Chapter 24: Problem 40
Write the condensed structural formula for each of the following compounds. a. 2,3 -dimethyl-2-pentene b. 2-methyl-4-propyl-3-heptene
Short Answer
Expert verified
a. CH3C(CH3)=C(CH3)CH2CH3; b. CH3CH(CH3)CH=CHCH2CH(CH2CH2CH3)CH3
Step by step solution
01
Understanding the Nomenclature
Before writing the condensed structural formula, identify the base chain and side groups from the given IUPAC names. The base chain in compound (a) is pentene, indicating a 5-carbon chain with a double bond on the second carbon. In compound (b), the base chain is heptene, a 7-carbon chain with a double bond on the third carbon.
02
Identify the Double Bond Location
For compound (a) 2,3-dimethyl-2-pentene, locate the double bond between the second and third carbon atoms in the base chain. For compound (b) 2-methyl-4-propyl-3-heptene, the double bond is between the third and fourth carbon atoms.
03
Determine Substituents and their Positions
In compound (a), there are two methyl groups attached to the second and third carbon atoms. In compound (b), there is a methyl group attached to the second carbon and a propyl group attached to the fourth carbon of the heptene chain.
04
Write the Condensed Structural Formula
For 2,3-dimethyl-2-pentene, the condensed structural formula is CH3C(CH3)=C(CH3)CH2CH3. For 2-methyl-4-propyl-3-heptene, the condensed structural formula is CH3CH(CH3)CH=CHCH2CH(CH2CH2CH3)CH3.
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
IUPAC nomenclature
The International Union of Pure and Applied Chemistry (IUPAC) nomenclature is a system for naming chemical compounds systematically. This allows chemists to easily identify a substance based on its name. The IUPAC system is key to ensuring that each compound has a unique and standardized name, minimizing confusion.
IUPAC names consist of several components:
IUPAC names consist of several components:
- The root or base name signifies the primary carbon chain in the molecule.
- Suffixes indicate the type of chemical bond (e.g., -ene for alkenes).
- Prefixes denote the presence of substituents or side groups, specifying their position on the carbon chain.
- Numerical locants are used to identify the position of double bonds and substituents.
Alkenes
Alkenes are a class of hydrocarbons characterized by having at least one carbon-carbon double bond, denoted by the suffix -ene. These double bonds make alkenes unsaturated compounds because they have fewer hydrogen atoms than their alkane counterparts.
Key features of alkenes include:
Key features of alkenes include:
- The presence of one or more double bonds within the carbon chain.
- A general formula of \\(C_nH_{2n}\) when there is only one double bond and no rings.
- Isomerism possibilities due to the restriction rotation around the double bond, leading to different spatial arrangements of substituents.
Carbon chain
The carbon chain forms the backbone of organic molecules and is crucial for defining the compound's structure. The carbon atoms are bonded in a linear or branched manner in aliphatic compounds, while aromatic compounds contain ring structures.
For the carbon chains:
For the carbon chains:
- The length and arrangement of the chain determine the physical and chemical properties of the compound.
- Carbon chains can range from a single carbon atom to long chains containing thousands of atoms.
- Naming the longest continuous chain helps identify the primary structure in IUPAC nomenclature.
Organic chemistry
Organic chemistry is the branch of chemistry that studies the structure, properties, composition, reactions, and synthesis of organic compounds primarily made of carbon and hydrogen atoms.
Important aspects of organic chemistry include:
Important aspects of organic chemistry include:
- Understanding the structure and bonding patterns of carbon compounds.
- Learning about various functional groups and their reactivity.
- Studying the mechanisms by which organic compounds undergo transformations.
- Identifying different classes of organic compounds such as alkanes, alkenes, alkynes, alcohols, and more.