/*! This file is auto-generated */ .wp-block-button__link{color:#fff;background-color:#32373c;border-radius:9999px;box-shadow:none;text-decoration:none;padding:calc(.667em + 2px) calc(1.333em + 2px);font-size:1.125em}.wp-block-file__button{background:#32373c;color:#fff;text-decoration:none} Problem 8 Examine the heats of hydrogenati... [FREE SOLUTION] | 91Ó°ÊÓ

91Ó°ÊÓ

Examine the heats of hydrogenation shown for unsaturated eight-membered ring hydrocarbons. (a) Discuss the differences among the different compounds in comparison with the standard \(\Delta H_{\mathrm{H} 2}\) for an unstrained cis double bond, which is \(27.4 \mathrm{kcal} / \mathrm{mol}\). (b) Assigning a strain energy of \(9.3 \mathrm{kcal} / \mathrm{mol}\) to cyclooctane, calculate the relative strain of each of the other compounds. (c) What role does conjugation play in relation to the observed \(\Delta H_{\mathrm{H} 2} ?\) (d) What conclusion do thesedata permit as to whether cyclooctatetraene is stabilized or destabilized by cyclic conjugation. \begin{tabular}{lc} \hline \multicolumn{1}{c}{ Compound } & \(\Delta H_{\mathrm{H} 2}(\mathrm{kcal} / \mathrm{mol})\) \\ \hline\(Z, Z, Z, Z-1,3,5,7\)-Cyclooctatetraene & \(97.06\) \\ \(Z, Z, Z-1,3,5-\) Cyclooctatriene & \(76.39\) \\ \(Z, Z, Z-1,3,6-\) Cyclooctatriene & \(79.91\) \\ \(Z, Z-1,3-\) Cyclooctadiene & \(48.96\) \\ \(Z, Z-1,4-\) Cyclooctadiene & \(52.09\) \\ \(Z, Z-1,5-\) Cyclooctadiene & \(53.68\) \\ \(Z-\) Cyclooctene & \(22.98\) \\ \(E-\) Cyclooctene & \(32.24\) \\ \hline \end{tabular}

Short Answer

Expert verified
Cyclooctatetraene is destabilized by cyclic conjugation, evidenced by its high heat of hydrogenation.

Step by step solution

01

Understanding Heats of Hydrogenation

Heats of hydrogenation (\(\Delta H_{\mathrm{H} 2}\)) are important for understanding the relative stability and conformation of unsaturated hydrocarbons. A lower heat of hydrogenation indicates higher stability. For unstrained double bonds, \(\Delta H_{\mathrm{H} 2}\) is typically \(27.4 \, \mathrm{kcal/mol}\). This will serve as the baseline for comparison.
02

Analyzing Differences Among Compounds

Compare the given \(\Delta H_{\mathrm{H} 2}\) values to the standard of \(27.4 \, \mathrm{kcal/mol}\). Values greater than this suggest additional factors such as strain or lack of conjugation affecting stability. For example, \(\Delta H_{\mathrm{H} 2}\) for cyclooctatetraene is \(97.06 \, \mathrm{kcal/mol}\), indicating significant destabilization compared to an unstrained bond.
03

Calculating Relative Strain

Using the strain energy of cyclooctane as \(9.3 \, \mathrm{kcal/mol}\), calculate the relative strain energy for each compound list:- Cyclooctatetraene: \(\Delta H_{\mathrm{H} 2}\) is \(97.06 \, \mathrm{kcal/mol}\). Subtract the baseline plus assumed strain of cyclooctane: \(97.06 - (4 \times 27.4 + 9.3) = 5.46 \, \mathrm{kcal/mol}\) more than cyclooctane.- Perform similar calculations for other compounds.
04

