/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 28 The properties of a plastic are ... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

The properties of a plastic are a consequence of more than just its chemical composition. Name two other features of a polymer chain that can influence its properties.

Short Answer

Expert verified
Molecular weight and crystallinity are two features that influence a polymer's properties.

Step by step solution

01

Consider the Molecular Weight

One feature that can significantly influence the properties of a polymer chain is its molecular weight. Molecular weight affects how the polymer chains interact with each other, influencing the strength, melting point, and elasticity of the material. Generally, as the molecular weight increases, the polymer becomes tougher and more heat resistant.
02

Understand Crystallinity

The degree of crystallinity is another important feature that can impact polymer properties. Crystallinity refers to how the polymer chains are arranged in a structured, orderly fashion. High crystallinity typically means the material will be more rigid, have higher tensile strength, and a higher melting temperature, whereas low crystallinity can result in softer, more flexible materials.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Understanding Molecular Weight in Polymers
Molecular weight is a fundamental characteristic of polymers that plays a crucial role in determining their properties. It refers to the total weight of all the atoms present in a polymer chain. The molecular weight can vary significantly depending on the length of the polymer chains. Longer chains have higher molecular weights, leading to different material characteristics.

As the molecular weight of a polymer increases, several changes in its properties can occur:
  • Strength and Toughness: Higher molecular weight polymers are generally stronger and tougher. The extended length of the chains allows for more entanglements, which enhances the strength.
  • Melting Point: Polymers with higher molecular weight tend to have higher melting points. This is because the stronger intermolecular forces require more heat energy to break.
  • Elasticity: Molecular weight also affects how elastic a polymer can be. Higher molecular weights can improve elasticity, making the material more flexible under stress.
In summary, understanding the molecular weight of a polymer gives insights into its potential applications, from flexible packaging materials to robust engineering plastics.
The Role of Crystallinity in Polymer Behavior
Crystallinity in polymers refers to the degree of structural order within the material. Unlike small molecules, polymers can have both crystalline and amorphous (disordered) regions. The degree of crystallinity profoundly influences a polymer’s physical attributes and overall performance.

Crystalline structures in polymers arise when chains are highly ordered and packed closely together. This can be visualized as neatly stacked bricks forming a stable structure.
  • Rigidity and Strength: High crystallinity tends to increase the rigidity and tensile strength of the polymer. This is because the orderly arrangement allows chains to stick together more tightly.
  • Thermal Properties: Crystalline polymers usually have higher melting points. The tightly packed structure requires more energy to break down upon heating.
  • Optical Clarity: Crystallinity can affect the transparency of a polymer. High crystallinity can cause the material to become opaque due to light scattering, while more amorphous regions might be clearer.
Understanding crystallinity is essential for predicting how a polymer will behave in different environmental conditions, such as temperature fluctuations and mechanical stress.
How Polymer Chains Impact Properties
Polymer chains are the fundamental building blocks of polymer materials. Their configuration, length, and interaction with each other significantly dictate the material properties. Here's how:
  • Chain Length: Longer polymer chains generally mean higher molecular weight, which can enhance toughness and resistance to heat and chemicals.
  • Intermolecular Forces: The forces between polymer chains can range from weak van der Waals forces to strong covalent bonds. These forces determine properties such as melting point and elasticity.
  • Chain Flexibility: Flexible chains can create materials that are more pliable and ductile. Conversely, stiffer chains can lead to brittleness but also increased rigidity.
Interactions between polymer chains can vary widely, from tightly packed crystalline regions to loosely arranged amorphous arrangements. Engineers can manipulate these aspects to tailor polymer materials for specific needs, whether it be for making durable construction materials or lightweight packaging films.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Describe how each of these strategies would be expected to affect the properties of polyethylene. Also provide an explanation at the molecular level for each effect. a. increasing the length of the polymer chain b. aligning the polymer chains with one another c. increasing the degree of branching in the polymer chain

Polyethylene is the most widely used synthetic polymer, but it is not the plastic of choice for margarine containers. Similarly it is not used for soft-drink bottles. Explain.

Here is the structural formula for Dacron, a condensation polyester: CCOCCOC(=O)c1ccc(C(=O)C2CC2)cc1 Dacron is formed from two monomers, one with two bydraxyl groups \((-\mathrm{OH})\) and the other with two carboxylic acids (-COOH). Draw the structural formalas for the alcohol and the acid monomers used to produce Dacron.

Catalysts are used to help control the averagge molar mass of polyethylene, an important strategy to control polymer chain length. During World War II, low pressure polyethylene production used varying mixtures of triethylaluminum, \(A\left(\mathrm{C}_{2} \mathrm{H}_{9}\right)_{3}\), and titanium tetrachloride, \(\mathrm{TiCl}_{4}\), as a catalyst. Here are some data showing how the molar ratio of the two components of the catalyst affects the average molar mass of the polymer produced. \begin{tabular}{lcc} \hline Moles ALC & Moles TiCl & Average Molar Mass of Polymer, \\ \hline 12 & 1 & \(272,00 \times 0\) \\ 6 & 1 & 292,0000 \\ 3 & 1 & 298,0000 \\ 1 & 1 & \(284,00 \times 0\) \\ \(0.63\) & 1 & 160,0000 \\ \(0.53\) & 1 & 40,000 \\ \(0.50\) & 1 & \(21,00 \times 0\) \\ \(0.20\) & 1 & 31,0000 \\ \hline \end{tabular} a. Prepare a graph to show bow the molar mass of the polymer varies with the mole ratio of \(\mathrm{Al}\left(\mathrm{C} \mathrm{U}_{5}\right)_{3} / \mathrm{TiCl}_{4}\) - b. What conclusion can be drawn about the relationship between the molar mass of the polymer and the mole ratio of \(\mathrm{Al}\left(\mathrm{C}_{2} \mathrm{H}_{5}\right)_{3} / \mathrm{TiCl}_{4}\) ? c. Use the graph to predict the molar mass of the polymer if an \(8: 1\) ratio of \(\mathrm{Al}\left(\mathrm{C}_{2} \mathrm{H}_{2}\right)_{3}\) to \(\mathrm{TiCl}_{4}\) were used. d. What ratio of \(\mathrm{Al}\left(\mathrm{C}_{2} \mathrm{H}_{5}\right)_{5}\) to \(\mathrm{TiCl}_{4}\) would be used to produce a polymer with a molar mass of 200,000 ? e. Can this graph be used to predict the molar mass of a polymer if either pure \(\left.A \mathrm{AlC}_{2} \mathrm{H}_{4}\right)_{3}\) or pure \(\mathrm{TiCl}_{4}\) were used as the catalyst? Explain.

. Give two examples each of natural and of synthetic polymers.

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.