Chapter 13: Problem 7
Draw a structural formula for each of the following alcohols. (a) Isobutyl alcohol (b) \(1,4-\) Butanediol (c) 5 -Methyl-1-hexanol (d) 1,3 -Pentanediol (e) trans\(-1,\) 4-Cyclohexanediol (f) \(1-\) Chloro- 2 -propanol
Short Answer
Expert verified
Each alcohol is drawn using its structure and naming conventions.
Step by step solution
01
Understand the Basics of Alcohol Structure
Alcohols contain the hydroxyl group (-OH) bonded to a carbon atom. The naming of alcohol helps identify the structure, indicating the positioning of the OH group and any branches or substituents.
02
Draw Isobutyl Alcohol (a)
Isobutyl alcohol has the structure of four carbon atoms in a chain, with the OH group attached to the second carbon. Draw four carbon atoms: CH3-CH2-CH(CH3)-OH.
03
Draw 1,4-Butanediol (b)
1,4-Butanediol is a four-carbon chain with hydroxyl groups on the first and fourth carbons. Draw four carbon atoms in a row and attach OH groups to each end: HO-CH2-CH2-CH2-CH2-OH.
04
Draw 5-Methyl-1-hexanol (c)
5-Methyl-1-hexanol is a six-carbon chain with a methyl group on the fifth carbon and an OH group at the end, carbon one. Write CH3-CH2-CH2-CH2-CH(CH3)-CH2-OH.
05
Draw 1,3-Pentanediol (d)
1,3-Pentanediol is a five-carbon chain with OH groups on the first and third carbons. Structure: HO-CH2-CH2-CH(OH)-CH2-CH3.
06
Draw trans-1,4-Cyclohexanediol (e)
A cyclohexane ring with OH groups on carbons 1 and 4 opposite each other (trans orientation). A possible representation: starting from any carbon, proceed with the OH on the first followed by placing the second OH on the opposite carbon, ensuring these are trans.
07
Draw 1-Chloro-2-propanol (f)
This is a three-carbon compound with a chloro substituent on carbon 1 and an OH group on carbon 2. Arrange as Cl-CH2-CHOH-CH3.
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Hydroxyl Group
A hydroxyl group is a functional group consisting of an oxygen atom bonded to a hydrogen atom, represented as
-OH. It is a defining feature of alcohols and plays a crucial role in determining their properties. The hydroxyl group is polar due to the electronegativity difference between oxygen and hydrogen, which influences the solubility and boiling points of alcohols.
Hydroxyl groups are typically bonded to carbon atoms. This bond occurs during oxidation reactions where the hydroxyl group replaces a hydrogen atom on a carbon chain. In naming alcohols, the position of the hydroxyl group is indicated by a number, showing which carbon atom it is attached to.
Understanding this concept helps in visualizing and drawing the structures of any alcohol. Knowing where to place the hydroxyl group is crucial for representing molecules such as isobutyl alcohol and 1,4-butanediol in their correct structural forms.
Hydroxyl groups are typically bonded to carbon atoms. This bond occurs during oxidation reactions where the hydroxyl group replaces a hydrogen atom on a carbon chain. In naming alcohols, the position of the hydroxyl group is indicated by a number, showing which carbon atom it is attached to.
Understanding this concept helps in visualizing and drawing the structures of any alcohol. Knowing where to place the hydroxyl group is crucial for representing molecules such as isobutyl alcohol and 1,4-butanediol in their correct structural forms.
Isobutyl Alcohol
Isobutyl alcohol is a type of alcohol that consists of four carbon atoms with a unique branching structure. Its IUPAC name is 2-methylpropanol, which reflects the branching on the second carbon. This compound is often represented by the molecular formula
CH extsubscript{3}-CH extsubscript{2}-CH(CH extsubscript{3})-OH.
To draw isobutyl alcohol, start with a simple three-carbon chain (propane). Next, add a methyl group (CH extsubscript{3}) as a branch on the middle carbon atom. Finally, attach a hydroxyl group to the end carbon. This positioning emphasizes the characteristic structure that differentiates isobutyl alcohol from other butyl alcohols.
Understanding the branching in isobutyl alcohol helps clarify why the placement of atoms results in different physical properties such as solubility and boiling points, compared to linear counterparts.
To draw isobutyl alcohol, start with a simple three-carbon chain (propane). Next, add a methyl group (CH extsubscript{3}) as a branch on the middle carbon atom. Finally, attach a hydroxyl group to the end carbon. This positioning emphasizes the characteristic structure that differentiates isobutyl alcohol from other butyl alcohols.
Understanding the branching in isobutyl alcohol helps clarify why the placement of atoms results in different physical properties such as solubility and boiling points, compared to linear counterparts.
1,4-Butanediol
1,4-Butanediol is an example of a diol, which is an alcohol possessing two hydroxyl groups. For this particular molecule, the hydroxyl groups are on the first and fourth carbon atoms of a straight four-carbon backbone. Its structure is depicted as HO-CH extsubscript{2}-CH extsubscript{2}-CH extsubscript{2}-CH extsubscript{2}-OH.
To construct 1,4-butanediol, begin by linking four carbon atoms in a sequence to form a butane chain. Then add a hydroxyl group to both ends of the chain (carbons one and four). This symmetrical arrangement is key to its stability and function in various chemical processes.
Being a diol, 1,4-butanediol has unique chemical properties, like higher solubility in water compared to monohydric alcohols, and it serves as a crucial intermediate in the synthesis of various chemical products, including but not limited to plastics and pharmaceuticals.
To construct 1,4-butanediol, begin by linking four carbon atoms in a sequence to form a butane chain. Then add a hydroxyl group to both ends of the chain (carbons one and four). This symmetrical arrangement is key to its stability and function in various chemical processes.
Being a diol, 1,4-butanediol has unique chemical properties, like higher solubility in water compared to monohydric alcohols, and it serves as a crucial intermediate in the synthesis of various chemical products, including but not limited to plastics and pharmaceuticals.
Cyclohexanediol
Cyclohexanediol is a cyclical alcohol with a cyclohexane base ring. The diol reference indicates that it contains two hydroxyl groups. In structures like trans-
1,4-cyclohexanediol, the two hydroxyl groups are attached to carbons number 1 and 4, and positioned opposite from each other, which indicates a trans-relationship.
The presence of the hydroxyl groups on the cyclohexane ring leads to particular spatial configurations, which significantly impacts the chemical behavior. The trans configuration minimizes steric hindrance between the groups, allowing it to interact differently in chemical reactions.
Cyclohexanediols are important in materials science and pharmaceuticals because their structure can lead to specific interactions with other substances, making them useful for creating polymers or medications. Learning to represent these structures correctly is important for understanding their potential applications.
The presence of the hydroxyl groups on the cyclohexane ring leads to particular spatial configurations, which significantly impacts the chemical behavior. The trans configuration minimizes steric hindrance between the groups, allowing it to interact differently in chemical reactions.
Cyclohexanediols are important in materials science and pharmaceuticals because their structure can lead to specific interactions with other substances, making them useful for creating polymers or medications. Learning to represent these structures correctly is important for understanding their potential applications.