/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 33 Explain why an increasing concen... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Explain why an increasing concentration of \(\mathrm{CO}_{2}\) in the atmosphere affects the quantity of energy leaving Farth but does not affect the quantity of energy entering from the Sun.

Short Answer

Expert verified
An increasing concentration of CO2 in the atmosphere affects the quantity of energy leaving Earth because CO2, as a greenhouse gas, absorbs and traps the infrared radiation emitted by the Earth's surface, preventing it from escaping into space. This leads to an increase in the Earth's temperature, causing global warming and climate change. However, the increasing CO2 concentration does not affect the quantity of energy entering from the Sun, as CO2 has very little effect on the wavelengths of visible light and ultraviolet radiation, which constitute most of the incoming solar energy. As a result, the incoming solar energy passes through the atmosphere without being absorbed or reflected.

Step by step solution

01

Understanding the Greenhouse Effect

The greenhouse effect is a natural process that warms the Earth's surface. It occurs when certain gases in the Earth's atmosphere, called greenhouse gases (GHGs), trap heat. These gases, which include carbon dioxide (CO2), water vapor, and methane, allow sunlight to pass through the atmosphere and reach the Earth's surface. Once sunlight reaches the Earth, it is absorbed, and the Earth's surface and oceans emit infrared radiation (heat). This heat is then trapped by GHGs, keeping the Earth warm and habitable.
02

Explaining the role of CO2 in the Greenhouse Effect

CO2 is one of the most significant greenhouse gases because it is released by many human activities, such as burning fossil fuels and deforestation. When the concentration of CO2 in the atmosphere increases, it results in more heat being trapped by the Earth's atmosphere. This is because CO2 absorbs infrared radiation emitted by the Earth's surface, preventing the heat from escaping into space. The trapped heat increases the Earth's temperature, leading to climate change and global warming.
03

Discussing the energy entering from the Sun

The Earth receives energy in the form of sunlight or solar radiation, emitted by the Sun. This energy is mostly in the form of visible light, ultraviolet (UV), and infrared (IR) wavelengths. Compared to GHGs like CO2, which are primarily responsible for absorbing infrared radiation, the Earth's atmosphere is relatively transparent to visible light and UV. This means that most of the energy from the Sun passes through the atmosphere without being absorbed or reflected.
04

Explaining why increasing CO2 concentration does not affect incoming energy

Although increasing concentrations of CO2 in the atmosphere increases the amount of trapped infrared radiation, it does not affect the amount of energy entering from the Sun. The reason is that CO2 has very little effect on the visible light and UV radiation which constitute most of the incoming solar energy. As a result, increasing CO2 concentration does not influence the amount of sunlight that reaches the Earth's surface. In conclusion, an increasing concentration of CO2 in the atmosphere affects the quantity of energy leaving Earth because it traps more heat, but it does not affect the quantity of energy entering from the Sun because it does not significantly interact with the wavelengths of light that make up most of the incoming solar energy.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Atmospheric CO2 Concentration
When discussing the impact of atmospheric CO2 concentration on Earth's climate, it is pivotal to understand how CO2 molecules interact with energy in the form of radiation. The concentration of carbon dioxide—one of the primary greenhouse gases—has been rising significantly due to human activities, notably the burning of fossil fuels and widespread deforestation.

As CO2 concentration increases, more molecules are available to absorb and emit infrared radiation. This process effectively thickens the 'thermal blanket' surrounding Earth, trapping more heat in the atmosphere. This trapped heat can lead to various consequences, including altered weather patterns, rising sea levels, and biodiversity loss. An essential point to remember is that the change in atmospheric CO2 affects the outgoing infrared radiation but not the incoming solar radiation, a fact underscored by their differing wavelengths.

Understanding this concept allows us to see why balance is critical. Natural carbon cycles maintain this balance, but human-induced CO2 emissions disrupt it, intensifying the greenhouse effect and contributing to global warming.
Infrared Radiation Absorption
The absorption of infrared radiation by greenhouse gases like CO2 is a key player in Earth's energy balance. Infrared radiation is essentially heat emitted by the Earth after it has absorbed sunlight. Not all radiation has the same properties; infrared radiation has longer wavelengths than visible light, placing it just beyond the red end of the visible spectrum.

