/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 44 Write the complete Lewis structu... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Write the complete Lewis structure for each of the following compounds: (a) calcium cyanide; (b) potassium sulfate; (c) ammonium iodate.

Short Answer

Expert verified
For calcium cyanide, Ca features 2 ionic bonds with two CN- groups; for potassium sulfate, K establishes ionic bonds with SO4^2-, with S connected to 4 O; for ammonium iodate, NH4+ bonds ionically with IO3-, with N bonded to 4 H and I attached to 3 O atoms.

Step by step solution

01

Understand Lewis Structures

Lewis structures are diagrams that show the bonding between atoms of a molecule and the lone pairs of electrons that may exist. The structures are drawn using dots to represent the valence electrons and lines to represent bonds between atoms.
02

Calcium Cyanide (Ca(CN)2)

Calcium has 2 valence electrons and tends to lose them to achieve a stable octet. Thus, it forms ionic bonds with cyanide ion (CN-), which has a triple bond between carbon and nitrogen atoms and a single pair of unshared electrons on the nitrogen atom. Since each CN- has a 1- charge and calcium has a 2+ charge, you need two cyanide ions to balance out the charge of one calcium ion, which is reflected in the chemical formula Ca(CN)2.
03

Potassium Sulfate (K2SO4)

Potassium has 1 valence electron and will form an ion with a +1 charge. In sulfate (SO4^2-), sulfur has 6 valence electrons and forms double bonds with two oxygen atoms and single bonds with the other two, each oxygen atom bears two pairs of unshared electrons. Two potassium ions are needed to balance out the charge of the sulfate ion.
04

Ammonium Iodate (NH4IO3)

The ammonium ion (NH4+) is formed by nitrogen with 5 valence electrons, sharing 4 of these with 4 hydrogen atoms, and has a formal positive charge. Iodate (IO3-) consists of iodine with 7 valence electrons, forming double bonds with two oxygen atoms and a single bond with one oxygen atom, each of the oxygen atoms has two pairs of unshared electrons, and the ion carries a negative charge. The positive charge of ammonium ion balances the negative charge of iodate ion.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Chemical Bonding
Chemical bonding is the force that holds atoms together in compounds. This attraction can be quite strong, creating stable associations between atoms that result in the diverse range of substances around us. The way atoms bond and the type of bond formed are crucial to determining the properties of a compound.

When atoms come together in chemical reactions, they do so by either exchanging or sharing their outermost electrons, known as valence electrons. These exchanges or sharing of electrons occur because atoms seek to achieve a more stable electronic configuration, often striving for a full outer shell of electrons, which is a state of lower energy. Stable configurations are often achieved by emulating the electronic structure of noble gases, which are inert and do not typically engage in chemical reactions.

In constructing Lewis structures, we visually capture these bonding processes. These structures serve as a map for understanding the electronic relationships between atoms in a molecule, which is pivotal in predicting molecular properties and reactions.
Valence Electrons
Valence electrons play a pivotal role in chemical bonding; they are the outermost electrons of an atom and are responsible for the chemical properties of the element. In Lewis structures, these electrons are represented as dots that surround the elements' symbols. The main purpose of these structures is to show which electrons participate in bonding, as well as which electrons remain non-bonded or 'lone pairs'.

Every element has a characteristic number of valence electrons that defines its ability to form bonds. For instance, in the context of the given exercise, calcium has 2 valence electrons and tends to lose them to achieve stability, forming ionic bonds. On the other hand, elements like carbon and nitrogen tend to share electrons to fill their valence shells, leading to covalent bonding.

Understanding the count and arrangement of an atom's valence electrons is the first step in predicting how atoms will bond with each other. The Lewis structures that students are asked to draw serve as a valuable tool in visualizing these valence electrons and the potential bonds they can form.
Ionic and Covalent Bonds
Ionic and covalent bonds represent the two primary types of chemical bonds that form between atoms due to the interaction of valence electrons. In ionic bonds, one atom donates valence electrons to another, leading to the formation of positively and negatively charged ions. This donation and acceptance of electrons occur because one atom (typically a metal) has a low electronegativity, and the other (typically a non-metal) has a high electronegativity. The resulting electrostatic attraction between these oppositely charged ions is what constitutes an ionic bond.

Covalent bonds, on the other hand, involve the sharing of valence electrons between atoms. This type of bond often forms between non-metals with similar electronegativities. The shared electrons allow each atom to achieve a full outer shell, thereby gaining stability. Depending on the number of shared electrons, covalent bonds can be single, double, or triple, with single bonds involving two shared electrons, double bonds four, and triple bonds six.

In the exercises provided, the students encounter examples of both ionic and covalent bonds. For instance, calcium cyanide features ionic bonds between calcium ions and cyanide ions. Conversely, in potassium sulfate and ammonium iodate, we see a combination of ionic and covalent bonding, with potassium and ammonium ions forming ionic bonds with polyatomic ions, while within the sulfate and iodate ions, atoms are held together by covalent bonds.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Two Lewis structures are shown below for each species. Determine the formal charge on each atom and then, if appropriate, identify the Lewis structure of lower energy for each species. (a) \(\quad \ddot{O}-\ddot{S}=\ddot{O} \quad \ddot{O}=\ddot{S}=\ddot{O}\) (b) O=S(=O)([O-])S(=O)(=O)[O-]

The perchlorate ion, \(\mathrm{ClO}_{4}^{-}\), is described by resonance structures. (a) Draw the Lewis structures that contribute to the resonance hyhrid and identify the most plawsible Lewis structures by using formal charge arguments. (b) The average length of a single \(\mathrm{Cl}-\mathrm{O}\) bond is 172 pm and that of a double \(\mathrm{Cl}=\mathrm{O}\) bond can be estimated at \(140 \mathrm{pm}\). The Cl-O bond length in the perchlorate ion is found experimentally to be \(144 \mathrm{pm}\) for all four bonds. Identify the most plausible Lewis structures of the perchlorate ion from these experimental data. (c) What is the oxidation mumber of chlorine in the perchlorate ion? Identify the most plausible Lewis structure by using the coxidation number, assuming that lone pairs belong to the atom to which they are attached but that all electrons shared in a bond helong to the atom of the more negative element. (d) Are these three approaches consistent? Explain why or why not.

Determine the formal charges for the atoms in (a) \(\mathrm{CN}^{-}\); (b) \(\mathrm{CNO}^{-}\); (c) \(\mathrm{N}_{3}^{-}\).

Write the complete Lewis structure for each of the following compounds: (a) ammonium chloride; (b) potassium phosphide; (c) sodium hypochlorite.

For each pair, determine which compound has bonds with greater ionic character: (a) \(\mathrm{PH}_{3}\) or \(\mathrm{NH}_{3} ;\) (b) \(\mathrm{SO}_{2}\) or \(\mathrm{NO}_{2}\); (c) \(\mathrm{SF}_{6}\) or \(\mathrm{IF}_{5}\).

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.