Chapter 17: Problem 31
Draw the condensed structural formula for each of the following: a. 1-propanol b. methyl alcohol c. 3 -pentanol d. 2 -methyl-2-butanol
Short Answer
Expert verified
a. CH3CH2CH2OH b. CH3OH c. CH3CH2CH(OH)CH2CH3 d. (CH3)2C(OH)CH2CH3
Step by step solution
01
- Understand condensed structural formulas
Condensed structural formulas show the arrangement of atoms in a molecule without displaying all the bonds. We need to know how to arrange each atom correctly.
02
- Identify the carbon chain
Identify the longest carbon chain for each compound. For example, 1-propanol has a 3-carbon chain (propane).
03
- Identify functional groups
Identify the functional groups and their positions. For instance, 1-propanol has an -OH group attached to the first carbon.
04
- Draw the condensed structural formula for 1-propanol
1-propanol: The longest chain is propane (3 carbons). Attach an -OH group to the first carbon: CH3CH2CH2OH
05
- Draw the condensed structural formula for methyl alcohol
Methyl alcohol (methanol): It consists of one carbon with an -OH group attached. Therefore, the formula is: CH3OH
06
- Draw the condensed structural formula for 3-pentanol
3-pentanol: The longest chain is pentane (5 carbons). Attach an -OH group to the third carbon:CH3CH2CH(OH)CH2CH3
07
- Draw the condensed structural formula for 2-methyl-2-butanol
2-methyl-2-butanol: The longest chain is butane (4 carbons) with a methyl group and an -OH group both attached to the second carbon:(CH3)2C(OH)CH2CH3
Unlock Step-by-Step Solutions & Ace Your Exams!
-
Full Textbook Solutions
Get detailed explanations and key concepts
-
Unlimited Al creation
Al flashcards, explanations, exams and more...
-
Ads-free access
To over 500 millions flashcards
-
Money-back guarantee
We refund you if you fail your exam.
Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!
Key Concepts
These are the key concepts you need to understand to accurately answer the question.
organic chemistry
Organic chemistry is the study of carbon-containing compounds. In this field, we explore a vast array of molecules ranging from simple ones like methane (CH4) to complex macromolecules like proteins and DNA. The unique ability of carbon to form four covalent bonds makes it capable of creating long chains and rings, which serve as the backbone for organic molecules.
Carbon combined with other elements such as hydrogen, oxygen, nitrogen, and halogens creates molecules with diverse properties and functions.
Carbon combined with other elements such as hydrogen, oxygen, nitrogen, and halogens creates molecules with diverse properties and functions.
- Carbon's versatility allows for the formation of single, double, and triple bonds.
- Functional groups are specific groupings of atoms within molecules which have their own characteristic properties.
functional groups
Functional groups are specific clusters of atoms within molecules that are responsible for the characteristic chemical reactions of those molecules. Identifying them is crucial for understanding reactivity and properties. Here are some essential functional groups:
- Hydroxyl group (-OH): Found in alcohols.
- Carboxyl group (-COOH): Found in carboxylic acids.
- Amino group (-NH2): Found in amines.
- Carbonyl group (C=O): Found in ketones and aldehydes.
carbon chain identification
Identifying the carbon chain is one of the first steps in understanding the structure of an organic molecule. The longest continuous chain of carbon atoms is known as the parent chain, and it serves as the backbone of the molecule.
To identify the carbon chain:
To identify the carbon chain:
- Count the number of carbon atoms in the longest continuous chain.
- Use prefixes like 'meth-', 'eth-', 'prop-', 'but-', etc., to denote the number of carbons.
- Methyl alcohol (methanol) has one carbon.
- 3-pentanol has five carbons.
- 2-methyl-2-butanol has a 4-carbon chain with a methyl group on the second carbon.
alcohols
Alcohols are organic compounds characterized by the presence of one or more hydroxyl groups (-OH) attached to a carbon atom. The general formula for alcohols is R-OH, where R represents the alkyl group.
To name alcohols:
To name alcohols:
- Identify the longest carbon chain containing the -OH group.
- Number the carbon chain starting from the end closest to the -OH group.
- 1-propanol: A three-carbon chain with an -OH group on the first carbon, CH3CH2CH2OH.
- Methyl alcohol (methanol): A one-carbon alcohol, CH3OH.
- 3-pentanol: A five-carbon chain with an -OH group on the third carbon, CH3CH2CH(OH)CH2CH3.
- 2-methyl-2-butanol: A four-carbon chain (butane) with a methyl group and an -OH group on the second carbon, (CH3)2C(OH)CH2CH3.