Chapter 22: Problem 62
Draw the structural formula for each of the following. a. formaldehyde (methanal) b. 4-heptanone c. 3-chlorobutanal d. 5,5-dimethyl-2-hexanone
Short Answer
Expert verified
a. Methanal (formaldehyde): H-C=O
b. 4-heptanone: CH₃CH₂CH₂C(O)CH₂CH₂CH₃
c. 3-chlorobutanal: ClCHâ‚‚CHâ‚‚CHâ‚‚-C=O
d. 5,5-dimethyl-2-hexanone: CH₃C(O)CH₂CH₂C(CH₃)₂CH₂CH₃
Step by step solution
01
Find the main functional group and backbone
Methanal is an aldehyde, so its functional group is a carbonyl group (C=O) attached to a hydrogen atom. The backbone is only one carbon atom.
02
Draw the structural formula
Put the single carbon atom in the center, attach the carbonyl oxygen atom with a double bond to the carbon, and the hydrogen atom with a single bond to the carbon.
The formula for methanal is H-C=O.
b. 4-heptanone
03
Find the main functional group and backbone
4-heptanone is a ketone with a seven-carbon backbone (heptane) and a carbonyl group at the fourth carbon.
04
Draw the structural formula
Draw a seven-carbon chain. Attach the carbonyl group to the fourth carbon. The other carbons have two hydrogen atoms each.
The formula for 4-heptanone is CH3CH2CH2C(O)CH2CH2CH3.
c. 3-chlorobutanal
05
Find the main functional group, backbone, and other substituent
3-chlorobutanal is an aldehyde with a four-carbon backbone (butane). It has a chloro substituent at the third carbon atom.
06
Draw the structural formula
Draw a four-carbon chain with the carbonyl group (C=O) attached to the first carbon. Attach the chlorine atom to the third carbon.
The formula for 3-chlorobutanal is ClCH2CH2CH2-C=O.
d. 5,5-dimethyl-2-hexanone
07
Find the main functional group, backbone, and other substituent
5,5-dimethyl-2-hexanone is a ketone with a six-carbon backbone (hexane) and a carbonyl group at the second carbon. There are two methyl substituents at the fifth carbon.
08
Draw the structural formula
Draw a six-carbon chain with the carbonyl group attached to the second carbon. Add two methyl groups (CH3) to the fifth carbon.
The formula for 5,5-dimethyl-2-hexanone is CH3C(O)CH2CH2C(CH3)2CH2CH3.
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
Aldehydes
Aldehydes are a class of organic compounds that are characterized by the presence of a carbonyl group (\(\text{C=O}\)) bonded directly to at least one hydrogen atom. This unique feature is what distinguishes aldehydes from other organic compounds containing carbonyl groups.
Aldehydes are typically found at the end of a carbon chain. This is because the carbonyl group in an aldehyde is always bonded to at least one hydrogen atom, meaning it can only be placed at a terminal position within the molecular structure.
A common example of an aldehyde is formaldehyde (also known as methanal), which has the simplest aldehyde structure, consisting of a single carbon atom, to which both a hydrogen atom and a carbonyl group are attached. This simple structure forms the backbone for more complex aldehydes.
Aldehydes are typically found at the end of a carbon chain. This is because the carbonyl group in an aldehyde is always bonded to at least one hydrogen atom, meaning it can only be placed at a terminal position within the molecular structure.
A common example of an aldehyde is formaldehyde (also known as methanal), which has the simplest aldehyde structure, consisting of a single carbon atom, to which both a hydrogen atom and a carbonyl group are attached. This simple structure forms the backbone for more complex aldehydes.
Ketones
Ketones, much like aldehydes, contain a carbonyl group (\(\text{C=O}\)). However, unlike aldehydes, ketones have the carbonyl group bonded to two carbon atoms instead of a hydrogen atom. This structural feature means that ketones are usually found within the interior of a carbon chain rather than at the end.
Ketones are known for their distinctive and often pleasant smells, making them widely used in perfumes and food flavorings. An example of a ketone is 4-heptanone, which has a seven-carbon backbone with the carbonyl group positioned at the fourth carbon atom. This internal placement of the carbonyl group highlights a key defining trait of ketones.
Ketones are known for their distinctive and often pleasant smells, making them widely used in perfumes and food flavorings. An example of a ketone is 4-heptanone, which has a seven-carbon backbone with the carbonyl group positioned at the fourth carbon atom. This internal placement of the carbonyl group highlights a key defining trait of ketones.
Carbonyl Group
The carbonyl group (\(\text{C=O}\)) is a pivotal functional group in organic chemistry, characterized by a carbon atom double-bonded to an oxygen atom. This group plays a crucial role in defining the reactivity and properties of various organic compounds.
The polarity of the carbon-oxygen double bond in the carbonyl group makes it a reactive site in many chemical reactions. The carbon atom in the carbonyl group is electrophilic, while the oxygen atom is nucleophilic, allowing for diverse reactions, especially in synthesis and transformations in organic chemistry.
Aldehydes and ketones both contain the carbonyl group. However, their placement within the molecule alters their chemical behavior and the types of reactions they can undergo, making the carbonyl group a versatile and essential functional group in organic compounds.
The polarity of the carbon-oxygen double bond in the carbonyl group makes it a reactive site in many chemical reactions. The carbon atom in the carbonyl group is electrophilic, while the oxygen atom is nucleophilic, allowing for diverse reactions, especially in synthesis and transformations in organic chemistry.
Aldehydes and ketones both contain the carbonyl group. However, their placement within the molecule alters their chemical behavior and the types of reactions they can undergo, making the carbonyl group a versatile and essential functional group in organic compounds.
Organic Compounds
Organic compounds are the building blocks of life, consisting primarily of carbon atoms bonded to each other and to hydrogen, oxygen, nitrogen, and other elements. They form a vast array of structures, from simple hydrocarbons to complex macromolecules like proteins and DNA.
In organic chemistry, the study often focuses on how these carbon-based compounds can form diverse structures and exhibit a wide range of chemical behaviors. This diversity is due to carbon's ability to form stable covalent bonds with a variety of elements.
Classes of organic compounds are distinguished by specific functional groups. For example, compounds containing carbonyl groups, such as aldehydes and ketones, provide insight into varied structures and reactivity, playing critical roles in both biological processes and industrial applications.
In organic chemistry, the study often focuses on how these carbon-based compounds can form diverse structures and exhibit a wide range of chemical behaviors. This diversity is due to carbon's ability to form stable covalent bonds with a variety of elements.
Classes of organic compounds are distinguished by specific functional groups. For example, compounds containing carbonyl groups, such as aldehydes and ketones, provide insight into varied structures and reactivity, playing critical roles in both biological processes and industrial applications.