Greenhouse gases have molecular structures that are capable of vibrating when they absorb infrared radiation, and it's this vibrational energy that generates heat. When CO2 levels rise, the increased absorption of infrared radiation leads to more heat being kept in the Earth's atmosphere rather than escaping into space.

This process influences the temperature of the atmosphere and the surface, but it is crucial to note that not all incoming solar radiation is absorbed. Much of it is actually reflected back into space by clouds, ice, and other reflective surfaces, which forms a part of Earth's albedo—a measure of how much solar energy is reflected by Earth.
Solar Radiation
Solar radiation is the lifeblood of our planet, delivering the energy required to sustain ecosystems, drive weather systems, and maintain global temperatures. This radiation is composed of a range of electromagnetic waves, including visible light, ultraviolet (UV), and infrared (IR) radiation, each with different wavelengths and energy levels.

The Earth's atmosphere acts somewhat like a filter, allowing most visible light to pass through while blocking out a significant portion of harmful UV radiation, thanks to the ozone layer. Unlike greenhouse gases, which absorb infrared radiation emitted from the Earth's surface, the gases in our atmosphere have minimal interaction with the incoming solar radiation.
Without this incoming energy, Earth would be a lifeless, frozen rock. However, with too much absorption of solar energy, the planet would become inhospitably hot. The transparency of the atmosphere to visible light ensures that just the right amount of solar energy reaches the surface to keep our planet warm enough to support the diverse life forms that reside here.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

The average daily mass of \(\mathrm{O}_{2}\) taken up by sewage discharged in the United States is \(59 \mathrm{~g}\) per person. How many liters of water at \(9 \mathrm{ppm} \mathrm{O}_{2}\) are \(50 \%\) depleted of oxygen in 1 day by a population of \(1,200,000\) people?

Alcohol-based fuels for automobiles lead to the production of formaldehyde \(\left(\mathrm{CH}_{2} \mathrm{O}\right)\) in exhaust gases. Formaldehyde undergoes photodissociation, which contributes to photochemical smog: $$ \mathrm{CH}_{2} \mathrm{O}+h_{\mathrm{w}} \longrightarrow \mathrm{CHO}+\mathrm{H} $$ The maximum wavelength oflight that can cause this reaction is \(335 \mathrm{~nm}\). (a) In what part of the electromagnetic spectrum is light with this wavelength found? (b) What is the maximum strength of a bond, in \(\mathrm{kJ} / \mathrm{mol}\), that can be broken by absorption of a photon of 335 -nm light? (c) Compare your answer from part (b) to the appropriate value from Table 8.4. What do you conclude about \(\mathrm{C}-\mathrm{H}\) bond energy in formaldehyde? (d) Write out the formaldehyde photodissociation reaction. showing Lewis-dot structures.

Gold is found in seawater at very low levels, about \(0.05 \mathrm{Ppb}\) by mass. Assuming that gold is worth about \(\$ 1300\) per troy ounce, how many liters of seawater would you have to process to obtain \(\$ 1,000,000\) worth of gold? Assume the density of seawater is \(1.03 \mathrm{~g} / \mathrm{mL}\) and that your gold recovery process is \(50 \%\) efficient.

The rate of solar energy striking Earth averages 168 watts per square meter. The rate of energy radiated from Earth's surface averages 390 watts per square meter. Comparing these numbers, one might expect that the planet would cool quickly, yet it does not. Why not?

The organic anion CCCCCC(C)c1ccc(S(=O)(=O)[O-])cc1 is found in most detergents. Assume that the anion undergoes aerobic decomposition in the following manner: $2 \mathrm{C}_{18} \mathrm{H}_{2} \mathrm{SO}_{3}^{-}(a q)+51 \mathrm{O}_{2}(a q) \longrightarrow$ $36 \mathrm{CO}_{2}(a q)+28 \mathrm{H}_{2} \mathrm{O}(l)+2 \mathrm{H}^{+}(a q)+2 \mathrm{SO}_{4}^{2-}(a q)$ What is the total mass of \(\mathrm{O}_{2}\) required to biodegrade $10.0 \mathrm{~g}$ of this substance?

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.