/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 32 Solve an equilibrium problem (us... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Solve an equilibrium problem (using an ICE table) to calculate the pH of each solution. a. 0.18 M CH3NH2 b. 0.18 M CH3NH3Cl c. a mixture that is 0.18 M in CH3NH2 and 0.18 M in CH3NH3Cl

Short Answer

Expert verified
The pH of a 0.18 M CH3NH2 solution is found using Kb and the ICE table method. For a 0.18 M CH3NH3Cl solution, use Ka with the ICE table. For a mixture of 0.18 M CH3NH2 and 0.18 M CH3NH3Cl, apply the Henderson-Hasselbalch equation, simplifying to pH being equal to pKa due to the equal concentrations of conjugate base and acid.

Step by step solution

01

Identify the Chemical Species and Reactions

For part a, CH3NH2 is a weak base that will react with water to form CH3NH3+ and OH-. Write the reaction equation: CH3NH2 (aq) + H2O (l) ⟶ CH3NH3+ (aq) + OH− (aq). For part b, CH3NH3+ is the conjugate acid of CH3NH2 and will react with water to form CH3NH2 and H3O+. Write the reaction equation: CH3NH3+ (aq) + H2O (l) ⟶ CH3NH2 (aq) + H3O+ (aq). For part c, the reaction will involve both CH3NH2 and CH3NH3+ in an equilibrium with water.
02

Set Up ICE Tables for Each Solution

Construct an ICE (Initial, Change, Equilibrium) table for each solution to track the concentrations of all species involved in the reactions. For CH3NH2 and CH3NH3Cl, assume no initial concentration of products and a 100% initial concentration of the reactants (0.18 M). For the mixture, both CH3NH2 and CH3NH3Cl will be 0.18 M initially.
03

Calculate the pH of the 0.18 M CH3NH2 Solution

For the weak base CH3NH2, write the equilibrium expression: Kb = [CH3NH3+][OH−]/[CH3NH2]. Assuming 'x' is the change in concentration CH3NH2, we can express the concentrations at equilibrium in terms of x. Kb is known from tables or can be calculated if pKb is given. Solve for x, which represents [OH−], and then calculate pOH by taking -log(x). Finally, calculate pH by subtracting pOH from 14.
04

Calculate the pH of the 0.18 M CH3NH3Cl Solution

For the weak acid CH3NH3+, write the equilibrium expression: Ka = [CH3NH2][H3O+]/[CH3NH3+]. Like before, let 'x' be the change in concentration, so x will be equal to [H3O+]. If the Ka of CH3NH3+ is known or can be calculated from pKa, solve for x and then directly calculate pH by taking -log(x).
05

Calculate the pH of the Mixture

Since CH3NH2 and CH3NH3Cl are a conjugate pair, use the Henderson-Hasselbalch equation to calculate the pH: pH = pKa + log([CH3NH2]/[CH3NH3+]). In this case, the ratio of the concentrations of CH3NH2 to CH3NH3+ is 1 (since they are both 0.18 M), simplifying the calculation to pH = pKa, as log(1) = 0.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

ICE Table
The ICE (Initial, Change, Equilibrium) table is a valuable tool for solving equilibrium problems in chemistry. It helps us to visually organize and understand changes in concentrations of reactants and products over the course of a reaction. Initially, you list the initial concentrations of the reactants and products, which, for weak base and acid reactions, typically means the reactants are present and the products are not. During the reaction, the concentrations of the reactants decrease and those of the products increase by a certain amount, which we often denote as 'x'. At equilibrium, you then express the new concentrations of all species.

When setting up an ICE table, careful attention must be paid to stoichiometry and to using proper equilibrium constants. For instance, a reaction starting with 0.18 M CH3NH2 would have an initial concentration of 0.18 M for CH3NH2 and 0 M for CH3NH3+ and OH−. As the reaction proceeds to equilibrium, 'x' amount of CH3NH2 is converted into 'x' amount of CH3NH3+ and OH−, showing the stoichiometric relationship. Understanding this concept is critical in correctly calculating the changes in species concentrations and eventually determining the pH.
Henderson-Hasselbalch Equation
The Henderson-Hasselbalch equation is a simplified method to calculate the pH of a solution when dealing with weak acids or bases, especially when they exist in a buffer system as conjugate pairs. It relates the pH of a solution to the pKa (the negative logarithm of the acid dissociation constant, Ka) and the ratio of the concentrations of the conjugate base and the conjugate acid. The equation is given by:
\[ pH = pKa + \log\left(\frac{[\text{Conjugate Base}]}{[\text{Conjugate Acid}]}\right) \].

For example, when you have a mixture of a weak base and its conjugate acid in equal concentrations, as we do with CH3NH2 and CH3NH3Cl, the logarithmic term becomes zero because the log of 1 is 0. This results in the pH being equal to the pKa. This property of buffers is what makes them so vital in biological systems and industrial processes, where maintaining a stable pH is crucial.
Weak Base and Acid Reactions
The behavior of weak bases and acids in water is quintessential for understanding pH calculations. Unlike strong acids and bases, which dissociate completely in water, weak acids and bases only partially dissociate. This partial dissociation creates an equilibrium condition in the solution. For instance, when CH3NH2 (a weak base) reacts with water, it produces CH3NH3+ and OH− ions, but not all CH3NH2 molecules convert into products. Similarly, the conjugate acid, CH3NH3+, partially dissociates into CH3NH2 and H3O+ ions in water.

Crucially, for weak bases and their corresponding acids, we use the equilibrium constants Kb and Ka, respectively, to quantify how far the reaction proceeds towards the products. These constants are essential parameters that need to be known or calculable in order to find the pH of the solutions concerned. It's important to grasp this concept of partial dissociation because it influences how we set up ICE tables and apply the Henderson-Hasselbalch equation.
Equilibrium Expression
The equilibrium expression for a chemical reaction allows us to relate the concentrations of reactants and products at equilibrium. For weak acid and base reactions, we have the acid dissociation constant (Ka) or the base dissociation constant (Kb). These constants are derived from the ratio of the concentrations of the products to the reactants at equilibrium, raised to the power of their stoichiometric coefficients.

For example, with a weak base like CH3NH2, the equilibrium expression using Kb would be \[ Kb = \frac{[CH3NH3+][OH−]}{[CH3NH2]} \].
Understanding this expression is vital as it enables us to solve for the variables that represent the concentration changes in the ICE table. Also, it is directly involved in the process of calculating pOH and subsequently pH. Equilibrium expressions can vary based on the reaction, but they all follow the same principle of quantifying the position of equilibrium. Bearing in mind how these expressions are constructed and manipulated provides a basis for successfully solving equilibrium problems and calculating pH in various chemical scenarios.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Study anywhere. Anytime. Across all devices.