/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 18 Draw a condensed structural form... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Draw a condensed structural formula for each of the following alkanes: a. 3 -ethylpentane b. 3 -ethyl-2-methylpentane c. 4 -ethyl- 2,2 -dimethyloctane d. 2-bromopropane e. 2,3 -dichloro-2-methylbutane

Short Answer

Expert verified
a. CH3-CH(CH2CH3)-CH2-CH2-CH3b. CH3-CH(CH3)-CH(CH2CH3)-CH2-CH3c. CH3-C(CH3)2-CH2-CH(CH2CH3)-CH2-CH2-CH2-CH3d. CH3-CH(Br)-CH3e. CH3-C(Cl)(CH3)-C(Cl)-CH3

Step by step solution

01

Understand the base structure

Identify the main carbon chain (parent chain) for each given alkane. This is the longest continuous chain of carbon atoms in the molecule.
02

Identify and place the substituents

Locate and place each substituent (groups attached to the parent chain) at the appropriate carbon atom based on the given names.
03

Draw the condensed structural formula for 3-ethylpentane

3-ethylpentane has a five-carbon chain (pentane) as the parent chain with an ethyl group (-CH2CH3) attached to the third carbon: CH3-CH(CH2CH3)-CH2-CH2-CH3
04

Draw the condensed structural formula for 3-ethyl-2-methylpentane

3-ethyl-2-methylpentane has a five-carbon chain (pentane) with an ethyl group at the third carbon and a methyl group at the second carbon: CH3-CH(CH3)-CH(CH2CH3)-CH2-CH3
05

Draw the condensed structural formula for 4-ethyl-2,2-dimethyloctane

4-ethyl-2,2-dimethyloctane has an eight-carbon chain (octane) with an ethyl group at the fourth carbon and two methyl groups at the second carbon: CH3-C(CH3)2-CH2-CH(CH2CH3)-CH2-CH2-CH2-CH3
06

Draw the condensed structural formula for 2-bromopropane

2-bromopropane has a three-carbon chain (propane) with a bromine atom attached to the second carbon: CH3-CH(Br)-CH3
07

Draw the condensed structural formula for 2,3-dichloro-2-methylbutane

2,3-dichloro-2-methylbutane has a four-carbon chain (butane) with chlorine atoms attached to the second and third carbon and a methyl group attached to the second carbon: CH3-C(Cl)(CH3)-C(Cl)-CH3

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

alkanes
Alkanes are a significant class of hydrocarbons in organic chemistry. They consist solely of single-bonded carbon (C) and hydrogen (H) atoms, making them saturated hydrocarbons. This means that each carbon atom in an alkane forms four single covalent bonds, either with hydrogen or with other carbon atoms. Example: Methane (CH4), Ethane (C2H6). Alkanes follow the general formula CnH2n+2. They are named based on the longest carbon chain, with prefixes denoting the number of carbons (e.g., 'meth-' for one carbon, 'eth-' for two, and so forth). The suffix '-ane' indicates all single bonds.
organic chemistry
Organic chemistry is the branch of chemistry that studies the structure, properties, composition, reactions, and synthesis of carbon-containing compounds. Carbon's ability to form long chains and rings with other carbon atoms, along with its capacity to bond with elements like hydrogen, oxygen, nitrogen, and halogens, makes organic compounds incredibly diverse. Key concepts in organic chemistry include understanding functional groups, which are specific atoms or groups of atoms that give characteristic reactivity to organic molecules. Examples of functional groups include hydroxyl (-OH), carbonyl (C=O), and carboxyl (-COOH). These groups determine the physical and chemical properties of organic compounds.
hydrocarbons
Hydrocarbons are organic molecules consisting entirely of carbon and hydrogen atoms. They are the primary constituents of fossil fuels (like oil and natural gas). Hydrocarbons can be classified into several categories: Alkanes (single bonds, CnH2n+2), Alkenes (one or more double bonds, CnH2n), Alkynes (one or more triple bonds, CnH2n-2), and Aromatic hydrocarbons (special stability due to resonance, e.g., Benzene, C6H6). These classes of hydrocarbons exhibit different reactivities and properties.
substituents
Substituents are atoms or groups of atoms that replace hydrogen atoms on the parent chain of a hydrocarbon. In naming substituted alkanes, number the parent chain to give the substituent the lowest possible position. Common substituents include: Methyl (CH3-), Ethyl (C2H5-), and Halogens (like -F, -Cl, -Br). For example, in 3-ethylpentane (CH3-CH(CH2CH3)-CH2-CH2-CH3), 'ethyl' is a substituent on the third carbon of the pentane chain. Understanding substituents is crucial for systematic IUPAC naming of organic compounds.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Write a balanced chemical equation for the complete combustion of each of the following compounds: a. hexane b. cyclopentane, \(\mathrm{C}_{5} \mathrm{H}_{10}\) c. 2 -methylbutane

Match the following physical and chemical properties with ethane, \(\mathrm{C}_{2} \mathrm{H}_{6}\), or sodium bromide, NaBr: a. boils at \(-89^{\circ} \mathrm{C}\) b. burns vigorously in air c. is a solid at \(250^{\circ} \mathrm{C}\) d. dissolves in water

Match each description with a term from the following list: alkane, alkene, alkyne, alcohol, ether, aldehyde, ketone, carboxylic acid, ester, amine, amide, functional group, isomers. a. organic compounds with identical molecular formulas that differ in the order the atoms are connected b. an organic compound in which the hydrogen atom of a carboxyl group is replaced by a carbon atom c. an organic compound that contains an oxygen atom bonded to two carbon atoms d. a hydrocarbon that contains a carbon-carbon triple bond e. a characteristic group of atoms that make compounds behave and react in a particular way f. an organic compound in which the carbonyl group is bonded to two carbon atoms

Identify the class of compounds that contains each of the following functional groups: a. a nitrogen atom attached to one or more carbon atoms b. a carboxyl group c. an oxygen atom bonded to two carbon atoms d. a carbonyl group between two carbon atoms

The density of pentane, a component of gasoline, is \(0.63 \mathrm{~g} / \mathrm{mL}\). The heat of combustion for pentane is \(845 \mathrm{kcal} / \mathrm{mole}\). a. Write the equation for the complete combustion of pentane. b. What is the molar mass of pentane? c. How much heat is produced when 1 gallon of pentane is burned \((1 \mathrm{gal}=4 \mathrm{qt}) ?\) d. How many liters of \(\mathrm{CO}_{2}\) at STP are produced from the complete combustion of 1 gallon of pentane?

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.