/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 93 The precipitation of \(\mathrm{A... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

The precipitation of \(\mathrm{A}(\mathrm{OH})_{3}\left(K_{s p}=1.3 \times 10^{-3}\right)\) is sometimes used to purify water. (a) Estimate the pH at which precipitation of \(\mathrm{Al}(\mathrm{OH})_{3}\) will begin if \(5.0 \mathrm{lb}^{\text {of }} \mathrm{Al}_{2}\left(\mathrm{SO}_{4}\right)_{3}\) is added to \(2000 \mathrm{gal}\) of water. (b) Approximately how many pounds of \(\mathrm{CaO}\) must be added to the water to achieve this pH?

Short Answer

Expert verified
The pH at which precipitation of \(\mathrm{Al}(\mathrm{OH})_{3}\) will begin if \(5.0\,\mathrm{lb}\) of \(\mathrm{Al}_{2}\left(\mathrm{SO}_{4}\right)_{3}\) is added to \(2000\,\mathrm{gal}\) of water is approximately 4.62. To achieve this pH, approximately 10.15 g or 0.02 pounds of \(\mathrm{CaO}\) must be added to the water.

Step by step solution

01

Calculate the moles of \(\mathrm{Al}_{2}\left(\mathrm{SO}_{4}\right)_{3}\) added to the water

First, we need to convert the given mass of \(\mathrm{Al}_{2}\left(\mathrm{SO}_{4}\right)_{3}\) (5.0 lb) into moles. The molar mass of \(\mathrm{Al}_{2}\left(\mathrm{SO}_{4}\right)_{3} = 2(\text{27.0}) + 3(4 \times 16.0 + 32.0) = 342.2 g/mol\). We will also convert the given volume of water, 2000 gal, to liters using the conversion factor: 1 gal = 3.78541 L. \[{\text {Moles of }} \mathrm{Al}_{2}\left(\mathrm{SO}_{4}\right)_{3}= \frac{\text{Mass}}{\text{Molar mass}} = \frac{5.0\text{ lb} \times 453.592 \frac{\text{ g}}{\text{ lb}}}{342.2\frac{\text{ g}}{\text{ mol}}} = 6.646 \text{ mol}\]
02

Calculate the concentration of \(\mathrm{A}(\mathrm{OH})_{3}\) before precipitation

Now, we will find the concentration of \(\mathrm{A}^{3+}\) ions in water after adding \(\mathrm{Al}_{2}\left(\mathrm{SO}_{4}\right)_{3}\): \[\text{Volume of water (L)}= 2000 \text{ gal} \times \frac{3.78541\text{ L}}{\text{gal}}= 7570.82 \mathrm{L}\] Therefore, \[\mathrm{[A^{3+}]} =\frac{\text{moles of } \mathrm{Al}_{2}\left(\mathrm{SO}_{4}\right)_{3} \times 2}{\text{Volume of water (L)}} = \frac{6.646 \mathrm{mol} \times 2}{7570.82\mathrm{ L}} = 1.759 \times 10^{-3} \mathrm{M}\]
03

Determine the pH when \(\mathrm{A}(\mathrm{OH})_{3}\) begins to precipitate

Set up the equilibrium expression using the \(K_{sp}\) value and \(\mathrm{[A^{3+}]}\) concentration: \[K_{sp}=\mathrm{[A^{3+}][OH^{-}]^3}\] Now, we'll use the ion product of water, \(K_w = \mathrm{[H^+][OH^{-}]}=1 \times 10^{-14}\), and substitute in terms of \(\mathrm{[H^+]}\): \[K_w = \mathrm{[H^+]\left(\frac{[A^{3+}]}{[H^+]^3}\right)}\] Solving for \(\mathrm{[H^+]}\): \[\mathrm{[H^+]}=\sqrt[3]{\frac{K_w}{K_{sp}}\times[A^{3+}]}=\sqrt[3]{\frac{1 \times 10^{-14}}{1.3 \times 10^{-3}} \times 1.759 \times 10^{-3}\mathrm{M}} = 2.398 \times 10^{-5} \mathrm{M}\] Finally, calculate the pH: \[\text{pH} = -\log(\mathrm{[H^+]}) = -\log(2.398 \times 10^{-5}) = 4.62\]
04

