/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 55 (a) What are trihalomethanes (TH... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

(a) What are trihalomethanes (THMs)? (b) Draw the Lewis structures of two example THMs.

Short Answer

Expert verified
(a) Trihalomethanes (THMs) are organic compounds composed of a central carbon atom bonded to a hydrogen atom and three halogen atoms (fluorine, chlorine, bromine, or iodine). They are byproducts of drinking water chlorination and are associated with potential health risks. (b) Lewis structures for two example THMs: 1. Chloroform (CHCl3): \(H - C - Cl\) \(-Cl\) \(-Cl\) 2. Bromodichloromethane (CHBrCl2): \(H - C - Br\) \(-Cl\) \(-Cl\)

Step by step solution

01

(a) Defining Trihalomethanes (THMs)

Trihalomethanes (THMs) are a group of organic compounds that consist of a central carbon atom bonded to a hydrogen atom and three halogen atoms. Halogens include fluorine (F), chlorine (Cl), bromine (Br), and iodine (I). THMs are commonly formed as byproducts during the chlorination of drinking water when chlorine reacts with naturally occurring organic matter. They have been associated with potential health risks, such as increased risk for cancer and reproductive issues.
02

(b) Drawing Lewis Structures of Two Example THMs

To draw the Lewis structures of two example THMs, we will follow these steps: 1. Identify the central atom: The central atom is the carbon atom, as it is bonded to a hydrogen atom and three halogen atoms. 2. Determine the total number of valence electrons: Add the valence electrons of all the atoms in the molecule. Carbon has 4 valence electrons, hydrogen has 1, and halogens typically have 7. 3. Distribute the valence electrons to create bonds and fulfill the octet rule: Place electrons between atoms to create single bonds, and then distribute the remaining electrons to complete the octet around each atom (except hydrogen, which only needs 2 electrons to complete its valence shell). Example 1: Chloroform (CHCl3) 1. Carbon is the central atom. 2. Total valence electrons: 4 (Carbon) + 1 (Hydrogen) + 7*3 (Chlorine) = 26 electrons 3. Distribute electrons: - Place 2 electrons between C-H, and 2 electrons between C-Cl (for each of the three chlorine atoms) to create single bonds. - Carbon has 8 electrons (fulfilled). - Complete the octet for each chlorine atom by adding 6 more electrons, making a complete set of 8. Lewis structure of Chloroform: \(H - C - Cl\) \(-Cl\) \(-Cl\) Example 2: Bromodichloromethane (CHBrCl2) 1. Carbon is the central atom. 2. Total valence electrons: 4 (Carbon) + 1 (Hydrogen) + 7 (Bromine) + 7*2 (Chlorine) = 26 electrons 3. Distribute electrons: - Place 2 electrons between C-H, 2 electrons between C-Br, and 2 electrons between C-Cl (for both chlorine atoms) to create single bonds. - Carbon has 8 electrons (fulfilled). - Complete the octet for bromine and each chlorine atom by adding 6 more electrons, making a complete set of 8. Lewis structure of Bromodichloromethane: \(H - C - Br\) \(-Cl\) \(-Cl\)

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Magnesium ions are remeved in water treatment by the addition of slaked lime, \(\mathrm{Ca}(\mathrm{OH})_{2}\). Write a balanced chemical equation to describe what occurs in this process.

Draw the Lewis structure for the chlorofluorocarbon CFC-11, \(\mathrm{CFCl}_{2}\). What chemical characteristics of this substance allow it to effectively deplete stratospheric ozone?

The organic anion CCCCCC(C)c1ccc(S(=O)(=O)[O-])cc1 is found in most detergents. Assume that the anion undergoes aerobic decomposition in the following manner: $2 \mathrm{C}_{18} \mathrm{H}_{2} \mathrm{SO}_{3}^{-}(a q)+51 \mathrm{O}_{2}(a q) \longrightarrow$ $36 \mathrm{CO}_{2}(a q)+28 \mathrm{H}_{2} \mathrm{O}(l)+2 \mathrm{H}^{+}(a q)+2 \mathrm{SO}_{4}^{2-}(a q)$ What is the total mass of \(\mathrm{O}_{2}\) required to biodegrade $10.0 \mathrm{~g}$ of this substance?

Ferrous sulfate \(\left(\mathrm{FeSO}_{4}\right)\) is often tued as a coagulant in water purification. The iron(II) salt is dissolved in the water to be purified, then oxidized to the iron(III) state by dissolved exygen, at which time gelatinous \(\mathrm{Fe}(\mathrm{OH})_{3}\) forms, assuming the \(\mathrm{pH}\) is abeve approximately 6 . Write balanced chemical equations for the oxidation of \(\mathrm{Fe}^{2+}\) to \(\mathrm{Fe}^{3+}\) by dissolved oxygen and for the formation of \(\mathrm{Fe}(\mathrm{OH})_{3}(s)\) by reaction of \(\mathrm{Fe}^{3+}(a q)\) with \(\mathrm{HCO}_{3}^{-}(a q)\) -

Do the reactions involved in ozone depletion involve changes in oxidation state of the \(\mathrm{O}\) atoms? Explain.

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.