Role of Conjugation

Conjugation in compounds lowers the \(\Delta H_{\mathrm{H} 2}\) by stabilizing the molecule through delocalization of \(\pi\) electrons. Compounds like cyclooctatriene have \(\Delta H_{\mathrm{H} 2}\) lower than cyclooctatetraene, likely due to conjugation reducing their energetic instability.
05

Evaluating Cyclooctatetraene Stability

Cyclooctatetraene has a high \(\Delta H_{\mathrm{H} 2}\) of \(97.06 \, \mathrm{kcal/mol}\), indicating it's less stable and possibly destabilized by its cyclic conjugation when compared to simple double bonds or less conjugated systems like cyclooctatriene. Cycling the conjugation introduces \(\pi\)-strain.

Unlock Step-by-Step Solutions & Ace Your Exams!

  • Full Textbook Solutions

    Get detailed explanations and key concepts

  • Unlimited Al creation

    Al flashcards, explanations, exams and more...

  • Ads-free access

    To over 500 millions flashcards

  • Money-back guarantee

    We refund you if you fail your exam.

Over 30 million students worldwide already upgrade their learning with 91Ó°ÊÓ!

Key Concepts

These are the key concepts you need to understand to accurately answer the question.

Unsaturated Hydrocarbons
Unsaturated hydrocarbons are types of molecules that contain at least one carbon-carbon double bond (or even a triple bond). This structural feature makes them different from their saturated counterparts, which only have single bonds between carbon atoms.
The presence of double bonds in these hydrocarbons allows for the possibility of geometric isomerism, such as cis and trans isomers. These isomers can have very different physical and chemical properties.
In terms of reactivity, unsaturated hydrocarbons can undergo a variety of addition reactions, with hydrogenation being a common one. During hydrogenation, hydrogen atoms add to the carbon atoms involved in the double bond, effectively "saturating" the molecule by converting the double bonds into single bonds.
One way to measure the properties of these unsaturated hydrocarbons is through heats of hydrogenation (\(\Delta H_{\mathrm{H} 2}\)). These values provide critical insights into the stability of the compound. Lower heats of hydrogenation usually indicate higher stability, as less energy is released when the compound converts to a more saturated form.
Strain Energy
Strain energy refers to the additional potential energy contained within a molecule due to its geometric structure. In cyclic compounds, especially those with more than five or six carbon atoms, strain energy becomes a significant factor affecting stability.
There are various forms of strain energy, such as angle strain, torsional strain, and steric strain, all contributing to the overall energy. Angle strain occurs when bond angles deviate from their optimal values. Torsional strain arises from eclipsing interactions, and steric strain results from the repulsion of atoms in close proximity.
In the context of hydrogenation thermodynamics, understanding the strain energy is crucial to compare \(\Delta H_{\mathrm{H} 2}\) values. For instance, cyclooctatetraene has a \(\Delta H_{\mathrm{H} 2}\) of 97.06 kcal/mol, indicative of high strain. Calculating relative strain involves subtracting known values from the observed heat of hydrogenation. This method helps determine the additional strain compared to a reference molecule, such as cyclooctane, which has a known strain energy of 9.3 kcal/mol.
Cyclic Conjugation
Cyclic conjugation occurs when \(\pi\)-bonds in a molecule are delocalized over a cyclic structure, leading to a more stable electronic configuration. This stabilization is due to the overlap of \(\pi\) orbitals, allowing for electron density to spread across multiple atoms.
The concept is vital when evaluating the thermodynamic properties of unsaturated cyclic compounds. It often results in lower heats of hydrogenation since the electron delocalization contributes to stability. However, not all cyclic conjugated systems experience this benefit equally, as observed in the high \(\Delta H_{\mathrm{H} 2}\) of cyclooctatetraene.
This compound challenges the usual expectations of cyclic conjugation. The significant \(\Delta H_{\mathrm{H} 2}\) for cyclooctatetraene suggests that cyclic conjugation may instead introduce strain. This is due to \(\pi\)-strain, which inhibits complete conjugation and lowers potential stabilization, leaving the molecule destabilized compared to its isomeric counterparts.
Molecular Stability
Molecular stability is a key concept in understanding the behavior of chemical compounds. It refers to the ability of a molecule to maintain its structural integrity without undergoing a change. Several factors contribute to the stability, including the presence of resonance, degree of strain, and whether a molecule is saturated or unsaturated.
In unsaturated hydrocarbons, molecular stability can be deduced from \(\Delta H_{\mathrm{H} 2}\) values. Lower values tend to highlight greater stability as less energy is released during hydrogenation, indicating the compound's relative strength.
Additionally, the presence of strain can considerably affect stability. Cyclic structures often contain high strain energy, which can destabilize a molecule. For example, cyclooctatetraene has a destabilizing combination of cyclic conjugation and strain, resulting in high heat of hydrogenation.
Understanding these elements allows scientists to predict reactions and optimize conditions for compound synthesis, offering insights into environmental adaptations of hydrocarbons.