Calculate the amount of \(\mathrm{CaO}\) needed

The balanced equation for the reaction of \(\mathrm{CaO}\) with water is: \[\mathrm{CaO}+H_2O\rightarrow Ca(OH)_2\] Assuming that all \(\mathrm{Ca(OH)_2}\) dissociates when added to the water, the moles of \(\mathrm{OH^-}\) ions produced are equal to the moles of \(\mathrm{CaO}\) added. Thus, the concentration of \(\mathrm{OH^-}\) ions in 7570.82 L of water is: \[\mathrm{[OH^{-}]} = \frac{\text{moles of CaO}}{7570.82\mathrm{ L}}\] The required pH after adding \(\mathrm{CaO}=4.62\) \[\text{pOH} = 14 - 4.62 = 9.38\] \[\mathrm{[H^+]}=10^{-9.38}=4.175 \times 10^{-10}\] The concentration of \(\mathrm{OH^-}\) required to maintain the desired pH is \[\mathrm{[OH^{-}]} = \frac{K_w}{[H^+]} = \frac{1 \times 10^{-14}}{4.175 \times 10^{-10}} = 2.392 \times 10^{-5}\] To find the moles of \(\mathrm{CaO}\) required, solve for moles of \(\mathrm{CaO}\) in the concentration equation: \[\mathrm{moles\,of\,CaO} = \mathrm{[OH^{-}]} \times 7570.82\mathrm{ L} = 2.392 \times 10^{-5} \times 7570.82\mathrm{ L} = 0.181\,\mathrm{mol}\] Now, calculate the mass of \(\mathrm{CaO}\) required: \[\text{Mass of CaO} = \mathrm{moles\,of\,CaO} \times \text{Molar mass of CaO} = 0.181\,\mathrm{mol} \times 56.08 \frac{\text{g}}{\text {mol}} = 10.15\,\mathrm{g}\] Thus, approximately 10.15 g or 0.02 pounds of \(\mathrm{CaO}\) must be added to achieve the desired pH.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Solubility Product Constant
Understanding the solubility product constant (Ksp) is fundamental when dealing with precipitation reactions. It represents the equilibrium between a solid and its respective ions in a solution. For a general compound AB3 that dissociates into A3+ and 3B-, the Ksp expression would be written as Ksp = [A3+][B-]3.

Higher Ksp values indicate a more soluble substance, whereas lower values suggest that the compound is less soluble, and thus more likely to precipitate under given conditions. In the context of pH and precipitation, as seen in the provided exercise with aluminum hydroxide, the pH at which precipitation begins can be estimated by manipulating the relationship between Ksp, Kw (the ion product of water), and the concentrations of the relevant ions.
Precipitation Reactions
Precipitation reactions occur when two soluble salts react in solution to form one or more insoluble products. The point at which the solid begins to form (precipitate) is when the product of the concentrations of the ions exceeds the solubility product constant, Ksp.

In our exercise, aluminum hydroxide begins to precipitate when the concentration of hydroxide ions increases at a certain pH level, making the product of ion concentrations greater than the Ksp. As Ksp is a constant at a given temperature, the pH determines the solubility of the substance in water — this underlies the pH-dependent precipitation process. By calculating the Ksp and the ion concentrations, as shown in the exercise solution, we can find the pH at which precipitation occurs.
Water Treatment Chemistry
The chemistry of water treatment involves processes to make water suitable for its intended use, which may be drinking, industrial water supply, or waste water treatment. Precipitation reactions are an essential part of water treatment, as they help in removing unwanted ions from the water.

For instance, the addition of aluminum sulfate (as in the exercise) is a common practice in water treatment to remove impurities through precipitation. When aluminum sulfate is added to water, it reacts with naturally occurring hydroxide ions to form aluminum hydroxide, a gelatinous precipitate that can drag down suspended particles as it settles. Adjusting the pH is a crucial step, typically done by adding bases like calcium oxide, to ensure that precipitation occurs efficiently, thus purifying the water.
Stoichiometry
Stoichiometry refers to the relationship between the relative quantities of substances taking part in a reaction or forming a compound, typically a ratio of whole integers. In a stoichiometric calculation, you balance the mass and the charge to ensure that matter is conserved.

In the exercise, stoichiometry comes into play when calculating the moles and mass of CaO needed to achieve a desired pH. The balanced chemical equation provides a stoichiometric ratio that tells us CaO fully reacts with water to form Ca(OH)2, which then dissociates to provide hydroxide ions necessary to increase the pH. We can use stoichiometry to determine exactly how much CaO we need to add to the water to reach the desired pH, ensuring no excess chemical is left unreacted. This principle illustrates the direct application of stoichiometry in water treatment processes.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

If an average \(O_{3}\) molecule "lives" only 100-200 seconds in the stratosphere before undergoing dissociation, how can \(\mathrm{O}_{3}\) offer any protection from ultraviolet radiation?

The solar power striking Earth every day averages 168 watts per square meter. The peak electrical power usage in New York City is 12,000 MW. Considering that present technology for solar energy conversion is about \(10 \%\) efficient, from how many square meters of land must sunlight be collected in order to provide this peak power? (For comparisen, the total area of New York city is \(830 \mathrm{~km}^{2}\).)

A friend of yours has seen each of the following items in newspaper articles and would like an explanation: (a) acid rain, (b) greenhouse gas, (c) photochemical smog, (d) ozone depletion. Give a brief explanation of each term and identify one or two of the chemicals associated with each. s in this respect?

The organic anion CCCCCC(C)c1ccc(S(=O)(=O)[O-])cc1 is found in most detergents. Assume that the anion undergoes aerobic decomposition in the following manner: $2 \mathrm{C}_{18} \mathrm{H}_{2} \mathrm{SO}_{3}^{-}(a q)+51 \mathrm{O}_{2}(a q) \longrightarrow$ $36 \mathrm{CO}_{2}(a q)+28 \mathrm{H}_{2} \mathrm{O}(l)+2 \mathrm{H}^{+}(a q)+2 \mathrm{SO}_{4}^{2-}(a q)$ What is the total mass of \(\mathrm{O}_{2}\) required to biodegrade $10.0 \mathrm{~g}$ of this substance?

(a) With respect to absorption of radiant energy, what distinguishes a greenhouse gas from a non-greenhouse gas? (b) \(\mathrm{CH}_{4}\) is a greenhouse gas, but \(\mathrm{N}_{2}\) is not. How might the molecular structure of \(\mathrm{CH}_{4}\) explain why it is a greenhouse gas?

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.