/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 43 Calculate the \(\mathrm{pH}\) of... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Calculate the \(\mathrm{pH}\) of \(0.05 \mathrm{M}\) sodium acetate solution if the \(p K_{a}\) of acetic acid is \(4.74\)

Short Answer

Expert verified
Calculate Ka from pKa, then calculate Kb. Use the hydrolysis reaction and equilibrium expression to set up and solve an ICE table, then use this to find the pOH, and finally calculate the pH.

Step by step solution

01

Understanding the problem

We are given the molarity of sodium acetate (NaCH3COO) solution and the pKa of acetic acid (CH3COOH). To find the pH of the solution, we need to understand that NaCH3COO is the salt of a weak acid (CH3COOH) and a strong base (NaOH). In water, it hydrolyzes to form CH3COO- and Na+. The CH3COO- reacts with water to form CH3COOH and OH- ions. We can calculate the concentration of these OH- ions and then find the pOH. The pH can then be determined using the formula pH + pOH = 14.
02

Write the hydrolysis reaction

CH3COO- (aq) + H2O (l) ⇌ CH3COOH (aq) + OH- (aq).We apply the equilibrium expression for the hydrolysis reaction to find the hydroxide ion concentration.
03

Write the equilibrium expression

The hydrolysis constant (Kb) of the acetate ion can be found using the relation Kb = Kw / Ka, where Kw is the ion-product constant of water (1.0 x 10^-14 at 25 degrees Celsius) and Ka is the acid dissociation constant of the conjugate acid (acetic acid). Ka can be found using pKa = -log(Ka). Then, we can express Kb as Kb = [CH3COOH][OH-]/[CH3COO-].
04

Calculate the Ka and Kb values

Ka = 10^(-pKa) = 10^(-4.74).Kb = Kw / Ka = (1.0 x 10^-14) / (10^(-4.74)).
05

Set up the ICE table

Using an ICE (Initial, Change, Equilibrium) table, we start with initial concentrations, account for changes as the system reaches equilibrium, and then solve for the equilibrium concentrations so that we can find [OH-]. The initial concentration of CH3COO- is 0.05 M, and initially there is no CH3COOH or OH-.
06

Assume small x approximation

Since we're dealing with a weak base equilibrium, we can assume that the change in concentration (x) is very small compared to the initial concentration, thus the concentration of CH3COO- at equilibrium is approximately 0.05 M.
07

Solve for x using the Kb expression

Kb ≈ x^2 / [CH3COO-].Solve for x (which is [OH-]) using the calculated Kb value and the concentration of CH3COO- from the ICE table.
08

Calculate the pOH and pH

pOH = -log([OH-]).Then use the relation pH = 14 - pOH to find the pH of the solution.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

pKa and pH Relationship
The relationship between pKa and pH is foundational to understanding acid-base chemistry. The pKa value is a measure of the strength of an acid; it's the negative logarithm of the acid dissociation constant (Ka). It indicates at what pH level half of the acid molecules are deprotonated (lose a hydrogen ion).

In the context of sodium acetate solutions, acetic acid's pKa helps us assess the degree to which the conjugate base (CH3COO-) can attract a hydrogen ion from water, creating hydroxide ions (OH-) and thus affecting the pH. Since pH is a measure of hydrogen ion concentration, and pKa provides a way to calculate the equilibrium concentrations, by knowing the pKa of acetic acid, we can determine the pH of its corresponding salt solution after hydrolysis.

Moreover, a lower pKa means a stronger acid; thus the conjugate base would be weaker and its solution less basic. This relationship enables us to predict how the pH will shift when an acid or its conjugate base is in solution.
Hydrolysis of Salts
Hydrolysis of salts occurs when salt ions react with water to form the acid or base. In the case of sodium acetate, the acetate ion (CH3COO-) is a conjugate base of acetic acid and can undergo hydrolysis to form hydroxide ions (OH-) and acetic acid.

This reaction is crucial because it directly impacts the pH of the solution. Since sodium acetate is derived from a weak acid and a strong base, the hydrolysis of the acetate ion will tend to make the solution more basic (higher pH). The extent to which this happens depends on the acid-base properties of the ions involved, which is determined by their respective pKa and pKb values.

Understanding the hydrolysis mechanism helps us predict the behavior of a solution and the dominant species at equilibrium. It is a perfect demonstration of how salts can affect the acidity or basicity of a solution, even though they might be neutral themselves.
ICE Table Method
The ICE (Initial, Change, Equilibrium) table method is an indispensable tool for solving equilibrium problems in chemistry. 'I' stands for the initial concentration of reactants and products, 'C' represents the change in concentration as reactants are converted to products, and 'E' stands for the equilibrium concentrations.

For sodium acetate hydrolysis, the ICE table helps quantify the hydrolysis process by outlining the initial concentrations of acetate ions and water, the changes as equilibrium is established, and the resulting concentrations of acetic acid and hydroxide ions.

This method simplifies dealing with complex equilibrium calculations by providing a structured approach. By assuming that the change in concentration of the hydrolyzed species (often labeled as 'x') is small, we can solve for 'x' essentially the concentration of OH- ions in a solution of a weak base like acetate.
Acid-Base Equilibrium
Acid-base equilibrium refers to the state in which the rates of the forward and reverse reactions of acid and base are equal, leading to constant concentrations of all species in solution. This equilibrium is governed by the acid dissociation constant (Ka) for acids or the base dissociation constant (Kb) for bases.

In the sodium acetate example, the equilibrium focuses on the hydrolysis reaction of the acetate ion. Using the known pKa of acetic acid, we can determine the Kb for the acetate ion and then use the ICE table approach to find the equilibrium concentrations of all species. It is important to consider the self-ionization of water as well, which provides a basis for calculating the hydroxide ion concentration and, subsequently, the pH of the solution.

The calculations based on this state of equilibrium help us understand the extent to which a substance can alter the pH of a solution. A strong grasp of acid-base equilibrium concepts allows students to predict the direction and extent of pH changes in any aqueous system.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.