Chapter 21: Problem 23
Show by chemical equations how alanine and glutamine can be combined to give two different dipeptides.
Short Answer
Expert verified
Two dipeptides can be formed: Ala-Gln and Gln-Ala.
Step by step solution
01
Write the Structures of Amino Acids
First, note the structures of alanine (Ala) and glutamine (Gln). Alanine has the formula CH3-CH(NH2)-COOH, and glutamine has the formula H2N-(CH2)2-CONH2-CH(NH2)-COOH. Both amino acids contain an amino group (-NH2) and a carboxyl group (-COOH).
02
Forming Ala-Gln Dipeptide
To form the dipeptide alanine-glutamine (Ala-Gln), the carboxyl group (-COOH) of alanine reacts with the amino group (-NH2) of glutamine. This forms a peptide bond, releasing a molecule of water (H2O) in a condensation reaction. The chemical equation is:
CH3-CH(NH2)-COOH + H2N-(CH2)2-CONH2-CH(NH2)-COOH → CH3-CH(NH2)-CO-NH-(CH2)2-CONH2-CH(NH2)-COOH + H2O.
03
Forming Gln-Ala Dipeptide
To form the dipeptide glutamine-alanine (Gln-Ala), the carboxyl group (-COOH) of glutamine reacts with the amino group (-NH2) of alanine. This also forms a peptide bond and releases water. The chemical equation is:
H2N-(CH2)2-CONH2-CH(NH2)-COOH + CH3-CH(NH2)-COOH → H2N-(CH2)2-CONH2-CH(NH2)-CO-NH-CH(CH3)-COOH + H2O.
04
Summary of Formation
In both reactions, a peptide bond is formed between the carboxyl group of one amino acid and the amino group of another, releasing a water molecule. The order of amino acids determines the type of dipeptide formed; either alanine is on the N-terminal (Ala-Gln) or glutamine (Gln-Ala).
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Peptide Bond
A peptide bond is a type of covalent bond specifically found in proteins. It is formed between amino acids, which are the building blocks of proteins. A peptide bond arises when the carboxyl group (-COOH) of one amino acid reacts with the amino group (-NH2) of another. This reaction releases a water molecule and holds the amino acids together in chains. Peptide bonds are crucial because they link amino acids, enabling proteins to form and function properly.
Peptide bonds are strong and stable, providing structural integrity to proteins. They form a backbone that is resistant to changes under physiological conditions. These bonds are represented in chemical structures as a C-N bond, specifically a linkage between the carbon atom of the carboxyl group and the nitrogen atom of the amino group.
Peptide bonds are strong and stable, providing structural integrity to proteins. They form a backbone that is resistant to changes under physiological conditions. These bonds are represented in chemical structures as a C-N bond, specifically a linkage between the carbon atom of the carboxyl group and the nitrogen atom of the amino group.
Condensation Reaction
In the context of biochemistry, a condensation reaction is a crucial process that forms bonds between molecules while removing water. During the formation of a dipeptide from two amino acids, a condensation reaction occurs.
This reaction involves the removal of a water molecule when the carboxyl group of one amino acid binds with the amino group of another amino acid. The result is the formation of a new bond, specifically a peptide bond, and the creation of a longer peptide chain.
This reaction involves the removal of a water molecule when the carboxyl group of one amino acid binds with the amino group of another amino acid. The result is the formation of a new bond, specifically a peptide bond, and the creation of a longer peptide chain.
- This type of reaction is essential for building larger macromolecules like proteins.
- It is the opposite of a hydrolysis reaction, where a molecule is split using water.
- Condensation reactions are fundamental to many biological processes beyond forming peptides, such as synthesizing nucleic acids and carbohydrates.
Amino Acids
Amino acids are organic compounds that serve as the building blocks of proteins, playing vital roles in countless biological processes. Each amino acid has a basic structure comprised of:
In dipeptide formation, each amino acid joins another by forming a peptide bond, creating protein chains necessary for complex cellular functions. Their unique sequence determines the structure and function of the resulting protein.
- An amino group (-NH2).
- A carboxyl group (-COOH).
- A variable side chain or R-group that determines the distinct characteristics of each amino acid.
In dipeptide formation, each amino acid joins another by forming a peptide bond, creating protein chains necessary for complex cellular functions. Their unique sequence determines the structure and function of the resulting protein.
Chemical Equation
A chemical equation represents a chemical reaction through symbols and formulas. In peptide formation, these equations illustrate how amino acids react to form dipeptides.
Chemical equations are structured as:
\[ \text{CH}_3\text{CH(NH}_2\text{)COOH + H}_2\text{N-(CH}_2\text{)}_2\text{CONH}_2\text{CH(NH}_2\text{)COOH } \rightarrow \text{CH}_3\text{CH(NH}_2\text{)CONH-(CH}_2\text{)}_2\text{CONH}_2\text{CH(NH}_2\text{)COOH + H}_2\text{O} \]
This equation summarizes how alanine and glutamine join to form a dipeptide while releasing a water molecule through a condensation reaction.
Chemical equations are structured as:
- Reactants are written on the left side.
- Products are on the right side.
- An arrow indicates the direction of the reaction from reactants to products.
\[ \text{CH}_3\text{CH(NH}_2\text{)COOH + H}_2\text{N-(CH}_2\text{)}_2\text{CONH}_2\text{CH(NH}_2\text{)COOH } \rightarrow \text{CH}_3\text{CH(NH}_2\text{)CONH-(CH}_2\text{)}_2\text{CONH}_2\text{CH(NH}_2\text{)COOH + H}_2\text{O} \]
This equation summarizes how alanine and glutamine join to form a dipeptide while releasing a water molecule through a condensation reaction.