/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 36 Draw the condensed formulas for ... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Draw the condensed formulas for each of the following compounds: (a) dipropyl ether (b) 2,2-dimethyl-3-hexanol (c) 2 -ethoxybutane

Short Answer

Expert verified
a) CH3CH2CH2OCH2CH2CH3, b) CH3C(CH3)2CH2CH(OH)CH2CH3, c) CH3CH2OCH2CH2CH3

Step by step solution

01

Drawing the condensed formula for dipropyl ether

First, understand that an ether has an oxygen atom connected to two alkyl groups. In dipropyl ether, both alkyl groups are propyl groups (\(\text{C}_3\text{H}_7\)). Connect them to an oxygen atom: CH3CH2CH2OCH2CH2CH3.
02

Drawing the condensed formula for 2,2-dimethyl-3-hexanol

The compound is a hexanol, indicating a six-carbon chain with an alcohol group (OH). The alcohol is on the third carbon. There are also two methyl groups on the second carbon. The condensed formula is: CH3C(CH3)2CH2CH(OH)CH2CH3.
03

Drawing the condensed formula for 2-ethoxybutane

This compound is an ether with an ethoxy (\(\text{C}_2\text{H}_5\text{O}\)) group attached to the second carbon of a butane (four-carbon chain). The condensed formula is: CH3CH2OCH2CH2CH3.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Organic Chemistry
Organic chemistry is a branch of chemistry that involves the study of the structure, properties, composition, reactions, and synthesis of organic compounds and materials. The term 'organic' refers to a large class of chemical compounds in which one or more atoms of carbon are covalently linked to atoms of other elements, most commonly hydrogen, oxygen, or nitrogen. Because of the immense variety of ways that carbon can bond with itself and other elements, there are millions of different organic compounds. Understanding how to represent the structures of these organic compounds is crucial for students as it lays the foundation for predicting reactivity and properties of organic matter.

Due to its versatility and complexity, mastering organic chemistry is vital for those pursuing careers in chemistry, biology, medicine, pharmacology, and many other scientific and technical fields. In essence, from understanding the molecular basis of life to the development of new pharmaceuticals, organic chemistry plays a central role in the scientific world.
Chemical Structure Representation
The representation of chemical structures in organic chemistry is essential for conveying information about molecular geometry, configuration, and composition. There are various ways to depict chemical structures, each serving a different purpose. The most common types include Lewis structures, skeletal (line-bond) formulas, and condensed chemical formulas.

Condensed chemical formulas, while less detailed than some other representations, offer a balance by showing the connectivity of atoms within a compound without drawing all the bonds explicitly. They are especially useful in text-based communication, like textbooks or exam papers, where space is limited or drawing is impractical. For example, the condensed formula for dipropyl ether, as given in the exercise, is CH3CH2CH2OCH2CH2CH3, which is much more concise than a fully drawn out structural diagram yet still communicates the primary structure of the molecule.

To read and write condensed formulas effectively, students must understand the conventions, such as the grouping of atoms and the implicit assumption that carbon atoms are fully saturated with hydrogen unless indicated otherwise. This skill is crucial for interpreting and constructing organic molecules in both academic and professional settings.
Alkyl Groups
Alkyl groups are important substructures within organic chemistry that consist of carbon and hydrogen atoms, arranged in a chain that is missing one hydrogen atom, allowing it to attach to another atom. They are derived from alkanes by the removal of one hydrogen atom and can be referred to as 'R' in generic formulas representing organic molecules.

There are several common alkyl groups, such as methyl (CH3-), ethyl (C2H5-), propyl (C3H7-), and butyl (C4H9-), which are named based on the number of carbon atoms they contain. For example, dipropyl ether, discussed in the exercise, contains two propyl groups linked by an oxygen atom. Students must learn to recognize these patterns to read, understand, and construct organic molecules more efficiently.

When discussing the chemical properties and reactivity of organic molecules, alkyl groups often play a critical role. They can affect the polarity, boiling points, melting points, stability, and reaction pathways of compounds. Therefore, understanding alkyl groups and their influence on compounds is an integral part of organic chemistry education.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Study anywhere. Anytime. Across all devices.