/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 5 The following synthetic route wa... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

The following synthetic route was used for the initial synthesis of fexofenadine \(\left(\mathrm{R}=\mathrm{CO}_{2} \mathrm{H}\right)\) - an analogue of terfenadine \(\left(\mathrm{R}=\mathrm{CH}_{3}\right)\). The synthesis was suitable for the large-scale synthesis of terfenadine, but not for fexofenadine. Suggest why not. (Hint: consider the electronic effects of R.) [R]C(C)(C)c1ccc(C(=O)CCCCl)cc1 [R]C(C)(C)c1ccc(C(=O)CCC[N+](=O)[O-])cc1

Short Answer

Expert verified
The electron-withdrawing nature of \\(\mathrm{CO}_2\mathrm{H}\\) in fexofenadine hinders key reactions compared to the electron-donating \\(\mathrm{CH}_3\\) in terfenadine, affecting large-scale synthesis.

Step by step solution

01

Identify the Functional Groups

In both terfenadine \(\left(\mathrm{R} = \mathrm{CH}_3\right)\) and fexofenadine \(\left(\mathrm{R} = \mathrm{CO}_2\mathrm{H}\right)\), there is a key functional group attached to the aromatic ring. For terfenadine, R is a methyl group \(\mathrm{CH}_3\), and for fexofenadine, R is a carboxylic acid \(\mathrm{CO}_2\mathrm{H}\). These groups have significant electronic and steric differences.
02

Consider Electronic Effects

The methyl group \(\mathrm{CH}_3\) in terfenadine is electron-donating, which can stabilize intermediate carbocations during the synthesis process. In contrast, the carboxylic acid group \(\mathrm{CO}_2\mathrm{H}\) in fexofenadine is electron-withdrawing. This can destabilize certain intermediates, making reactions such as electrophilic aromatic substitution less favorable in fexofenadine.
03

Evaluate Steric Effects

The difference in size and electronic environment between the methyl group \(\mathrm{CH}_3\) and the carboxylic acid group \(\mathrm{CO}_2\mathrm{H}\) can also affect synthesis. The bulky, more polar \(\mathrm{CO}_2\mathrm{H}\) group might hinder certain approaches to the aromatic ring and prevent efficient large-scale synthesis as used for terfenadine.
04

Conclusion Based on Functional Group Differences

The electronic and steric differences between \(\mathrm{CH}_3\) and \(\mathrm{CO}_2\mathrm{H}\) imply that the synthesis route suitable for terfenadine may not work for fexofenadine. The electron-withdrawing nature of \(\mathrm{CO}_2\mathrm{H}\) provides a less favorable environment for key reaction steps compared to the electron-donating \(\mathrm{CH}_3\), limiting synthetic efficiency.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Functional Groups
Functional groups are specific groups of atoms within molecules that have characteristic properties and reactivity. In the context of fexofenadine and terfenadine synthesis, the difference between these two compounds begins with the functional group attached to the aromatic ring. Terfenadine features a methyl group \(\mathrm{CH}_3\), which is simple in structure. In contrast, fexofenadine contains a carboxylic acid group \(\mathrm{CO}_2\mathrm{H}\), which is more complex.

These groups are crucial as they determine the behavior of the compound in reactions. The methyl group, being non-polar and electron-donating, contributes differently to the chemical environment compared to the carboxylic acid, which is polar and electron-withdrawing. This key difference in functional groups significantly affects the overall synthesis and chemical properties of each compound.
Electronic Effects
Electronic effects involve the influence of atoms or groups within a molecule on its electron distribution. Such effects are important when considering reaction mechanisms in medicinal chemistry.

During the fexofenadine synthesis, the carboxylic acid group \(\mathrm{CO}_2\mathrm{H}\) plays a critical role as an electron-withdrawing group. This property can lead to destabilization of reaction intermediates, particularly in electrophilic aromatic substitution reactions. Whereas in terfenadine, the methyl group \(\mathrm{CH}_3\) donates electrons and stabilizes positive charges due to its +I inductive effect.

These variances mean that reactions suitable for terfenadine's synthesis might be inefficient for fexofenadine due to different stabilization and favorability factors.
Steric Effects
Steric effects are related to the physical space that atoms or groups occupy, affecting how molecules interact during reactions. They are significant because they can either hinder or facilitate molecular interactions.

In the synthesis of fexofenadine, the bulky carboxylic acid group \(\mathrm{CO}_2\mathrm{H}\) presents a steric challenge compared to the smaller methyl group \(\mathrm{CH}_3\) in terfenadine. This bulkiness can obstruct the approach of reactants or catalysts, slowing or preventing reactions from proceeding efficiently.

This factor is often a major reason why synthetic routes need adjustment when switching from one functional group to another, as seen between fexofenadine and terfenadine.
Synthetic Route
A synthetic route is a planned sequence of chemical reactions aimed at producing a specific compound. The route must consider various factors, including the chemical properties of the involved functional groups.

The original route for the synthesis of terfenadine is less effective for fexofenadine due to the presence of a carboxylic acid group. This changes both the electronic and steric environment. Therefore, chemists must often adapt or redesign these routes to account for changes in molecule structure.

Optimization of the synthetic route may involve altering reaction conditions, such as solvents, catalysts, or temperatures, to accommodate the demanding reactivity profile of the new functional group.
Fexofenadine Synthesis
Fexofenadine synthesis presents unique challenges due to the molecule's functional and electronic properties. It is derived as an analogue of terfenadine but requires a more tailored approach due to its carboxylic acid group.

Unlike terfenadine, where the synthesis benefits from a more stable reaction environment, fexofenadine's synthesis needs special conditions to mitigate destabilizing electronic effects. Researchers must employ innovative strategies to manage these side reactions and optimize yields.

Ultimately, the goal is to achieve an efficient and practical synthetic route for large-scale production, considering both safety and cost-effectiveness. This demonstrates how a deep understanding of functional groups and their effects is critical in medicinal chemistry.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Study anywhere. Anytime. Across all devices.