peptide bonds, leading us to our next concept.
The twenty standard amino acids differ in the structure of their R groups, leading to varying chemical properties, such as polarity, acidity, and charge. These differences influence the way amino acids interact with one another and with the environment, ultimately shaping protein structure and function. Amino acids can polymerize into peptides and proteins through the formation of peptide bonds, leading us to our next concept.
Peptide bond
A peptide bond is a covalent bond that links two amino acids together, forming a dipeptide or longer chain called a peptide. This bond is the result of a condensation reaction between the carboxyl group of one amino acid and the amino group of another. During this process, a molecule of water is released, which is why it is called a dehydration synthesis.
The formation of a peptide bond results in the overlap of the amino group from one amino acid and the carboxyl group from another, establishing a new molecular structure with a unique backbone: the sequence -NH-CO-. This strong bond is essential for maintaining the stability and functionality of peptides and proteins. Once formed, a peptide bond is relatively stable under normal physiological conditions, though hydrolysis can occur under specific circumstances, breaking the bond and separating the amino acids. Understanding peptide bonds is fundamental when studying dipeptides like Gly-Ala or Ala-Phe.
The formation of a peptide bond results in the overlap of the amino group from one amino acid and the carboxyl group from another, establishing a new molecular structure with a unique backbone: the sequence -NH-CO-. This strong bond is essential for maintaining the stability and functionality of peptides and proteins. Once formed, a peptide bond is relatively stable under normal physiological conditions, though hydrolysis can occur under specific circumstances, breaking the bond and separating the amino acids. Understanding peptide bonds is fundamental when studying dipeptides like Gly-Ala or Ala-Phe.
One-letter abbreviation
In the realm of biochemistry, shorthand notation for amino acids is often used to simplify communication and writing. Each of the 20 standard amino acids is assigned a unique one-letter abbreviation, allowing for quick and easy notation of protein sequences.
- For example, Glycine is abbreviated as 'G', Alanine as 'A', and Phenylalanine as 'F'.
- These abbreviations emerge from the initials of the amino acid names, or in some cases, unique characters, to prevent overlap.