/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 2 Polymers sometimes are referred ... [FREE SOLUTION] | 91影视

91影视

Polymers sometimes are referred to as macromolecules. Explain.

Short Answer

Expert verified
Polymers are referred to as macromolecules due to their large size and complex molecular structures.

Step by step solution

01

Define Polymers

Polymers are large molecules composed of many repeating structural units called monomers. These monomers are covalently bonded in a chain-like structure, which allows the polymer to have unique physical and chemical properties.
02

Define Macromolecules

Macromolecules are very large molecules, typically with a molecular mass greater than 1,000 Daltons. They are crucial for biological processes and can include carbohydrates, proteins, nucleic acids, and lipids. The size and complexity of macromolecules make them significant in biological systems.
03

Compare Polymers and Macromolecules

While all macromolecules are not polymers, most polymers are considered macromolecules due to their large size. The repetitive bonding in polymers forms long chains, giving them a high molecular weight and complex structure akin to other macromolecules.
04

Conclusion of the Exercise

Polymers are referred to as macromolecules because they have large molecular masses and complex structures due to repeated monomer units. This size and complexity align with the broader definition of macromolecules.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91影视!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Macromolecules
Macromolecules are essential building blocks for life and are fundamental to the makeup of various biological entities. These enormous molecules consist of interconnected atoms forming complex structures with substantial molecular weights, often exceeding 1,000 Daltons. They play a pivotal role in our bodies and environment.
  • Types of Macromolecules: The four major types are proteins, nucleic acids, carbohydrates, and lipids. Each type serves distinct functions in the body, such as acting as enzymes, storing genetic information, or providing energy.
  • Role in Biology: Macromolecules are involved in virtually every cellular process. Their large size and intricate structures are essential for facilitating complex biological functions, from catalyzing biochemical reactions to forming cellular structures.
Understanding macromolecules provides insights into how living organisms function and adapt to their environments.
Monomers
Monomers are the smaller, basic building units that create polymers through a process known as polymerization. Think of them as the individual beads on a necklace, where each bead represents a monomer, and the complete necklace is the polymer.
  • Formation: Monomers covalently bond together to form long chains, resulting in polymers. This chain formation is the basis for the structural and functional properties of the resulting macromolecule.
  • Examples: Common monomers include amino acids, which build proteins, and nucleotides, which form nucleic acids. Each monomer type has specific properties that contribute to the function of the larger polymer.
The versatility in the combinations and arrangements of monomers allows for an incredible diversity of macromolecule functions.
Covalent Bonds
Covalent bonds are strong chemical bonds that hold monomers together in polymers. These bonds result from the sharing of electron pairs between atoms, providing the stability necessary for macromolecules to maintain their structure.
  • Characteristics: Covalent bonds are characterized by sharing electrons rather than transferring them, leading to strong connections that are critical for the integrity of macromolecules.
  • Role in Polymers: They allow monomers to form stable, sequential chains, essential for the structural stability of both synthetic and natural polymers.
Covalent bonds are, therefore, fundamental to the formation and stability of macromolecules like proteins and DNA.
Chemical Properties
The chemical properties of polymers and other macromolecules are inherently determined by their structures and compositions. These properties influence how macromolecules interact with each other and the environment.
  • Interactivity: Macromolecules' surface charge, polarity, and functional groups determine their interactions, including solubility and reactivity, influencing biological processes.
  • Synthetic vs. Natural: While natural polymers like DNA have evolved highly functional chemical properties, synthetic polymers can be designed with specific properties for targeted applications, such as increased durability or flexibility.
By studying these chemical properties, scientists can develop new materials and improve existing ones, highlighting the versatility and importance of macromolecular chemistry.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Here is the structural formula for Dacron, a condensation polyester: CCOCCOC(=O)c1ccc(C(=O)C2CC2)cc1 Dacron is formed from two monomers, one with two bydraxyl groups \((-\mathrm{OH})\) and the other with two carboxylic acids (-COOH). Draw the structural formalas for the alcohol and the acid monomers used to produce Dacron.

Catalysts are used to help control the averagge molar mass of polyethylene, an important strategy to control polymer chain length. During World War II, low pressure polyethylene production used varying mixtures of triethylaluminum, \(A\left(\mathrm{C}_{2} \mathrm{H}_{9}\right)_{3}\), and titanium tetrachloride, \(\mathrm{TiCl}_{4}\), as a catalyst. Here are some data showing how the molar ratio of the two components of the catalyst affects the average molar mass of the polymer produced. \begin{tabular}{lcc} \hline Moles ALC & Moles TiCl & Average Molar Mass of Polymer, \\ \hline 12 & 1 & \(272,00 \times 0\) \\ 6 & 1 & 292,0000 \\ 3 & 1 & 298,0000 \\ 1 & 1 & \(284,00 \times 0\) \\ \(0.63\) & 1 & 160,0000 \\ \(0.53\) & 1 & 40,000 \\ \(0.50\) & 1 & \(21,00 \times 0\) \\ \(0.20\) & 1 & 31,0000 \\ \hline \end{tabular} a. Prepare a graph to show bow the molar mass of the polymer varies with the mole ratio of \(\mathrm{Al}\left(\mathrm{C} \mathrm{U}_{5}\right)_{3} / \mathrm{TiCl}_{4}\) - b. What conclusion can be drawn about the relationship between the molar mass of the polymer and the mole ratio of \(\mathrm{Al}\left(\mathrm{C}_{2} \mathrm{H}_{5}\right)_{3} / \mathrm{TiCl}_{4}\) ? c. Use the graph to predict the molar mass of the polymer if an \(8: 1\) ratio of \(\mathrm{Al}\left(\mathrm{C}_{2} \mathrm{H}_{2}\right)_{3}\) to \(\mathrm{TiCl}_{4}\) were used. d. What ratio of \(\mathrm{Al}\left(\mathrm{C}_{2} \mathrm{H}_{5}\right)_{5}\) to \(\mathrm{TiCl}_{4}\) would be used to produce a polymer with a molar mass of 200,000 ? e. Can this graph be used to predict the molar mass of a polymer if either pure \(\left.A \mathrm{AlC}_{2} \mathrm{H}_{4}\right)_{3}\) or pure \(\mathrm{TiCl}_{4}\) were used as the catalyst? Explain.

A Tefl on ear bone, fallopian tube, or heart valve? A Gore-Tex implant for the face or to repair a hernia? Some polymers are biocompatible and now used to replace or repair body parts. a. List four properties that would be desirable for polymers used within the human body b. Other polymers may be used outside your body, but in close contact with it. For example, no surgeon is needed for you to use your contact lenses鈥攜ou insert, remove, clean, and store them yourself. From which polymers are contact lenses made? What properties are desirable in these materials? Either a call to an optometrist or a search on the web may provide some answers. c. What is the difference in the material used in 鈥渉ard鈥 and 鈥渟oft鈥 contact lenses? How do the differences in properties affect the ease of wearing the contact lenses?

Cotton, rubber, silk, and wool are natural polymers. Consult other sources to identify the monomer in each of these polymers. Which are addition polymers and which are condensation polymers?

a. What are the structures of the monomers used in SBR synthetic rubber? b. How are natural and synthetic rubber alike, and how do they differ?

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.