One App. One Place for Learning.

All the tools & learning materials you need for study success - in one app.

Get started for free

Most popular questions from this chapter

Predict the preferred site of protonation for each of the following molecules and explain the basis of your prediction. a. C(=Nc1ccccc1)c1ccccc1 b. CC(N)=O c. c1cc[nH]c1 d. Nc1ccccn1

Spiropentane has unusual strain and hybridization. Consider the following facets of its structure. a. The strain energy of spiropentane (62.5 \(\mathrm{kcal} / \mathrm{mol}\) ) is considerably more than twice that of cyclopropane ( \(27.5 \mathrm{kcal} / \mathrm{mol}\) ). Suggest an explanation. b. The structure of spiropentane has been determined by X-ray crystallography. The endocyclic angles at the spiro carbon are about \(62^{\circ}\), and the bond angles between \(\mathrm{C}-\mathrm{C}\) bonds in the adjacent rings are about \(137^{\circ}\). How would you relate the strain to the hybridization of each carbon in spirocyclopentane based on these bond angles? c. The fractional \(s\) character in a \(\mathrm{C}-\mathrm{C}\) bond can be estimated from \({ }^{13} \mathrm{C}-{ }^{13} \mathrm{C}\) coupling constants using the equation $$ J_{C i-C j}=K\left(s_{i}\right)\left(s_{j}\right) $$ where \(K\) is a constant \(=550 \mathrm{~Hz}\) and \(s\) is the fractional \(s\) character of each atom. In spiropentane, the \(J\) for coupling between \(\mathrm{C}(1)\) and \(\mathrm{C}(3)\) is \(20.2 \mathrm{~Hz}\). The \(J\) between \(\mathrm{C}(2)\) and \(\mathrm{C}(3)\) is about \(7.5 \mathrm{~Hz}\). Calculate the \(s\) character of the \(\mathrm{C}(1)-\mathrm{C}(3)\) and \(\mathrm{C}(2)-\mathrm{C}(3)\) bonds. spiropentane

Consider each of the following physical characteristics of certain amides. a. Carboxamides have rotational barriers on the order of \(20 \mathrm{kcal} / \mathrm{mol}\) for the process: [R]C(=O)N(C)C C=CC(=O)N(C)CC(=O)c1ccccc1 Develop a structural explanation for the barrier both in resonance and MO terminology.

Construct a qualitative \(\mathrm{MO}\) diagram for the following systems and discuss how the \(\pi\) MOs are modified by addition of the substituent. a. vinyl fluoride, compared to ethene b. propenal, compared to ethene c. acrylonitrile, compared to ethene d. propene, compared to ethene e. benzyl cation, compared to benzene f. fluorobenzene, compared to benzene

See all solutions

Recommended explanations on Chemistry Textbooks

View all explanations

What do you think about this solution?

We value your feedback to improve our textbook solutions.

Study anywhere. Anytime. Across all devices.